

4.2 Which of the following is not another representation for isopentane? H a. CH2CH2-C-CH3 C. CH2CH2CH(CH3)2...
Give the following compounds there IUPAC name? Thank you
in advance!
e. (CH2CH2)3CCH(CH3)CH2CH2CH3 f. CH2CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)2CH3 g. (CH3CH2CH2)4C
1. MCPBA 2. H, H20 CH(CH3)2 H3CH2C- OH H- OH CH2CH3 CH(CH3)2 CH(CH3)2 CH(CH3)2 HECH,C- OH HOCH,CH, HOCHCH, HOH HOH H- OH CH2CH2 C H2CH3 CH2CH3 A. I and II B. III and IV c. I and IV D. II and III E. I and 111
CH3 6. Assign IUPAC names for each of the following compounds: d) CHS-C-CH3 CH₂CH3 CH2CH2 C H2CH2CH3 CH3-CH2-CH2-C-CH2-CH2-C-CH3 H2 CH₂ CH₂ H CH2CH3
Which of the following reactions will produce the molecule shown below? CH3(CH2)3–0–—CH, CH3 CHCH2)3 + HOẠC–CH2CH, CH2CH2)3-0–CH + H2C-CH3 CH3 (CH2)3-OH + HO—C—CH2CH3 CH3(CH2)3-OH + HC-CH2CH3
1.
2.
3.
H3C CH2CH3 0% CH3 CH2CH(CH32 Hc CH2CH2CH Which of the alkenes above is the least stable (highest in energy)? |--I Which is the most stable (lowest in energy)? Submit Answer Retry Entire Group 4 more group attempts remaining
give the compound name
= 0 CH3-CHY-CH2-CH2CH3 H3C-CH2-CH3 = H3C-CH2-CH2-CH2CH2-CH3 H2C=CH2 = H-C=C-CH3 = = H3C-CH2-CH2-OH = H2C=CH-CH2-CH2-CH3 = H3C-CH2-CH2-CH3 H3C-CH=CH-CH3 = = CH3-OH = CH3-CH2-OH = CH3-CH2-CH2-CH2-OH = CH3-CH-CH2-CH2-CH2-CH3 = 64 CH3-CH2-CH2-CH2-CH-OH = CH3-CH-CH2-CH, = H3C-CH2-C=0 H.C-CH2-CH2-CH2-C=0 HC-OH = H3C-CHCH2-f-OH H,C-CH2-COH
please provide nomenclature for a through j. thanks!
Nomenclature Provide the IUPAC name for the following a. CHỊCH-CH(CH3)CH2CH(CHO)CH, C. (CH3)3CCH2C(CH3)3 d. C(CH3)4 f. CH3C(CI)2CH(CH3)2 h. (CH2CH2)2CHCH(CH3)CH2CH3 j. CH2CH(CH3)CCCH2CH3
Rank the following conformation in order of increasing energy. Put the lowest first. CH2CH3 CHCH HH-CH2CH, HOCH CH H.CH C HC CH CHE CH₂CH3 HCH,C1 CH2CH CH3 CH2CHE CH,CH CA<C<D<B O C<A<B<D CC<A<D<B A<C<B<D
Which is the correct product for the following reaction?
Which is the correct major monobromination product for the
following reaction?
9) Which is the correct product for the following reaction? (1 mark) H CH2CH3 H- Br H ci+H. + NaNz (excess) DMSO Í I CH2CH3 HEN H- H N3+H " CHCH HEN3 CH2CH3 HH AN3 CH2CH3 H Br HH HNz HTH CH2CH3 NgH HTH HEN CH CH3 CH3 CH3 CH3 CH3 10) Which is the correct major monobromination product for...
1. Give IUPAC names for the following compounds: (b) CH2C=CCH2C=CCH2CH3 CH3 CH3CH2C=CCCH CHE (d) (c) CH3 CH3 CH2CH=CC=CCHCH3 CH3 HCCCCH2C=CH CH₂ (e) H2C=CHCH=CHCECH (1) CH2CH3 CH3CH2CHCECCHCHCH, CH₂CH₂ CH₂ 2. Give the IUPAC names for each of the following: 3. Without consulting tables, arrange the following compounds in order of decreasing acidity: 1-Pentene Pentane 1-Pentanol 1-Pentyne