Question

6. Na SO4, Ba(OH)2 - SO42- + Ba2+ → BaSO4 7. NaOH, Ba(OH)2 Set #4. 1. FeCl3, CO(NO3)2 2. FeCl3, COCI2 3. FeCl3, NaOH 4. FeCl3 write balanced equations and create a matrix ions charts
Sheet1 Column 1 Column 2 Column 3 Column 4 Column 5 Column6 MATRIX OF IONS Column 1 Column 2 Column 3 Column4 Column 5 Column
0 0
Add a comment Improve this question Transcribed image text
Answer #1

Matrix of ions : - it is also called Crm cross method. KB Ay By : 99:- Acts 50,- :. Al,(504), . . . 2 Matrix of ions: column

Add a comment
Know the answer?
Add Answer to:
write balanced equations and create a matrix ions charts 6. Na SO4, Ba(OH)2 - SO42- +...
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Not the answer you're looking for? Ask your own homework help question. Our experts will answer your question WITHIN MINUTES for Free.
Similar Homework Help Questions
  • 16) Write a balanced net ionic equation for the reaction of H2SO4iag) with Ba(OH)2(g) A) Ba2+(ag)...

    16) Write a balanced net ionic equation for the reaction of H2SO4iag) with Ba(OH)2(g) A) Ba2+(ag) + SO42-(a)- BaSO4) B) 2 H+(aq) SO42-(a) Ba2 (ag) +2 OH-(a)-BaSO4(0 2 H20) C) H2SO4(a) + Ba(OH)2(e) - BaSO40) 2 H20() D) H (ag) OH(ag)--H2O) 16) 17) Write a balanced net ionic equation for the reaction of Pb(NO3)2(ag) with Nal(ag). A) Pb2 (ag)+2 NO3-(4g) +2 Na+ (ag) +2 1-(a4)-- Pb2+(ag)+ 2 1-(a4)+ 2 Na (a) +2 NO3-(a) B) Pb2+(ag) 2 NO3-(a) + 2 Na...

  • help with thes 12. In the reaction, K2SO4(99) + Ba(NO3)2(aq) + BaSO4(s) + 2 KNO3(aq), which...

    help with thes 12. In the reaction, K2SO4(99) + Ba(NO3)2(aq) + BaSO4(s) + 2 KNO3(aq), which ions are the spectator ions? a. Ba2+ and SO42- b. Ba2+ and K+ c. Ba2+ and NO3 d. K+ and SO42- e. K+ and NO3 13 Which is the net ionic equation for the reaction which takes place when HCl(ag) is added to KOH(aq)? a. HCl(aq) + KOH(99) KCl(aq) + H2O(1) b. H(aq) + OH(aq) + H2O(1) c. HCl(aq) + OH(aq) + Cl(aq) +...

  • 2,3,&4 2) Write a balanced net ionic equation for the reaction of H2SO4(ag) with Ba(OH)2(aq) A)...

    2,3,&4 2) Write a balanced net ionic equation for the reaction of H2SO4(ag) with Ba(OH)2(aq) A) 2 H+ (aq) + SO42-(aq) + Ba2+ (aq) + 2 OH-(aq) --BaSO4(s) + 2 H2001) B) Ba2+ (aq) + SO42-(aq) -BaSO46) C) H2SO4(aq) + Ba(OH)2(aq) -BaSO4(s) + 2 H20(1) D) H+ (aq) + OH+(aq) +2001 3) Write a balanced net ionic equation for the reaction of AgNO3(aq) with Cu(s). A) 2 AgNO3(aq) + Cu(s) - 2 Ag(s) + CUNO3(aq) B) AgNO3(aq) + Cu(s) -Ag(s)...

  • Soluble Ions 1. Cations 2. Anions Empirical Solubility Rules The presence of these ions tend to...

    Soluble Ions 1. Cations 2. Anions Empirical Solubility Rules The presence of these ions tend to make the ionic compound water soluble (note exceptions). Ions Exceptions (compounds are insoluble despite having these cations) Li", Na, K, Exceptions = Li,Co, and LigPO4 NH Exceptions (compounds are insoluble Ious despite having these anions) NO,, nitrate ion No exceptions, all nitrates are water soluble C₂H₂O₂: No exceptions, all acetates are water soluble No acetate ion CIO4, CIO3. No exceptions, all perchlorate and chlorate...

  • Write balanced and net equations NiCl2 + Na2CO3 NiCl2 + NH Br Ba(OH)2 + HCI Ba(OH)2...

    Write balanced and net equations NiCl2 + Na2CO3 NiCl2 + NH Br Ba(OH)2 + HCI Ba(OH)2 + NaCO3 Ba(OH)2 + NH Br HCl + Na.Co HCl + NH Br Na,CO, + NH Br

  • For all of the following experiments, under standard conditions, which species could be spontaneously produced? A...

    For all of the following experiments, under standard conditions, which species could be spontaneously produced? A lead wire is placed in a solution containing Cu2+ yes no  Cu yes no  PbO2 yes no  No reaction Crystals of I2 are added to a solution of NaCl. yes no  I- yes no  No reaction yes no  Cl2 A silver wire is placed in a solution containing Cu2+ no yes  Cu no yes  No reaction no yes  Ag+ Half-Reaction 8° (V) Half-Reaction 8° (V) 2.87 1.99 1.82 1.78 1.70 1.69 1.68 1.60...

  • please write legible 1. Identify each of the following reactions as a precipitation reaction, an acid-base...

    please write legible 1. Identify each of the following reactions as a precipitation reaction, an acid-base reaction, or as a redox reaction + a. Pb(NO3)2 (aq) + 2 HCl(aq) PbCl (s) + 2 HNO, (aq) b. 2 Hxe + O2 + 2 H2O c. HNO, (aq) + KOH(aq) KNO, (aq) + H20 (1) d. Zna + 2HCl(a) - ZnClaraq) + Halle e. Ba?'(aq) + 2 Br(aq) + 2 Na(aq) + SO/"(aq) BaSO. (s) + 2 Na'(aq) + 2 Br" (aq)...

  • What is the activity coefficient of H in a solution containing 0.073 M HCI and 0.0090...

    What is the activity coefficient of H in a solution containing 0.073 M HCI and 0.0090 M Ca(CIO,)? Activity coefficients at various ionic strengths can be found in this table. Y = What is the pH of this solution? pH Charge +/-1 H* Activity coefficient (y) 900 (CaH5i2CHCO2, (C3H7)4N* (02N)3CH20",(C3H7) NH*, CH3OgH4Co2 0.967 0.933 0.914 0.96 800 0.966 0.931 0.83 0.912 0.85 0.82 700 0.965 0.930 0.909 0.845 0.81 L CeHsCO2, HOC H4CO, CICeH4CO, CsHgCH2C02 CH2-CHCH2CO2(CH3)2CHCH2CO2, (CH3CH2)4N, (C3H7)2NH2+ 600 0.965...

  • Candidate l: Zn(s) | Zn2+(aq,0.500 M) I Cu2+(aq, 1.00 M) Cu(s) Candidate 2: Pb(s) | Pb2+(aq,...

    Candidate l: Zn(s) | Zn2+(aq,0.500 M) I Cu2+(aq, 1.00 M) Cu(s) Candidate 2: Pb(s) | Pb2+(aq, 0.500 M) || Cu2+(aq, 1.00 M) Cu(s) Candidate 3: Mg(s) | Mg2+(aq, 0.500 M) | Pb2+(aq, 1.00 M)| Pb(s) (a) 6 pts) Choose one of the candidate voltaic cells #1, #2, or #3. Draw a schematic cell diagram for the candidate voltaic cell of choice. Clearly label anode, cathode, electrodes, ions and their concentrations, salt bridge, and the flow of electrons. (b) (5 pts)...

  • if you can't answer all ,please don't answer 1) of the reactions below, which one is...

    if you can't answer all ,please don't answer 1) of the reactions below, which one is a decomposition reaction? A) Ca(NO3)2 + Na2S -- CdS +2NaNO3 B) NH4Cl- NH3 + HCI C) 2Mg + 02 - 2MgO D) 2N2 + 3H2 → 2NH3 E) 2CH4 + 402 - 2002 + 4H20 miches of - x 1? 2 2) Calculate the percentage by mass of ammonia in cisplatin, PtCl2/NH3 12. A) 12.53 B) 5.68 C) 18.09 D) 11.35 E) 4.67 3)...

ADVERTISEMENT
Free Homework Help App
Download From Google Play
Scan Your Homework
to Get Instant Free Answers
Need Online Homework Help?
Ask a Question
Get Answers For Free
Most questions answered within 3 hours.
ADVERTISEMENT
ADVERTISEMENT