COH CH3CVAICI cCH3 CCH3 CCH3 CCHg NO2 -NO2 NO2 NO2 no reaction

Question

Question

science chemistry

Answer 1

Answer #1

Os CH3CI, AICI: NO2 NO2

Answer 2

Similar Homework Help Questions

5) Predict the product(s) of the following reaction. IL II COH COH A

5) Predict the product(s) of the following reaction. IL II COH COH A
Draw the product of the reaction CH3CH2CH2CH2C(triple)CCH3 + 2Br2 --> ?? Draw the aldehyde produced from...

Draw the product of the reaction CH3CH2CH2CH2C(triple)CCH3 + 2Br2 --> ?? Draw the aldehyde produced from the oxidation of CH3CH2CH2C(CH3)2CH2OH Draw the dipeptide Gly-Gly ***************************** Include all hydrogen atoms. *******************************
11) Which compound is most acidic ? Explain. NO2 O O -COH сон COM "OCH3 12....

11) Which compound is most acidic ? Explain. NO2 O O -COH сон COM "OCH3 12. Predict the major product. CH3 CH3 -NH₂ 1.) CH₃ I 2.) AgzO/ H₂0² 13.) Predict the product, Show each step. 1.) Febrz/Bra 2.) H2SO4/ HNO3 7 3.) HCI / NaNO2 4.) H₂ot

Give the product for the following reaction. CH3CH2 H 1. CH3NH2, H 2. -H2O 3. NaBH(O,CCH3)3...

Give the product for the following reaction. CH3CH2 H 1. CH3NH2, H 2. -H2O 3. NaBH(O,CCH3)3 CH3CH2NHCH3 CH3CH2CH2NHCH3 CH3CH2 H NCHS CH3CH2CH2N(CH3)2 O CH3CH2CH2OH Give the product for the following reaction. CH3CH2 H 1. CH3NH2, H 2. -H2O 3. NaBH(O,CCH3)3 CH3CH2NHCH3 CH3CH2CH2NHCH3 CH3CH2 H NCHS CH3CH2CH2N(CH3)2 O CH3CH2CH2OH
What is the expected product of this reaction? NaOEt, EtOH + NO2 ? O NO2 NO2...

What is the expected product of this reaction? NaOEt, EtOH + NO2 ? O NO2 NO2 A ON С NO2 B D
Question 7 Predict the major organic product of the reaction sequence, i. NH3, H20 M ii....

Question 7 Predict the major organic product of the reaction sequence, i. NH3, H20 M ii. dilute Ha, cold O O OH NH2 NH2 HO HO HN I II III H N HN IV V CA. V B. III C. 11 DIV E. I Question 8 Which of the following would be the strongest acid? NO2 COH COH COH ON ON "NO2 I II III COH COH NO2 ON "NO2 IV V A. IV B. III C. I D. II...

Question 90 x your answer is incorrect. Try again. Predict the major product for the following...

Question 90 x your answer is incorrect. Try again. Predict the major product for the following reaction. CCH3 CHCI AICI: CCH3 CCH3 CCH3 CCH3 NO, NO, Y NO NO2 I II III IV llo 0 0 0 0 no reaction LINK TO TEXT LINK TO TEXT
uestion 28 What would be the major product(s) of the following reaction? COCH HNO3 H2SO4, heat...

uestion 28 What would be the major product(s) of the following reaction? COCH HNO3 H2SO4, heat COH COH NO2 ON NO2 NO2 NO2 I III ON Approximately equal amounts of II and IV Click if you would like to Show Work for this question: Open Show Work
major product of the reaction below would be... CO2H heat HOC Select one: COH O a....

major product of the reaction below would be... CO2H heat HOC Select one: COH O a. "COH CO2H ob. "CO2H CO2H O c. *CO H Od. CO2H COZH O e, no reaction

e attached What is the product of the following reaction? 1. HBr CH3C=CCH3 – 2. (CH3CH2CH2)2Culí...

e attached What is the product of the following reaction? 1. HBr CH3C=CCH3 – 2. (CH3CH2CH2)2Culí Responses. (E)-3-methyl-2-hexene C. 2-heptyne 5-decyne (Z)-2-bromo-2-hexene (E)-2-bromo-2-hexene