Question

Open with Google Docs The reaction to the right describes the isomerization of dihydroxyacetone phosphate (DHAP) to glycerald
Vinegar is about 0.83 M acetic acid (HCH.COO) in water. Acetic acid reacts with water according to the following reaction: HC
0 0
Add a comment Improve this question Transcribed image text
Answer #1

Last Question.

Let 'x' = equilibrium [CH3COO-] = equilibrium [H3O+]

Then, equilibrium [HCH3COO] = (0.83-x) M

Now, Kc = [CH3COO-][H3O+]/[HCH3COO]

i.e. 1.8*10-5 = x*x/(0.83-x)

Here, (0.83-x) ~~ 0.83

i.e. x2 = 1.8*10-5 * 0.83 = 0.00001494

i.e. x = 0.003865 M

Therefore, equilibrium [CH3COO-] = equilibrium [H3O+] = 0.003865 M

And equilibrium [HCH3COO] = (0.83-0.003865) M = 0.826135 M

Add a comment
Know the answer?
Add Answer to:
Open with Google Docs The reaction to the right describes the isomerization of dihydroxyacetone phosphate (DHAP)...
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Not the answer you're looking for? Ask your own homework help question. Our experts will answer your question WITHIN MINUTES for Free.
Similar Homework Help Questions
  • In another key reaction in glycolysis, dihydroxyacetone phosphate (DHAP) is isomerized into glyceraldehyde-3-phosphate (GAP): The equilibrium...

    In another key reaction in glycolysis, dihydroxyacetone phosphate (DHAP) is isomerized into glyceraldehyde-3-phosphate (GAP): The equilibrium constant is 5.4×10−2. Calculate the equilibrium fraction of GAP from the above, at 37 ∘C. CH2OH HC-OH ΔGor = +7.5 kJ/mol CH2OPO22 CH2OPO2 GAP DHAP

  • The isomerization of dihydroxyacetone phosphate to glyceraldehyde 3-phosphate has an equilibrium constant of 0.0475 under the...

    The isomerization of dihydroxyacetone phosphate to glyceraldehyde 3-phosphate has an equilibrium constant of 0.0475 under the following standard conditions (1 atm, 298K, pH 7). Calculate the standard free energy change for this isomerization. (2 points) Calculate the free energy of this reaction inside of a cell where the initial concentration of dihydroxyacetone phosphate is typically 2 x 10-4 M and the initial concentration of glyceraldehyde-3- phosphate is typically 3μM. (4 points) Extra credit (2 points): What do the values above...

  • The value of ΔG°\' for the conversion of dihydroxyacetone phosphate to glyceraldehyde-3-phosphate...

    The value of ΔG°\' for the conversion of dihydroxyacetone phosphate to glyceraldehyde-3-phosphate (GAP) is 7.53 kJ/mol. If the concentration of dihydroxyacetone phosphate at equilibrium is 2.85 mM, what is the concentration of glyceraldehyde-3-phosphate? Assume a temperature of 25.0 °C. The constant R = 8.3145 J/(mol·K) Map do Sapling Learning macmilan learning The value of AG° for the conversion of dihydroxyacetone phosphate to glyceraldehyde-3-phosphate (GAP) is +7.53 kJ/mol. If the concentration of dihydroxyacetone phosphate at equilibrium is 2.85 mM, what is...

  • Dihydroxyacetone (DHA) isomerizes to glyceraldehyde 3-phosphate (G3P): K = 0.0475 G3P (aq) DHAP (...

    help with 15 and 16 Dihydroxyacetone (DHA) isomerizes to glyceraldehyde 3-phosphate (G3P): K = 0.0475 G3P (aq) DHAP (aq) what is the standard free energy change (AG") for this reaction and is this reaction exergonic or endergonic? R = 8.3 14 J mol-1 K-1 and T = 298K +7.55 kJ mol-1 II. 3.28 kJ mol1 III. -7.55 kJ mol- +3.28 kJ mol so the reaction is Vexergonic VI. endergonic CAlI and V HtI and VI A I and V b....

  • In a key reaction of glycolysis, dihydroxyacetone phosphate (DHAP) is isomerized into glyceraldehydes 3- phosphate (G3P)...

    In a key reaction of glycolysis, dihydroxyacetone phosphate (DHAP) is isomerized into glyceraldehydes 3- phosphate (G3P) by the action of the enzyme triose phosphate isomerase: Because delta G degree, is positive, the equilibrium lies to the left. Calculate the equilibrium constant for this reaction, assuming a temperature of 37 degree C. In the cell, depletion of G3P makes the reaction proceeds. What is the value of delta G if the concentration of G3P is kept at 1/100 of the value...

  • In another key reaction in glycolysis, phosphate (DHAP) is isomerized into glyceraldehyde-3-phosphate (GAP): Because deltaG' is...

    In another key reaction in glycolysis, phosphate (DHAP) is isomerized into glyceraldehyde-3-phosphate (GAP): Because deltaG' is positive, the equilibrium lies to the left. Calculate the equilibrium constant, and the equilibrium fraction of GAP from the above, at 37degreeC. Express your answer using two significant figures. In the cell, depletion of GAP makes the reaction proceed. What will deltaG be if the concentration of GAP is always kept at 1/100 of the concentration of DHAP? Express your answer to two significant...

  • Consider the reaction, which takes place at a certain elevated temperature CO(g)+NH3(g)⇌HCONH2(g), Kc=0.900 If a reaction...

    Consider the reaction, which takes place at a certain elevated temperature CO(g)+NH3(g)⇌HCONH2(g), Kc=0.900 If a reaction vessel initially contains only CO and NH3 at concentrations of 1.00 M and 2.00 M, respectively, what will the concentration of HCONH2 be at equilibrium? Question 2 2 of 12 > Review Constants Periodic Table Part The concentrations of reactants and products for a chemical reaction can be calculated if the equilibrium constant for the reaction and the starting concentrations of reactants and/or products...

  • Select all of the true statements regarding chemical equilibrium. The concentrations of reactants and products are...

    Select all of the true statements regarding chemical equilibrium. The concentrations of reactants and products are equal. The concentrations of reactants and products remain constant. Reactants are being converted to products and vice versa. The rates of the forward and reverse reactions are equal. Write the equilibrium constant expression for the reaction A(s)+3 B() 2C (aq) D(aq) in terms of [A]. [B]. [C], and [D] K = Write the equilibrium-constant expression for the reaction shown in terms of [A]. [B]....

  • A. What is the pH of an aqueous solution with a hydrogen ion concentration of H']...

    A. What is the pH of an aqueous solution with a hydrogen ion concentration of H'] 6.0 x 10M? pH = , in an aqueous solution with a hydrogen ion concentration B. What is the hydroxide ion concentration, OH of H'] = 6.0 x 10-5 M? [OH - C. A monoprotic weak acid, HA, dissociates in water according to the reaction HA(aq) = H(aq) + A (aq) M. and The equilibrium concentrations of the reactants and products are [HA] =...

  • Consider the general class of chemical reactions where A+B+9++ C+D If the reaction is initially at...

    Consider the general class of chemical reactions where A+B+9++ C+D If the reaction is initially at equilibrium, what happens when B is added to the reaction mixture? O a. The equilibrium is not affected. Ob. The equilibrium shifts to the left and generates more reactants. Oc. The equilibrium shifts to the right and generates more products. QUESTION 14 Consider the general class of chemical reactions where A+B+ C+D If the reaction is initially at equilibrium, what happens when D is...

ADVERTISEMENT
Free Homework Help App
Download From Google Play
Scan Your Homework
to Get Instant Free Answers
Need Online Homework Help?
Ask a Question
Get Answers For Free
Most questions answered within 3 hours.
ADVERTISEMENT
ADVERTISEMENT