CH2CH3 CH, Oo D) NaH + CH3CH2CH2OH m) Product from I) + CH CI CHE +...

Question

Question

science chemistry

Answer 1

Answer #1

1 CHOOH - + C- C сн, см; 7 NAH & CH₂ CH₂ ch oh CH₂ - CH₂ - CH₂ - ok+NG - CH3 – CH-0-0 NAD made fromd & CHz el SN2 CH₂ - CH₂ -

Answer 2

Similar Homework Help Questions

UCJION What is the product of the reaction? CH3-CHC-CI+ CH3-NI+CH, CHE ch gra - онлинсь, —...

UCJION What is the product of the reaction? CH3-CHC-CI+ CH3-NI+CH, CHE ch gra - онлинсь, — странен, орвоо он CH3-CH-CH-N-CH2 CH3 CH3 CH3-CH+C-N-CHE " CH₂ CH₂
5) What is the major product of the following reaction? сн. H HBr CH, OO CHE...

5) What is the major product of the following reaction? сн. H HBr CH, OO CHE H CHS A) CH CH:CH-CH:Br B) CH3 CH3 -CH-CHE C) CH: CH--C-CH Br Br D) CH,Br CH3 -CH-CH Br E) CHE CH-C-CHE Br
Name the following carbonyl I compounds Please help with H., I., J. CH2CH3 CH CH,C= N...

Name the following carbonyl I compounds Please help with H., I., J. CH2CH3 CH CH,C= N 2 CH3 CH2CH2CH3

Give the name of the product for the following SN2 reaction. CH2CH3 OH CH, CH, CH2...

Give the name of the product for the following SN2 reaction. CH2CH3 OH CH, CH, CH2 CI OA) (9-3-hexanol B) (R)-2-hexanol C) (R)-3-hexanol D) (S)-2-hexanol
IUPAC Nomenclature 4.39 Give the IUPAC name for each compound. h. tyn my 1. -CH(CH2CH3)2 i....

IUPAC Nomenclature 4.39 Give the IUPAC name for each compound. h. tyn my 1. -CH(CH2CH3)2 i. a. CH3CH2CHCH2CHCH2CH2CH3 CH3 CH2CH3 CH2CH3 CH3 b. CH3CH2CCH_CH2CHCHCH2CH2CH3 CH2CH3 CH2CH3 C. CH3CH,CH,C(CH3)2C(CH3)2CH2CH3 d. CH3CH2C(CH2CH3)2CH(CH3)CH(CH2CH2CH3)2 e. (CH3CH2),CCH(CH3)CH2CH2CH3 f. CH3CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)3CH3 g. (CH2CH2CH2)4C more on mo .
Section: 17-14 63. Give the major product for the reaction. Justify your answer. 1. CH, CHECHE...

Section: 17-14 63. Give the major product for the reaction. Justify your answer. 1. CH, CHECHE CH2CH3 CHC осн; 2. HCI excess B) A) C) OO DO DEO CH,CHE CH2CH2 CH:CHE CHCH3 CH, CH2 CHCH CH CH:09 OH CHO D) E) OH =O CH CH3 CH,CHE CHCH CH,CHE CHO O CHO “Η

1. Predict the ions.-40 pts. major products in the following CI CI 1. NaH (I mol) 2. CH,Br (1mol ...

1. Predict the ions.-40 pts. major products in the following CI CI 1. NaH (I mol) 2. CH,Br (1mol 0 CI Cl C. 1. Nall (3 mol) H,Br (I mol) 1. Predict the ions.-40 pts. major products in the following CI CI 1. NaH (I mol) 2. CH,Br (1mol 0 CI Cl C. 1. Nall (3 mol) H,Br (I mol)
4. Which pall or suructures are enantiomers? COOH OH CH3 Ноосон нон CH2CH3 Br CH CI...

4. Which pall or suructures are enantiomers? COOH OH CH3 Ноосон нон CH2CH3 Br CH CI WYCH CH3 ÇH2CH3 CH3 HO CH3 HOCH CHz a) I, II b) II, III c) I, III d) I, II, III 5. Which are meso compounds? OH H ANH OH - H TOH a) I and II b) II and III c) I and III d) III and IV
Predict the major organic product(s) of the reaction shown below. OH PBT OPB:2 "CH CHE A...

Predict the major organic product(s) of the reaction shown below. OH PBT OPB:2 "CH CHE A only Bonly Conly A mixture of B and C QUESTION 2 Predict the major organic product of the reaction shown below. B Nah Bra

14. (4 points each) Complete the following reactions showing the major organic product). 2 CH,NH CH CH,OH Ci pyridine 2. 2CH,NH2 Ci AICl I. excess CH,MgBr 2. H CH,CH,CH OH NaOH 14. (4 points...

14. (4 points each) Complete the following reactions showing the major organic product). 2 CH,NH CH CH,OH Ci pyridine 2. 2CH,NH2 Ci AICl I. excess CH,MgBr 2. H CH,CH,CH OH NaOH 14. (4 points each) Complete the following reactions showing the major organic product). 2 CH,NH CH CH,OH Ci pyridine 2. 2CH,NH2 Ci AICl I. excess CH,MgBr 2. H CH,CH,CH OH NaOH