Homework Answers
IUPAC NOMENCLATURE of organic compounds.
Add Answer to:
3. (8 pts) Assign unambiguous syste structures. unambiguous systematic names to each of the following parent:...
1. (9 pts) Assign a systematic name for each of the following compounds:
1. (9 pts) Assign a systematic name for each of the following compounds:
Give IUPAC names for the following compounds: Draw structures corresponding to each of the given names....
Give IUPAC names for the following compounds: Draw structures corresponding to each of the given names. A. 2-phenyl-2-propanol B. 2, 3-diphenyl-2-hexene C. 2-hydroxyacetophenone D. 5, 5-dimcthyl-l, 3, 6-cycloheptatriene-l-carboxylicacid E. Acetic anhydride
(3 pts) Provide 2 acceptable names for the molecule below. If you provide a systematic name,...
(3 pts) Provide 2 acceptable names for the molecule below. If you provide a systematic name, include the appropriate R or S designation in the name. (2 pts) Provide a systematic name for the molecule below. (2 pts) Indicate whether the listed solvent is protic or aprotic. a. tert-butanol [(CH3)3COH] b. formamide (HCONH2]
Provide IUPAC names for each of the following structures: Draw structures corresponding to each of the...
Provide IUPAC names for each of the following structures: Draw structures corresponding to each of the following names: 6. 2-propenamide 7. 3,4,5-trimethoxybenzoyl chloride 8. acetic formic anhydride 9. N,N-dimethylformamide 10. methyl cis-3-ethylcyclobutanecarboxylate 11. (E)-2,4-dimethyl-2-hexenoyl chloride
please help 3. Please draw the structures for the major product(s) from each of the following...
please help
3. Please draw the structures for the major product(s) from each of the following reactions and include stereochemistry where appropriate. (2 pts for each) (a) O2N NH2 NO2 (b) NAOCH3 OCH3 CHон (c) pyridine -NH2 + S-Cl (d) HOH CHO Br2 HO H Нао H OH H-OH CH2OH (e) Hао* Ph H (f) N2HA H (hint: cyclization)
3. Please draw the structures for the major product(s) from each of the following reactions and include stereochemistry where appropriate. (2...
1. Name the following or Draw the Structure (2 x 3 pts each) a. N-methyl-3-phenylpentan-2-amine OH...
1. Name the following or Draw the Structure (2 x 3 pts each) a. N-methyl-3-phenylpentan-2-amine OH b. OH NH2O 2. Draw the starting materials for the following hydrolysis reactions. (3 pts each) 1. NaOH, H2O a. 3-or 2. HCI, H2O OH OH Ph 1. NaOH, H2O b. HO Н. CH3 OH HPh 2. HCI, H2O 3. Of the following, which form would actually exist at: (5 points) a) pH = 2 (acidic) b) pH = 7 (neutral) c) pH =...
3. Give good systematic names of the following. Include E,Z nomenclature if necessary. Parts A-C 4....
3. Give good systematic names of the following. Include E,Z
nomenclature if necessary. Parts A-C
4. Identify the following as nucleophiles (Nu) or
electrophiles (E). Figures 1-5
bve good systematic names for the following. Include E,Z nomenclature if necessary. a. b. C. Cl 4. Identify the following as nucleophiles (Nu) or electrophiles (E) Ho (CHa) C H20 BF3
1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH...
1. Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
CH3C(CH3)CH2
CH2O
CH3CH(NH2)CH3
CH3OCH2CH2CH3
CH(CH3)2COOH
For the list above I currently put the following as the IUPAC
names. If any are wrong can you please correct them!
Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
IUPAC Name: 3,3,4-trimethylhexane
IUPAC Name:
3-methyl-4-ol-heptane
CH3C(CH3)CH2 IUPAC Name:
2-methylpropene
CH2O IUPAC Name: methanal
CH3CH(NH2)CH3 IUPAC Name:
isopropylamine
CH3OCH2CH2CH3 IUPAC
Name: methoxyethane (ethyl methyl ether)
CH(CH3)2COOH IUPAC Name:
2-methylpropanoic acid
write condensed structures fore each of the following compounds Homework Problems 7.1 Write condensed structures for...
write condensed structures fore each of the following
compounds
Homework Problems 7.1 Write condensed structures for each of the following compounds: a. 2,2,4-trimethylpentane b. 5-isopropyl-2-methyloctane c. 1,1,3,3-tetrabromopropane d. 1,1-dichlorocyclopentane e. 1,4-diethylcyclohexane f. 1-bromo-2-methylcyclobutane What are the IUPAC names of the following compounds? 7.2 CH2CH, CH3 a) CH, C CH, CH, CH СH,CH, сн, CH2CH, b) CH2CH d) (CH),CCH2CH e) F Br Br Write the structural formulas and names for FOUR isomers of cycloalkane, CSH10. 7.3 7.4 Propose structures for molecules...
4) The following compounds are incorrectly named. Provide correct systematic names for each a. 2-methyl-2-ethylpropane b....
4) The following compounds are incorrectly named. Provide correct systematic names for each a. 2-methyl-2-ethylpropane b. 2,6-diethylcyclohexane c. 1-bromo-3-isopropylpentane d. 5-fluoro-8-methyl-3-tert-butylnonane
1. (9 pts) Assign a systematic name for each of the following compounds:
Give IUPAC names for the following compounds: Draw structures corresponding to each of the given names. A. 2-phenyl-2-propanol B. 2, 3-diphenyl-2-hexene C. 2-hydroxyacetophenone D. 5, 5-dimcthyl-l, 3, 6-cycloheptatriene-l-carboxylicacid E. Acetic anhydride
(3 pts) Provide 2 acceptable names for the molecule below. If you provide a systematic name, include the appropriate R or S designation in the name. (2 pts) Provide a systematic name for the molecule below. (2 pts) Indicate whether the listed solvent is protic or aprotic. a. tert-butanol [(CH3)3COH] b. formamide (HCONH2]
Provide IUPAC names for each of the following structures: Draw structures corresponding to each of the following names: 6. 2-propenamide 7. 3,4,5-trimethoxybenzoyl chloride 8. acetic formic anhydride 9. N,N-dimethylformamide 10. methyl cis-3-ethylcyclobutanecarboxylate 11. (E)-2,4-dimethyl-2-hexenoyl chloride
please help
3. Please draw the structures for the major product(s) from each of the following reactions and include stereochemistry where appropriate. (2 pts for each) (a) O2N NH2 NO2 (b) NAOCH3 OCH3 CHон (c) pyridine -NH2 + S-Cl (d) HOH CHO Br2 HO H Нао H OH H-OH CH2OH (e) Hао* Ph H (f) N2HA H (hint: cyclization)
3. Please draw the structures for the major product(s) from each of the following reactions and include stereochemistry where appropriate. (2...
1. Name the following or Draw the Structure (2 x 3 pts each) a. N-methyl-3-phenylpentan-2-amine OH b. OH NH2O 2. Draw the starting materials for the following hydrolysis reactions. (3 pts each) 1. NaOH, H2O a. 3-or 2. HCI, H2O OH OH Ph 1. NaOH, H2O b. HO Н. CH3 OH HPh 2. HCI, H2O 3. Of the following, which form would actually exist at: (5 points) a) pH = 2 (acidic) b) pH = 7 (neutral) c) pH =...
3. Give good systematic names of the following. Include E,Z
nomenclature if necessary. Parts A-C
4. Identify the following as nucleophiles (Nu) or
electrophiles (E). Figures 1-5
bve good systematic names for the following. Include E,Z nomenclature if necessary. a. b. C. Cl 4. Identify the following as nucleophiles (Nu) or electrophiles (E) Ho (CHa) C H20 BF3
1. Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
CH3C(CH3)CH2
CH2O
CH3CH(NH2)CH3
CH3OCH2CH2CH3
CH(CH3)2COOH
For the list above I currently put the following as the IUPAC
names. If any are wrong can you please correct them!
Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
IUPAC Name: 3,3,4-trimethylhexane
IUPAC Name:
3-methyl-4-ol-heptane
CH3C(CH3)CH2 IUPAC Name:
2-methylpropene
CH2O IUPAC Name: methanal
CH3CH(NH2)CH3 IUPAC Name:
isopropylamine
CH3OCH2CH2CH3 IUPAC
Name: methoxyethane (ethyl methyl ether)
CH(CH3)2COOH IUPAC Name:
2-methylpropanoic acid
write condensed structures fore each of the following
compounds
Homework Problems 7.1 Write condensed structures for each of the following compounds: a. 2,2,4-trimethylpentane b. 5-isopropyl-2-methyloctane c. 1,1,3,3-tetrabromopropane d. 1,1-dichlorocyclopentane e. 1,4-diethylcyclohexane f. 1-bromo-2-methylcyclobutane What are the IUPAC names of the following compounds? 7.2 CH2CH, CH3 a) CH, C CH, CH, CH СH,CH, сн, CH2CH, b) CH2CH d) (CH),CCH2CH e) F Br Br Write the structural formulas and names for FOUR isomers of cycloalkane, CSH10. 7.3 7.4 Propose structures for molecules...
4) The following compounds are incorrectly named. Provide correct systematic names for each a. 2-methyl-2-ethylpropane b. 2,6-diethylcyclohexane c. 1-bromo-3-isopropylpentane d. 5-fluoro-8-methyl-3-tert-butylnonane
Most questions answered within 3 hours.
-
Where is the error in this code sequence?
String s1 = "Hello";
String s2 = "ello";...
asked 10 months ago -
Financial data for Joel de Paris, Inc., for last year
follow:
Joel de Paris, Inc.
Balance...
asked 10 months ago -
Consider this reaction:
Al2(SO4)3 (aq)+ BaCl3
(aq) Al2Cl6 (aq)- +
3BaSO4(s) . What is the...
asked 10 months ago -
Suppose that Savneet is considering increasing her
recent random sample from 20 car rentals to 40...
asked 10 months ago -
Trucks arrive at an unloading terminal at an average rate of 120
per hour.
Trucks arrive...
asked 10 months ago -
Why are methanol and ethanol completely soluble in water while
octanol is not very little soluble....
asked 10 months ago -
A facilities manager at a university reads in a research report
that the mean amount of...
asked 10 months ago -
When the CuSO4 is rehydrated by adding water to the anhydrous
compound, is this an endothermic...
asked 10 months ago -
A ray of sunlight is passing from diamond into crown glass; the
angle of incidence is...
asked 10 months ago -
A block of mass 0.249 kg is placed on top of a light, vertical
spring of...
asked 10 months ago -
how do the kidneys compensate in the presences of acidosis
a) trigger hyperventilate
b) reserve acid...
asked 10 months ago -
Question 501 pts
The rental rate of capital to the firm increases. Which of the
following...
asked 10 months ago