
Complete these SN2 reactions: X Incorrect. (9) NH + CH3(CH2).CHCI + C1- ethanol Edit (b) Edit...
x Incorrect. H2O+ -CH3 Edit OH Practice the Skill 19.15 Draw the major product for each of the following reactions: * Incorrect [H] NH -H2O Conceptual Checkpoint 19.22 Predict the product of the two-step procedure below: X Incorrect. 1) (H+). H2N-NH2, -H2O 2) KOH/H,O, heat Edit SHOW HINT X Incorrect. || 2,2,5,5-tetramethylcyclopentanal
= CH3 OH Aqueous =O HO- O=O=O CH3 acetone +NH 2. b a + H2NNH2 s NH, C . a = Proton transfer b = Lewis acid/base c= Radical chain substitution d = Electrophilic addition e=E1 Elimination f=E2 Elimination g=Sn1 Nucleophilic substitution h=Sn2 Nucleophilic substitution Identify the mechanism by which each of the reactions above proceeds from among the mechanisms listed. Use the letters a - i for your answers. 1.
7) What is the product of the following reactions? NaBHA ethanol A) CH3CH2CH2CH2CH=CH2 C) CH3CH2CH2CH2CH2CH3 B) CH3CH2CH2CH2CH2C02H D) CH3CH2CH2CH2CH2CH2OH 8) 8) The reaction of a Grignard reagent with a ketone followed by dilute acid gives a(n) A) primary alcohol. B) ester. C) tertiary alcohol. D) secondary alcohol.
Post Lab questions 1. Complete the following reactions and name the products. a) CH3 -CH=CH2 CI + b) + Bry c) CH3 -CH=CH-CH3 + HBE Pt d) CH3 -CH2-CH=CH2 + H 25 °C, 1 atm e) + Brz 2. Toluene contains a benzene ring with three double bonds in it, but still does not show any signs of undergoing a reaction with bromine solution. Why? 3. Why doesn't cyclohexane decolorize the orange-red color of the bromine or the purple color...
LES BELOW FOR QUESTIONS 23-28. CH3 F. CH2-CH2-C J. СН 3-C-OH H. NH2-C-NH2 G. CH3-CH2 9 CH3 K. CH3 -CH2-CH2-c M. CH3-CH-CH3 L. CH3-C-O-C H3 NH2 N.0%-O- (CH2)5-CMg P. CH3-C-CH3 S. CH3-CH2-N CH3-CH-CH3 CH3 CH3 CH3-CH2-C-CH 3 CH3 Х. V. W. CH3-CH-CH-CH2-CH2-CH2 CH3 -CH- CH2 CH2-CH3 C2Hs CH3-CH- C-CH2-CH3 AA. -(CH 2- CH)- Z. -(CH2-CH) CH3-CH2-CH-CH3 CH3 он но AB. -(CH2 - CH)- Ac.-|-o-(CH 2)40-C-N-(CH2)6N-C- 23. Which molecule would produce a ketone when oxidized? a. F b. G c. J...
5. Complete the following triacylglycerol reactions: a. Complete Hydrogenation: CH2-0-C-(CH3)-CH-CH (CH)s-CH CH-0-C-(CHỊhCH=CH-(CHỊ) -CH, + 3H, Ni, CH2-0-º-(CH3)-CH=CH-(CHỊ) -CHỊ b. Partial Hydrogenation: CH-0-C-(CH2)-CH-CH-(CH3)-CH; CH-0-C-(CH2)-CH-CH-CH2-CH3 + 2H, N . CH-0-C-(CH3)-CH=CH-(CH3-CH c Acid Hydrolysis: CH2-0-C-(CH3)-CH=CH-(CH3)-CH, -0-C-(CH); -CH=CH-CH2)-CH3 + 3H. 0 . 10 CH2-0-C-(CH2)2CH=CH-(CH2)s -CH; d. Saponification: CH2-0-C-(CH3)-CH=CH-CH2)-CH CH-0-C-(CH)-CH=CH-CH3)-CH+ 3NaOH Heat CH2-0-C-(CH)-CH-CH-CH2-CH,
9. What is the final product of the following sequence of reactions? 13. Arrange the following compounds in order of decreasing adidity CH PB Mg Eto 011 CHCI 10. Methanolysis of 4-bromo-2-methyl-2-pentene gives two isomeric substitution products, one of which is shown. What is the other substitution product? B с CH,OH Isomer 14. Benzalacetone is the crossed aldol condensation product formed between betaaldehyde and acetone. Draw the structure of benzalacetone. OCH, 11. Which of the following has the largest for...
need help with question 8 9 10
Part B. Silver Nitrate in Ethanol (Sul mechanisms) 7. Write an Spi mechanism with curved arrows for the general reaction. Make sure you draw out the bond-line structures to show mechanism. (CH),CCI + CH3CH2OH (CH3),OC,Hs + HCI - Stor-) CH3 CH2 - HEc6+ HC ct cus CHO-H HC - c-o-qus - HCl + H₂4-1 s church 8. a) What is the formula of the precipitate that indicates a reaction has taken place? He...
b) CH, CH2 CH CH Br + SH — CHZ CH3 CH, CH, CH, Br + SH" — c) (polar protic solvents) CH, Br + (CH3)3N CH, Br + (CH3)3P - — d) CH, I + CN- - DMF CHZI + CNC CH3CH20H e) CH I + OH- - CHZI + CH, CO2- (6) 14. Place 1º, 2º, 3º and Methyl carbocations in order from least stable to most stable. What factor(s) account for the stability of the most stable...
please answer for me all questions 1-20
1) Identify the alkyl halide that reacts the fastest in a Sn2 reaction. A) chloromethane B) 2-chloro-2-methylpropane C) 2-chlorobutane D) 1-chlorobutane 2) Identify the alkyl halide that reacts the fastest in an SN 2 reaction. A) 1-bromopropane B) 1-fluoropropane C) 1-chloropropane D) 1-iodopropane 3) Which of the following alkyl halides gives the slowest SN2 reaction? A) CH3CH2C1 B) Ci CH3CCH2CH3 CH3 C) CH3CHCH2CH3 CH2 CH3CHCHCH3 C1 СН3 4) Which of the following alkyl...