


The cell diagram for the lead-acid cell that is used in automobile and truck batteries is...
The standard half-cell reactions of lead acid battery is: 2) Half-cell reduction reaction form: red 1.69 +4Ht +so +2ePbSO4,()+2H2O) РЬОог.0) Red (aq) -Ox. PbSO4.()+2e Pb)+SO -0.36 4.(aq) Pb()+PbO2.(s)+2H2SO4.(ag) Tot. 2PBSO4.()+ 2H20() 2.05 a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery. I b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference potential?
The standard half-cell reactions of lead acid battery is: 2) ЕФN Half-cell reduction reaction form: red PbOo2.(s) 4H+ + so2 4, (aq) PbSO4,()+2H20 Red 2e 1.69 Рo) + So?- 4.(aq) -Ox -0.36 Pbs04.(s)2e Pb()PbO2,(s)+ 2H2SO4,(ag) 2P6SO4.(6) +2H20D 2.05 Tot. a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference...
Problem 2 (chapter 18.3, 2 points): The lead-acid battery is commonly used in cars. One electrode is a lead grid filled with spongy lead Pb(s). The other electrode is a lead grid filled with spongy lead oxide PbO2(s). The net reaction that occurs is: Pb(s)+PbO (s+2H(aq) 2HSO (aq) ->2PbSO4(s2H 0(0) a) Write down the half reactions that occur at each electrode. b) Identify the oxidation state of Pb in each of the species: Pb(s), PbO2(s) and PbSO4(s). Explain. c) Identify...
Use the following lead-acid battery cell to answer the related questions: PbO2 (s) │PbSO4 (s) │H2SO4 (aq) (1 M) ‖ H2SO4 (aq) (1 M)│Pb (s) │PbSO4 (s) A. (5 pts) Determine the Cell potential for the battery at 25°C B. (5 pts) A high output alternator for a KIA soul can produce 220 Amp current. How long would it take to recharge/reform 4.03 kg of Pb at that rate (assuming your battery is near dead)?
Consider a voltaic (galvanic) cell with the following metal electrodes. Identify which metal is the cathode and which is the anode, and calculate the cell potential. (Use the table of Standard Electrode Potentials.) (a) Ca(II) and Sc(III) Cathode: . Ca(II) Sc(III) Anode: Ca(II) Sc(III) Ecell = 0.0591 x V (b) Pb(II) and In(III) Cathode: . Pb(II) In(III) Anode: Pb(II) In(III) Ecell - (c) Ni(II) and Zr(IV) Cathode: NI(II) Zr(IV) Anode: Ni(II) Zr(IV) Ecell - V Supporting Materials Periodic Table Supplemental...
Candidate l: Zn(s) | Zn2+(aq,0.500 M) I Cu2+(aq, 1.00 M) Cu(s) Candidate 2: Pb(s) | Pb2+(aq, 0.500 M) || Cu2+(aq, 1.00 M) Cu(s) Candidate 3: Mg(s) | Mg2+(aq, 0.500 M) | Pb2+(aq, 1.00 M)| Pb(s) (a) 6 pts) Choose one of the candidate voltaic cells #1, #2, or #3. Draw a schematic cell diagram for the candidate voltaic cell of choice. Clearly label anode, cathode, electrodes, ions and their concentrations, salt bridge, and the flow of electrons. (b) (5 pts)...
solve all please and only one per question just for me to get
the idea
9.18 Use the standard potentials of the electrodes to calculate the standard potentials of the cells in Exercise 9.17. 9.19 Devise cells in which the following are the reactions. In each case state the value for v to use in the Nernst equation. (a) Fe(s)+PbS04(aq) FeSO4(aq) + Pb(s) (b) Hg2Cl2(s) H2(g) 2 HCl(aq) +2 Hg(I) + 9.20 Use the standard potentials of the electrodes to...
i need help with all of these questions
Chem 103A Electrochemistry 5. A voltaic cell is to be constructed using the Ag/Ag half cell and the Pb/Pb half-cell. Measurement shows that the silver electrode is positive. a) Write balanced half-reactions and the overall spontancous reaction, without using a table of half-cell potentials. b) Diagram the cell, labeling electrodes as anode and cathode, labeling the salt bridge, showing what ions are in solution, and showing the direction of electron flow in...
need help with 8,9,10, and 11
Chem 103A Electrochemistry 8. Consider a voltaic cell that uses the reaction Cu(s) + 2Fe'(aq) - Cr"(aq) + 2Fe""(aq) What is the potential of a cell at 25°C that has the following concentrations? [Fe'') - 1.0x 10M (Cu)-0.25 M [Fe] =0.20 M 9. Lead can displace silver from solution, and as a consequence, silver is a valuable by-product in the industrial extraction of lead from its ore: Pb(s) + 2 Ag" (aq) → Pb...
(20%) Problem 1: Standard automobile batteries have six lead-acid cells in series, creating a total emf of 12.0 V. A What is the emf of an individual lead-acid cell in V? V= Grade Summary Deductions 0% Potential 100% Late Work % 100% Late Potential 100% HOME E sin() cotan atan cosh cos) tan asin acos acotan() sinh) tanh() cotanh Degrees Radians ( 7 8 | | 4 | 5 * 1 2 0 V BACKSPACE 9 6 3 . Submissions...