I am having trouble understanding this problem. Can you please
walk me through the steps using the BCA and ICE tables? 
b) Consider the ionization of C2H3O21- as below.
C2H3O21- (aq) + H2O (l) --------> HC2H3O2 (aq) + OH- (aq)
Since OH- is formed, we work with Ka of C2H3O21-. We know that Ka (HC2H3O2) = 1.8*10-5. We further know that
Ka*Kb = Kw
where Kb is the base ionization constant of C2H3O21- and Kw = 1.0*10-14 is a constant. Therefore,
Kb = Kw/Ka = (1.0*10-14)/(1.8*10-5)
= 5.55*10-10
Next, write down the expression for Kb as
Kb = [HC2H3O2][OH-]/[C2H3O21-] = (x).(x)/(0.158 – x)
Since Kb is small, we can assume x << 0.158 M and thus,
Kb = 5.55*10-10 = x2/(0.158)
====> x2 = 5.55*10-10*0.158 = 8.769*10-11
====> x = 9.364*10-6
Therefore, [OH-] = 9.364*10-6 M and pOH = -log [OH-] = -log (9.364*10-6 M) = 5.028.
We know that pH + pOH = 14; therefore,
pH = 14 – pOH = 14 – 5.028 = 8.972 ? 8.97.
This denotes the initial pH of the solution.
Now, millimoles C2H3O21- = (volume of C2H3O21- in mL)*(molarity of C2H3O21-) = (300. mL)*(0.158 M) = 47.4 mmole.
Millimoles of HCl added = (volume of HCl in mL)*(molarity of HCl) = (10.0 mL)*(3.68 M) = 36.8 mmole.
C2H3O21- reacts with HCl as per the equation
C2H3O21- (aq) + HCl (aq) --------> HC2H3O2 (aq) + Cl- (aq)
Cl- is the counter ion. C2H3O21- and HC2H3O2 form a buffer.
As per the stoichiometry of the reaction,
millimoles C2H3O21- neutralized = millimoles HCl added = millimoles HC2H3O2 formed = 36.8 mmole.
Millimoles of C2H3O21- retained at equilibrium = (47.4 – 36.8) mmole = 10.6 mmole.
Since the total volume of the solution remains stay, we can express the ratio of the concentrations of C2H3O21- and HC2H3O2 in terms of the number of moles. We determine the pH using the Henderson-Hasslebach equation as
pH = pKa + log [C2H3O21-]/[HC2H3O2]
====> pH = -log (Ka) + log (moles C2H3O21- at equilibrium)/(moles HC2H3O2 at equilibrium)
====> pH = -log (1.8*10-5) + log (10.6 mmole)/(36.8 mmole)
====> pH = 4.745 + log (0.288)
====> pH = 4.745 + (-0.541)
====> pH = 4.204 ? 4.20
This denotes the pH of the solution after the addition of HCl. Therefore, pH change = (final pH) – (initial pH) = (4.20) – (8.97) = -4.77 (ans).
d) We determine the pH using the Henderson-Hasslebach equation as
pH = pKa + log [C2H3O21-]/[HC2H3O2]
====> pH = -log (1.8*10-5) + log (0.158 M)/(0.158 M)
====> pH = 4.745 + log (1)
====> pH = 4.745 + 0 ? 4.74
This denotes the pH of the solution before the addition of HCl.
Now, millimoles C2H3O21- = millimoles of HC2H3O2 = (volume of C2H3O21-/HC2H3O2 in mL)*(molarity of C2H3O21-/HC2H3O2) = (300. mL)*(0.158 M) = 47.4 mmole.
Millimoles of HCl added = (volume of HCl in mL)*(molarity of HCl) = (10.0 mL)*(3.68 M) = 36.8 mmole.
C2H3O21- reacts with HCl as per the equation
C2H3O21- (aq) + HCl (aq) --------> HC2H3O2 (aq) + Cl- (aq)
Cl- is the counter ion. C2H3O21- and HC2H3O2 form a buffer.
As per the stoichiometry of the reaction,
millimoles C2H3O21- neutralized = millimoles HCl added = millimoles HC2H3O2 formed = 36.8 mmole.
Millimoles of C2H3O21- retained at equilibrium = (47.4 – 36.8) mmole = 10.6 mmole.
Millimoles of HC2H3O2 at equilibrium = (47.4 + 36.8) mmole = 84.2 mmole.
Since the total volume of the solution remains stay, we can express the ratio of the concentrations of C2H3O21- and HC2H3O2 in terms of the number of moles. We determine the pH using the Henderson-Hasslebach equation as
pH = pKa + log [C2H3O21-]/[HC2H3O2]
====> pH = 4.745 + log (moles C2H3O21- at equilibrium)/(moles HC2H3O2 at equilibrium)
====> pH = 4.745 + log (10.6 mmole)/(84.2 mmole)
====> pH = 4.745 + log (0.126)
====> pH = 4.745 + (-0.8996)
====> pH = 3.8454 ? 3.84
This denotes the pH of the solution after the addition of HCl. Therefore, pH change = (final pH) – (initial pH) = (3.84) – (4.74) = -0.90 (ans).
I am having trouble understanding this problem. Can you please walk me through the steps using...
Calculate the pH of each of the solutions and the change in pH to 0.01 pH units caused by adding 10.0 mL of 2.31-M HCI to 620. mL of each of the following solutions Change is defined as final minus initial, so if the pH drops upon mixing the change is negative a) water pH before mixing pH after mixing- pH change- 1- b) 0.186 M C2H302 pH before mixing pH after mixing pH change- c) 0.186 M HC2H302 pH...
Calculate the pH of each of the solutions
and the change in pH to 0.01 pH units caused by adding 10.0 mL of
2.93-M HCl to 570. mL of each of the following solutions.
pka is not given.
Calculate the pH of each of the solutions and the change in pH to 0.01 pH units caused by adding 10.0 mL of 2.93-M HCI to 570 mL of each of the following solutions. Change is defined as final minus initial, so...
Calculate the pH of each of the solutions and the change in pH
to 0.01 pH units caused by adding 10.0 mL of 2.52-M HCl to 340. mL
of each of the following solutions.
Change is defined as final minus initial, so if the pH drops
upon mixing the change is negative.
+ 18.55/24 points Previous Answers My Notes Calculate the pH of each of the solutions and the change in pH to 0.01 pH units caused by adding 10.0...
Calculate the pH of each of the solutions and the change in pH to 0.01 pH units caused by adding 10.0 mL of 3.01-M HCl to 640. mL of each of the following solutions. Change is defined as final minus initial, so if the pH drops upon mixing the change is negative. a) water pH before mixing = 7.00 pH after mixing= 1.33 pH change = -5.67 b) 0.143 M C2H3021- pH before mixing = 8.95 pH after mixing= 5.23...
Calculate the pH of each of the solutions and the change in pH to 0.01 pH units caused by adding 10.0 mL of 2.31-M HCI to 620. mL of each of the following solutions Change is defined as final minus initial, so if the pH drops upon mixing the change is negative a) water pH before mixing 7.00 pH after mixing- 1.42 pH change = X 5.53 1- b) 0.186 M C2H302 pH before mixing- 9.01 pH after mixing 5.34...
Calculate the pH of each of the solutions and the change in pH to 0.01 pH units caused by adding 10.0 mL of 3.09-M HCl to 370. mL of each of the following solutions. Change is defined as final minus initial, so if the pH drops upon mixing the change is negative. a) water pH before mixing = pH after mixing= pH change = b) 0.162 M C2H3O21- pH before mixing = pH after mixing= pH change = c) 0.162...
Calculate the pH of each of the solutions and the change in pH to 0.01 pH units caused by adding 10.0 mL of 3.59-M HCl to 450. mL of each of the following solutions. Change is defined as final minus initial, so if the pH drops upon mixing the change is negative. a) water pH before mixing = 7.00 pH after mixing= 1.10 pH change = -5.90 b) 0.103 M C2H3O2^1- pH before mixing = pH after mixing= pH change...
Calculate the change in pH to 0.01 pH units caused by adding 10.
mL of 2.58-M NaOH is added to 420. mL of each of the following
solutions.
5. + 2/24 points Previous Answers My Notes Calculate the change in pH to 0.01 pH units caused by adding 10. mL of 2.58-M NaOH is added to 420. mL of each of the following solutions. a) water pH before mixing = 7.00 pH after mixing= pH change = b) 0.132 M...
Calculate the pH of each of the solutions and the change in pH to 0.01 pH units caused by adding 10.0 mL of 2.27-M HCl to 670. mL of each of the following solutions. a) pH of water before mixing, after mixing and pH change b) 0.152 M C2H3O21- pH before mixing, after mixing and pH change c) 0.152 M HC2H3O2 pH before mixing, after mixing and pH change. d) a buffer solution that is 0.152 M in each C2H3O21-...
i am having trouble determining the calculations for table 3.
Can you please show me how to do the calculations? thank you!
Mass Formula Weight Amount Needed Amount NeededWeighed Chemical Ingredient Formula(g/mol) CO3 03 349 13.2 4 oz. Baking Soda Epsom Salt 2 oz. blo Corn Starch 2 oz. slo v Citric Acid 2 oz. Dried Flower Petals Least amount possible Witch Hazel Soap Colorant 4-6 drops 4-6 drops Essential Oil 119 Coconut Oill 17 g Solution pH Bath Bomb...