Calculate the molar mass of (NH4)2SO4

Question

Question

science chemistry

Answer 1

Answer #1

(NH4)2504 Nitrogen Atomic mass = 14.0x2= 28 Hydrogen Atonia maus - 1.08 8 =8 Sulphur Atomic mas = 32.06 X 1 = 32.06 Oxygen At

Answer 2

Similar Homework Help Questions

Calculate the mass of 0.00456 moles of (NH4)2SO4

Calculate the mass of 0.00456 moles of (NH4)2SO4
what is the molar concentration of NH4+ ions in a 3.1 M solution of (NH4)2SO4?

what is the molar concentration of NH4+ ions in a 3.1 M solution of (NH4)2SO4?
what is the molar concentration of NH4+ lions in a 3.1 M solution of (NH4)2SO4

what is the molar concentration of NH4+ lions in a 3.1 M solution of (NH4)2SO4

Calculate the molality of a 20.0% by mass ammonium sulfate (NH4)2SO4 solution. The density of...

Calculate the molality of a 20.0% by mass ammonium sulfate (NH4)2SO4 solution. The density of the solution is 1.117 g/mL.
The boiling point of an aqueous 1.83 m (NH4)2SO4 (molar mass = 132.15 g/mol) solution is 102.5°C. Determine the value of...

The boiling point of an aqueous 1.83 m (NH4)2SO4 (molar mass = 132.15 g/mol) solution is 102.5°C. Determine the value of the van't Hoff factor for this solute if the Kb for water is 0.512°C/m. Answer's 2.7 but I have no idea how to solve for this, can someone show me how to solve with LOTS of steps? Thanks.
rank the following fertilizers in decreasing order of mass percentage of nitrogen KNO3 (NH4)H2PO4 (NH4)2SO4 NH4NO3...

rank the following fertilizers in decreasing order of mass percentage of nitrogen KNO3 (NH4)H2PO4 (NH4)2SO4 NH4NO3 NH3 (NHO4)2HPO4

what mass of (nh4)2so4 must be mixed with 55.0kg of Kno3 to produce a fertilizer that...

what mass of (nh4)2so4 must be mixed with 55.0kg of Kno3 to produce a fertilizer that has 15.4 mass% nitrogen
What mass of (NH4)2SO4 must be mixed with 70.0 kg of KNO3 to produce a fertilizer...

What mass of (NH4)2SO4 must be mixed with 70.0 kg of KNO3 to produce a fertilizer that has 18.1 mass % nitrogen?
Chemical reaction: (NH4)2SO4 (aq) + 2KOH (aq) > k2SO4 (aq) + 2NH3 (g) + H2O (l)...

Chemical reaction: (NH4)2SO4 (aq) + 2KOH (aq) > k2SO4 (aq) + 2NH3 (g) + H2O (l) Collected in 100.00 mL flask, 25.0 C. complete the table, find for each one using molar masses (NH4)2SO4 , KOH , K2SO4 , NH3 amount before rxn: 50.0 mL of 0.111 M , 50.0 mL of 0.200M solution, moles before rxn: moles after rxn: amount after rnx (in M):

Na2SO4+(NH4)2CO3=Na2CO3+(NH4)2SO4 Balanced equation: Ionic equation: Net ionic equation:

Na2SO4+(NH4)2CO3=Na2CO3+(NH4)2SO4 Balanced equation: Ionic equation: Net ionic equation: