How many oxygen atoms are on the reactant side of this chemical equation? K2SO4(aq)+Pb(NO3)2(aq)→2KNO3(aq)+PbSO4(s)

Question

Question

How many oxygen atoms are on the reactant side of this chemical equation?

K2SO4(aq)+Pb(NO3)2(aq)→2KNO3(aq)+PbSO4(s)

science chemistry

Answer 1

Answer #1

K₂SO₄(aq)+Pb(NO₃)₂(aq)→2KNO₃(aq)+PbSO₄(s)

oxygen atoms in K₂SO₄ = 4

oxygen atoms in Pb(NO₃)₂ = 6

Number of oxygen atoms on the reactant side = 10

Answer 2

Answer #2

How many oxygen atoms are on the reactant side of this chemical equation?

$2 K_{3} P O_{4} (a q) + 3 P b (N O_{3})_{2} (a q) \to 6 K N O_{3} (a q) + P b_{3} (P O_{4})_{2} (s)$

How many oxygen atoms are on the reactant side of this chemical equation?

8

17

26

44

answered by: kay

Answer 3

Similar Homework Help Questions

How many grams of PbCl2 are formed when 35.0 mL of 0.520 M KCl react with Pb(NO3)2? 2KCl(aq) + Pb(NO3)2(aq) → 2KNO3(aq)...

How many grams of PbCl2 are formed when 35.0 mL of 0.520 M KCl react with Pb(NO3)2? 2KCl(aq) + Pb(NO3)2(aq) → 2KNO3(aq) + PbCl2(s) How many grams of PbCl2 are formed when 35.0 mL of 0.520 M KCl react with Pb(NO3)2? 2KCl(aq) + Pb(NO3)2(aq) → 2KNO3(aq) + PbCl2(s) 10.1 g 25.3 g 5.06 g 15.2 g 2.53 g
Consider the balanced equation of KI reacting with Pb(NO3)2 to form a precipitate. 2KI(aq)+Pb(NO3)2(aq)⟶PbI2(s)+2KNO3(aq) What mass...

Consider the balanced equation of KI reacting with Pb(NO3)2 to form a precipitate. 2KI(aq)+Pb(NO3)2(aq)⟶PbI2(s)+2KNO3(aq) What mass of PbI2 can be formed by adding 0.413 L of a 0.140 M solution of KI to a solution of excess Pb(NO3)2?
Equation: Pb(NO3)2(aq) + K2(CO3) --> PbCO3(s) + 2KNO3(aq) Net Ionic Equation: Pb2+ + CO32- --> PbCO3(s)...

Equation: Pb(NO3)2(aq) + K2(CO3) --> PbCO3(s) + 2KNO3(aq) Net Ionic Equation: Pb2+ + CO32- --> PbCO3(s) lead (ii) nitrate concentration = 0.15 M, potassium carbonate concentration = 0.20 M Determine the percent yield if 0.1150 L of each reactant were allowed to react, and a mass of 5.0012 g of solid were obtained.

For each of the following precipitation reactions, calculate how many grams of the first reactant are...

For each of the following precipitation reactions, calculate how many grams of the first reactant are necessary to completely react with 18.0 g of the second reactant. a. 2KI(aq)+Pb(NO3)2(aq)→PbI2(s)+2KNO3(aq) b. Na2CO3(aq)+CuCl2(aq)→CuCO3(s)+2NaCl(aq) c. K2SO4(aq)+Sr(NO3)2(aq)→SrSO4(s)+2KNO3(aq)
2KI (aq) + Pb(NO3)2 (aq) + PbI, (s) + 2KNO3 (aq). How much 0.7 M KI...

2KI (aq) + Pb(NO3)2 (aq) + PbI, (s) + 2KNO3 (aq). How much 0.7 M KI solution in liters will completely precipitate the Pb2+ in 2.1 L of 0.18 M Pb(NO3), solution? Do not include units in your answer and round to two significant figures. Druiden bela
Which equation describes a redox reaction? Multiple Choice 2KBr(aq) + Pb(NO3)2(aq) → 2KNO3(aq) + PbBr2(s) H+(aq)...

Which equation describes a redox reaction? Multiple Choice 2KBr(aq) + Pb(NO3)2(aq) → 2KNO3(aq) + PbBr2(s) H+(aq) + OH–(aq) → H2O(l) CO32–(aq) + HSO4–(aq) → HCO3–(aq) + SO42–(aq) CaBr2(aq) + H2SO4(aq) → CaSO4(s) + 2HBr(aq)

For the chemical reaction 2KI+Pb(NO3)2⟶PbI2+2KNO3 how many moles of lead(II) iodide (PbI2) are produced from 8.0...

For the chemical reaction 2KI+Pb(NO3)2⟶PbI2+2KNO3 how many moles of lead(II) iodide (PbI2) are produced from 8.0 mol of potassium iodide (KI)?
For the chemical reaction 2KI+Pb(NO3)2⟶PbI2+2KNO3 how many moles of lead(II) iodide (PbI2) are produced from 8.0...

For the chemical reaction 2KI+Pb(NO3)2⟶PbI2+2KNO3 how many moles of lead(II) iodide (PbI2) are produced from 8.0 mol of potassium iodide (KI)?
Na2SO4+Pb(NO3)2=Na2(NO3)2+PbSO4 Balanced equation: Ionic equation:

Na2SO4+Pb(NO3)2=Na2(NO3)2+PbSO4 Balanced equation: Ionic equation:

7. _Pb + K2SO4 → PbSO4 + K How many atoms of potassium are produced from...

7. _Pb + K2SO4 → PbSO4 + K How many atoms of potassium are produced from 2.50 * 10” units of K2SO4