i. Write half reaction
ii. Balance oxygen by adding water
iii. Balance hydrogen by adding H+
iv. Balance the charge by adding electrons
v. Balance the electrons
vi. Add both equation to cancel out common terms

Question 17 Write a balanced chemical equation for the oxidation of chromium metal with nitric acid....
Balance the following oxidation-reduction equation. The reactions occur in acidic or basic aqueous solution, as indicated. a. Co2+ + H2S +Co+Ss (acidic) O Co2+ +8H2S + 2Co + S8 + 16H+ O8Co2+ + 8H,8 + 8Co+Sg + 16+ Co2+ + 8H2S + 2Co + S8 b. S + Bry + SO 2 + Br” (basic) OS? + 4Br2 + 80H 8Br + SO4 + 4H2O O $2 + 4Br2 + 4H20 +8Br” + SO4 + 8H+ Os + 4Br2 +...
In many species, a transition metal has an unusually high or low oxidation state. Write a balanced equation (including states) for the following and find the oxidation state (e.g., +2) of the transition metal in the product: Iron(III) ion reacts with hypochlorite ion in basic solution to form ferrate ion (FeO,,cr, and water Include the states of all reactants and products in your equation. 3- 2Fe (aq) +100H (ag) 3C10 (ag)-3C! (aq) 2Fco. (aq) +31 (aq) +5H,01) Oxidation state of...
Write a balanced chemical equation for the reaction of aqueous solutions of potassium sulfide and nitric acid. a) K2S(aq) + 2HNO3(aq) > H2S(g) +2 KNO3(aq) b) K2S(aq) + 2HNO3(aq) > S(s) +H2(g) + 2KNO3(aq c) K2S(aq) + HNO3(aq) > HS(g) + K2NO3(aq) d) K2S(aq) + 2HNO3(aq) > 2K(s) + H2(g) + S(NO3)2(g) e) K2S(aq) + 2HNO3(aq) > 2KH(aq) + S(NO3)2(g)
Part A Write the overall balanced equation for the reaction. 2+ Sn(a)Sn (aq) ||NO (g)NO, (aq), H (ag) Pt(e) (ag) +2 NO(a) + W0) 3 Sn(s) +NO3 (aq)+8H (aq)3Sn O Sn(a)+2 NO (aq)+ 4H* (aq)Sn (aq) + NO(a) + 2 H,0) O 3 Sn(s)+2 NO, (aq) +8H (aq) 3 Snt (ag) +2NOa)+4H,00) Sn(s)+NO3 (aq) +4H (aq) Sn (a4) + NO() +211,00) Request Answer Submit Part B Calculate Ecell VO AXD ? Ell V Request Answer Submit
com/mv Problem 20.51 K3 of3 Part G Write balanced chemical equation for the oxidation of Fe (a?) by VO (aq) Fe (ag)eFe (aq) Ered +0.77v S2O% (ag) + 4H (aq) +2e -2H,SO (aq) N20(9) +2H (a)+2eN2(9) H20(U) Part H Calculate AG for this reaction at 298 K k.J 45 PM 5/B/2018 O Type here to search
1. Write a balanced chemical equation for the oxidation of zinc metal (Zn) by copper(II) ions (Cu?") in a copper sulfate solution. Note that copper(II) sulfate completely dissociates in aqueous solution and forms Cu2+ (aq) and SO,- (aq) in water. Zinc metal is a solid and should be represented as Zn (3) Write a chemical equation for the decomposition of limestone (CaCO,) by heating to high temperature to drive off carbon dioxide. The other product of this decomposition reaction is...
I'd
like the answers for 22-25. on 25 there is a fifth option of 49.9g
C2H4O2, C6H1206 Question 22 (2 points) The diagram represents a mixture of S atoms and O2 molecules in a closed container =s 00 =0 Select the diagram that shows the results after the mixture reacts as completely as possible according to the equation: 25 + 302 → 2503 О 20 alo Jestion 23 (2 points) 25.5 mL aliquot of HCl (aq) of unknown concentration was...
Balance the following chemical equations. Write the word "Balanced" if the equation is already balanced. a) 2 H2(g) + O2(g) → 2 H20(1) b) 2NH3(g) + H2SO4(90) → (NH4)2SO4(94) Decomposition Reactions a) 2H2O2(0) → 2 H2O(l) + O2(g) b) "Balanced" CaCO3(s) → "Balanced" CaQ/s) + "Balanced" CO2(g) Single Displacement Reactions a) Mg(s) + 2HCl(aq) → MgCl2(aq) + H2(g) b) 2Nas) + 2H2O(1) ► 2NaOH(aq) + H2(g double Displacement Reactions a) AgNO3(aq) + NaCl(aq) → AgCl(s) + NaNO3(aq) “Balanced" b) H2SO4(aq)...
16) Write a balanced net ionic equation for the reaction of H2SO4iag) with Ba(OH)2(g) A) Ba2+(ag) + SO42-(a)- BaSO4) B) 2 H+(aq) SO42-(a) Ba2 (ag) +2 OH-(a)-BaSO4(0 2 H20) C) H2SO4(a) + Ba(OH)2(e) - BaSO40) 2 H20() D) H (ag) OH(ag)--H2O) 16) 17) Write a balanced net ionic equation for the reaction of Pb(NO3)2(ag) with Nal(ag). A) Pb2 (ag)+2 NO3-(4g) +2 Na+ (ag) +2 1-(a4)-- Pb2+(ag)+ 2 1-(a4)+ 2 Na (a) +2 NO3-(a) B) Pb2+(ag) 2 NO3-(a) + 2 Na...
Question 1 (1 point) Reaction of chromium metal with phosphoric acid produces chromium(lI) phosphate and hydrogen gas. Select the correct balanced equation O2Cr(s)+2H3PO4laq)-- 2CrPO4(s)+6H(g) O2Cr(s)+2H3PO4laq)--2CrPO4(s)+3H2(g) O3Cr(s)+3H3PO4(aq)--Cr3(PO4]3(s)+3 H2{g) O2Cr(s)+2H3PO3(aq)--2CrPO3(s)+3H2(g) Question 2 (1 point) Methane gas (CH4) reacts with steam (H20 (g)) to produce hydrogen gas and carbon monoxide gas. Select the correct balanced equation. OCHalg) +H20(g) -- 6H(g)+CO(g) O2CH4(8)+H20(g)- 3H2(g)+2CO(g) OCH4(8) +H20(g) - 3H2(g)+CO(g) OCH4(8) +2H208)-- 4H2{g)+CO2{g) Question 3 (1 point) When the following equation is balanced using the smallest possible...