Na2SO4+NaI=NaI+NaSO4 Balanced equation: Ionic equation:

Question

Question

Na2SO4+NaI=NaI+NaSO4

Balanced equation:

Ionic equation:

science chemistry

Answer 1

Answer #1

Answer 2

Similar Homework Help Questions

Na2SO4+(NH4)2CO3=Na2CO3+(NH4)2SO4 Balanced equation: Ionic equation: Net ionic equation:

Na2SO4+(NH4)2CO3=Na2CO3+(NH4)2SO4 Balanced equation: Ionic equation: Net ionic equation:
AgNO3+NaSO4 molecular equation and net ionic equation

AgNO3+NaSO4 molecular equation and net ionic equation
Na2SO4+Pb(NO3)2=Na2(NO3)2+PbSO4 Balanced equation: Ionic equation:

Na2SO4+Pb(NO3)2=Na2(NO3)2+PbSO4 Balanced equation: Ionic equation:

Help me solve and understand this 3 Balanced Reaction - CaCl2(aq) + Complete Ionic Equation: Net Ionic Reaction Bala...

Help me solve and understand this 3 Balanced Reaction - CaCl2(aq) + Complete Ionic Equation: Net Ionic Reaction Balanced: Na2CO3 (aa) 4 Balanced Reaction - H₂SO4 (aq) + NaOH (aa) → Complete Ionic Equation: Net Ionic Reaction Balanced (5) Balanced Reaction _HCl(aq) + NaOH (as) Complete Ionic Equation: Net ionic Reaction Balanced: (6) Balanced Reaction -NH₂ NO3(aq) + Na2SO4 (99) Complete Ionic Equation: Net Ionic Reaction Balanced: 6 Balanced Reaction AgNO3(aq)+ NaBr (aq) → Complete Ionic Equation: Net Ionic Equation...
Complete and balance the molecular equation for the reaction of aqueous sodium sulfate, Na2SO4,Na2SO4, and aqueous...

Complete and balance the molecular equation for the reaction of aqueous sodium sulfate, Na2SO4,Na2SO4, and aqueous barium nitrate, Ba(NO3)2.Ba(NO3)2. Include physical states. molecular equation: Na2SO4(aq)+Ba(NO3)2(aq)⟶Na2SO4(aq)+Ba(NO3)2(aq)⟶ Enter the balanced net ionic equation for this reaction. Include physical states. net ionic equation:
What is the molecular, complete ionic, and net ionic equation for Na2SO4 + CuCl2?

What is the molecular, complete ionic, and net ionic equation for Na2SO4 + CuCl2?

Write the balanced molecular equation, the balanced ionic equation, and the balanced net ionic equation for...

Write the balanced molecular equation, the balanced ionic equation, and the balanced net ionic equation for the reaction of an aqueous solution of nickel (II) bromide with an aqueous solution of ammonium sulfide.
The net ionic equation for the reaction of calcium bromide (CaBr2) and sodium sulfate (Na2SO4) is...

The net ionic equation for the reaction of calcium bromide (CaBr2) and sodium sulfate (Na2SO4) is shownbelow. Ca2+(aq) + SO4 2–(aq) -> CaSO4(s) (a) What are the spectator ions in this reaction? Hint: they are not involved in the reaction. (b) Write the full balanced equation for this reaction with the () to indicate physical states. (c) What type of reaction is this? (Hint: forming some favored substances) (d) If a mineral sample containing CaBr2 is mixed with Na2SO4 to...
Write a balanced equilibrium equation for the dissolution of NaI in water. Include phases.

Write a balanced equilibrium equation for the dissolution of NaI in water. Include phases.

Question 7 2.5 pts In the balanced molecular equation for the neutralization of sodium hydroxide with...

Question 7 2.5 pts In the balanced molecular equation for the neutralization of sodium hydroxide with sulfuric acid, the products are: NaSO4+H2O Na S + 2H20 Na2SO4 + 2H20 2NaSO4+H20 NaSO3 + 2H20 Question 8 2.5 pts