






Practice problems l need help organic II )Give the IUPAC name of the following alkyne: a)...
CHM230 Class Worksheet Alkene and Alkyne reactions Give the major product of each of the following reactions: CH,CH,C=CH + 1 equivalent HCI H2 + Lindlar catalyst CH3CHCH2C=CCHCH3 + CICH + H+ + CH3CH2OH CH3CH2C=CH + 2 equivalents HCI CH,CH2C=C-CH3 + 2 equivalents HBr + H+ + H2O + excess HBr CH,CH.C=C-CH3 + excess Hy/Lindlar 2 + excess H/PUC CH3C=C-CH3 + H2O / H / Hg2+ ox.. + HBr + NaNH2 + CH CH Br Given the following alkyne, provide the...
Please Help
20201 26221 + Fit to page Page CHMT032 Organic Chemistry Focus Concepts 1. Name the following compounds Br a) CO2H b) 2. Give the common and IUPAC name the following compounds OH NH2 Give the IUPAC name of each of the following compound 3 032 Organic Che X ate.blackboard.com/bbcswebdav/pid-4824859-dt-content-rid-44102712 1/courses/CHM1032 20201 - + Fit to page 3. Give the IUPAC name of each of the following compound a) CH3CH2CH2CH2CHO b) CHsCOCH2CH2CHs c) CH COOCH2CH 4. Which of the...
1. Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
CH3C(CH3)CH2
CH2O
CH3CH(NH2)CH3
CH3OCH2CH2CH3
CH(CH3)2COOH
For the list above I currently put the following as the IUPAC
names. If any are wrong can you please correct them!
Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
IUPAC Name: 3,3,4-trimethylhexane
IUPAC Name:
3-methyl-4-ol-heptane
CH3C(CH3)CH2 IUPAC Name:
2-methylpropene
CH2O IUPAC Name: methanal
CH3CH(NH2)CH3 IUPAC Name:
isopropylamine
CH3OCH2CH2CH3 IUPAC
Name: methoxyethane (ethyl methyl ether)
CH(CH3)2COOH IUPAC Name:
2-methylpropanoic acid
1. Give IUPAC names for the following compounds: (b) CH2C=CCH2C=CCH2CH3 CH3 CH3CH2C=CCCH CHE (d) (c) CH3 CH3 CH2CH=CC=CCHCH3 CH3 HCCCCH2C=CH CH₂ (e) H2C=CHCH=CHCECH (1) CH2CH3 CH3CH2CHCECCHCHCH, CH₂CH₂ CH₂ 2. Give the IUPAC names for each of the following: 3. Without consulting tables, arrange the following compounds in order of decreasing acidity: 1-Pentene Pentane 1-Pentanol 1-Pentyne
Please give a detail mechanism of 22-29
22. What is the major organic product obtained from the following reaction? 1. NalH 2 CHỊCH CHỊCH EM a. l-methyl-4-nonyne b. 2-methyl-4-nonyne c. 2-methyl-3-nonyne d. 3-methyl-4-nonyne ANSWER: d 23. What is the major organic product obtained from the following reaction? Br. CH, C=C=CH CH, CH,COOH, LIBE - a. (E) 1.2-dibromobutene b. (Z) 1,2-dibromobutene c. (E) 2,3-dibromobutene d. (Z) 2,3-dibromobutene ANSWER: C 25. What is the major organic product obtained from the following reaction?...
need help with these. thank you in advanced
7) What is the IUPAC name for the following compound? CHз CI 5 1 CH3-CH-C-CH= CH 5 CHз CHнз A) 3-chloro-1,3,4-trimethyl-1 - penterte B) 4-chloro-4,5-dimethyl-2-hexene C) 3-chloro-1,3,4,4- tetramethyl -1 -butene 3-chloro-2,3,5-trimethyl-4-pentene E) 3-chloro-2,3-dimethyl-4-hexene 13) Name the following compound. C CH CH,CH2CHCH, A) 3-methyl-4-pentyne 3-ethyl-1-butyne C) 2-ethynebutane D) 1-hexyne E) 3-methyl-1-pentyne 16) Name the following compound. CH3-CH2-C-CH3 A) 3-butenal B) 2-methylbutanone 2-methyl-2-ethylbutanone D) 2-butenal E 2-butanone 18) What is the IUPAC name of...
Q:
what is the IUPAC name for the following molecule?
In the following molecule is formed from the overlap of an sp 3. 6 5 the C-C2 t bond b. the Cy C, a bond a. the Cy-C4 a bond the C-C2 o bond е. the C-Cs a bond с. 2. Which condensed formula contains a ketone? C-CC 1 CH CHO , CH,CH,Oн CH CO,CH2CH a. d. CH,COCH, CH,CH,CH,COOH D3 What is the IUPAC name for the following molecule? HHH...
Give the IUPAC name for the following structures:
Part II: Give the IUPAC name for each of the following structures. (10 marks) 1. нс. CH CH3 CH3 2. нс. CH3 CH3 CH3 3 -CH3 CH3 CH3 4. F CH3 CI 5. À 6. HC CH3 Br CH3 H 7. H 8. H3C 9. HC CI HC CHE 10. H3c CH3
problems a-h
Alkyl Halide Nomenclature 1. Name the following organic mo lecules following IUPAC system of nomenclature. If cig and trans can be used in the name, be sure to include that. Br a. b. Cl Br d. C. Br Br F b d. ci si This is a continuation of problem number 1, e. f. Br- Br h. F Br h.
need help with these practice problems please :) if can help with
all would greatly appreciate.
A. Predict how reaction conditions (substrate, nucleophile, leaving group, solvent) effect the rate of Swi and S2 reactions. Circle the faster substitution reaction among the following pairs. If the rate is not affected, circle both OH OH in acetone ta NaBr DMSO in H2O NaBr CH, OH V CI Br- na ro ChOH CHCI Bra CHCI ? © CN acetone CI- in H20 in...