Analyze the reaction provided then select all organic molecules that could serve as the starting materials.


Analyze the reaction provided then select all organic molecules that could serve as the starting materials....
Select all the possible reaction conditions that would enable
the transformation of the starting material(s) into the
product(s).
Question 2 2 pts Select all the possible reaction conditions that would enable the transformation of the starting material(s) into the product(s) ? OCH3 OH a) H2SO4(cat), CH3OH b) work-up a) PBr3, solvent b)work-up a) NaOH, H2O b) work-up a) H2SO 4(cat), H20 b) work-up a) SOCI2, CH30H b) work-up
Question 2 2 pts Select all the possible reaction conditions that would...
Select all the possible reaction conditions that would enable
the transformation of the starting material(s) into the
product(s).
Question 10 2 pts Select all the possible reaction conditions that would enable the transformation of the starting material(s) into the product(s) CI a) 1-butylamine, pyridine b) work-up a) butyl-1,4-diamine, pyridine b) work-up a) H2SO4 (cat.), pyridine b) work-up a) Pyrrolidine, pyridine b)work-up a) Pyridine b) work-up
Question 10 2 pts Select all the possible reaction conditions that would enable the transformation...
Question 3 2 pts Select all the possible reaction conditions that would enable the transformation of the starting material(s) into the product(s) CI CI a) NaOCH(CH3)2, solvent b) work-up a) Ethanol, pyridine b)work-up a) NaOH, Methanol b) work-up a) H2SO4(cat), Ethanol b) work-up a) Isopropanol, pyridine b) work-up
Select the major organic product(s) that are formed in the following reaction: a) Diethylmalonate, NaOEt b) H2SOalcat), H0, HEAT Br Br c) work-up Br HO HO OH OH OH ai 10. A Br HO OH OH C D E
Select the major organic product(s) that are formed in the following reaction: a) Diethylmalonate, NaOEt b) H2SOalcat), H0, HEAT Br Br c) work-up Br HO HO OH OH OH ai 10. A Br HO OH OH C D E
Establish what is the starting material(s) for the reaction and
draw a full mechanism for the following reactions:
Establish what is(are) the starting material (s) for the reactions, and draw a full mechanism for the ing reaction. a) NaOH, H2O, HEAT b) work-up Draw a mechanism that explains the formation of the product under the given reaction conditions a) NaOH, H2O b) work-up OH
Establish what is(are) the starting material (s) for the reactions, and draw a full mechanism for...
Answer the following 5
questions:
1. What is(are) the
starting material(s) in the reaction below?
2. Determine the
stereochemistry of the following alkenes.
3. What is (are) the
product(s)?
4. Select the correct
drawings of the elimination product(s) formed by treating the
starting material with a base.
5. Indicate how many
unsaturations does this molecule have?
Quiz CH 7 (10 points) CHEM 333 1. What is (are) the starting material(s) in the reaction below? (CH).COH CH, - HCHC=C- =CH-CH- (2...
Supply products or reagents. If more than one organic product
forms, you must write both products. If stereo- or regiochemistry
is important, you must show that. Incorrect regio- or
stereochemistry will not receive credit. If no reaction is
possible, write N.R.
a. CECH peroxides, M heat or ho y heat or ho Clin 9. CH3CH2CH2CH2CHO H2SO4 b. 3,3-dimethylbut-1-yne - cat. HgSO4 H2SO4, H2O cat. Os04 NMO 1. BH3-SMez 2. H2O2, NaOH (CH3)3 SICI OH Et;N, CH2Cl2 ON=0 OH HomoH Mor...
Consider the below general Fischer Esterification reaction.
Which intermediate(s) are formed during the mechanism? Select all
that apply.
Question 1 2 pts Consider the below general Fischer Esterification reaction. Which intermediate(s) are formed during the mechanism? Select all that apply. R2OH Cat. H2SO4 R1 R1 OR2 OH ОН R1 Он -OH R1 R2 .H -OH R1 R2 OH HT R1 H R2 I H. OR2 Ri -OH R1 R2 R1 OH H R2
For each of the following reactions supply the missing starting
material(s) or final organic product(s) in the bobxes provided.
HO Ph 1) LiAlH4 2) H20 Me Me Mel Br2 H30 1) PBr3, Br2 2) H20 OH excess NaOH 1) excess Br2 2) H30 Reaction Name:
starting with only 1-propanol as your ONLY organic starting material, come up with a reaction scheme to produce: CH3-CH2-C(=0)-O-CH2-CH2-CH3 As your final product Show all work