Homework Answers
Add Answer to:
Question 12 What is the correct IUPAC name for the following alkene? CH3 CHỊCH,CHC=CH, CH2CH3 a....
What is the correct IUPAC name for the following alkene? CH CHỊCH,CHC-CH CH2CH3 O a. octene...
What is the correct IUPAC name for the following alkene? CH CHỊCH,CHC-CH CH2CH3 O a. octene b. 3-methyl-4-ethylpent-4-ene C. 3-(isobutyl)but-3-ene d. 4-ethyl-3-methylpent-4-ene e. 2-ethyl-3-methylhex-2-ene f. 2-(sec-butyl)but-1-ene g. 2-ethyl-3-methylpent-1-ene
What is the systematic IUPAC name for the following Organic compound? OH O a. 2-Ethyl-7-oxodecanoic acid...
What is the systematic IUPAC name for the following Organic compound? OH O a. 2-Ethyl-7-oxodecanoic acid O b. 2-Ethyl-1,7-dioxodecan-1-ol c. 3-Carboxy-8-oxoundecane d. 9-Ethyl-4-oxodecanoic acid e. 1-Hydroxydecan-1,7-dione f. 9-Ethyl-4-oxodecanal What is the correct IUPAC name for the following alkene? CH3 CH3CH2CHC=CH2 CH2CH3 a. 2-(sec-butyl)but-1-ene b. 3-isobutylbut-3-ene c. 4-ethyl-3-methylpent-4-ene d. 2-ethyl-3-methylpent-l-ene e. 3-methyl-4-ethylpent-4-ene f. 2-ethyl-3-methylhex-2-ene g. octene
1. What is the IUPAC name for the following compound? CH3 CI CH3-CH-C- CH-CH CH3 CH3...
1. What is the IUPAC name for the following compound? CH3 CI CH3-CH-C- CH-CH CH3 CH3 A) 4-chloro-4,5-dimethyl-2-hexene B) 3-chloro-1,3,4-trimethyl-1-pentene C) 3-chloro-2,3-dimethyl-4-hexene D) 3-chloro-2,3,5-trimethyl-4-pentene E) 3-chloro-1,3,4,4-tetramethyl-1-butene 2. Name the following compound. CH-CH2 CH,CH CH CCH H-CH A) 2,2-diethylpenatane B) 2,2-diethylpentene C) 4-ethyl-4-methyl-5-hexene D) 3-ethyl-3-methyl-1-hexene E) 4-ethyl-4-methylhexane 3. Name the following compound. CH CH CH, CH,CH CC CH CH2CH CH A) 3-butyl-3-propyl-1-pentyne B) 3-butyl-3-propyl-4-pentyne C) 3-ethyl-3-propyl-1-heptyne D) 5-ethyl-5-propyl-6-heptyne E) 3-ethyl-3-butyl-1-hexyne
Select the correct IUPAC name for the following branched alcohol. Select the correct IUPAC name for...
Select the correct IUPAC name for the following branched
alcohol.
Select the correct IUPAC name for the following branched alcohol. CH3CHCH2CHCH2CH2CH2CH3 CH2CHCH2CHCH2CH3 CH3 CH2CH3 O 3-butyl-7-ethyl-1,5-dimethyl-2-nonanol 7-methyl-9-ethyl-5-(2-hydroxypropyl)undecane 4-butyl-8-ethyl-6-methyl-2-decanol 7-butyl-3-ethyl-5-methyl-9-decanol O
Give the correct IUPAC name for the following compound, CH3 CEC CH3-CH, CH, CH3 O a....
Give the correct IUPAC name for the following compound, CH3 CEC CH3-CH, CH, CH3 O a. 3-methyl-3-hexene Ob. 3-methyl-trans-3-hexene Oc. 2-ethyl-trans-2-pentene O d. 3-methyl-cis-3-hexene Oe. 2-ethyl-2-pentene QUESTION 6 The systematic name for the following is CH3CH2-C-CH-CH3 CH3 a. 2-methyl-3-pentanal b.2-methyl-3-pentanone c. ethyl isopropyl ketone d. 2-methyl-3-propanol e. 2-methyl-3-propanone
1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH...
1. Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
CH3C(CH3)CH2
CH2O
CH3CH(NH2)CH3
CH3OCH2CH2CH3
CH(CH3)2COOH
For the list above I currently put the following as the IUPAC
names. If any are wrong can you please correct them!
Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
IUPAC Name: 3,3,4-trimethylhexane
IUPAC Name:
3-methyl-4-ol-heptane
CH3C(CH3)CH2 IUPAC Name:
2-methylpropene
CH2O IUPAC Name: methanal
CH3CH(NH2)CH3 IUPAC Name:
isopropylamine
CH3OCH2CH2CH3 IUPAC
Name: methoxyethane (ethyl methyl ether)
CH(CH3)2COOH IUPAC Name:
2-methylpropanoic acid
1. What is the IUPAC name of the following compound? CH, CH,CHCH.SH a. isobutyl mercaptan C....
1. What is the IUPAC name of the following compound? CH, CH,CHCH.SH a. isobutyl mercaptan C. 2-methyl-1-propanthiol b. sec-butyl mercaptan d. 2-methyl-1-propanethiol
What is the correct IUPAC name for the compound shown below? H3C CH3 C=C H CH2CH3...
What is the correct IUPAC name for the compound shown below? H3C CH3 C=C H CH2CH3 O cis-2-ethyl-2-butene (Z)-2-ethyl-2-butene O (E)-3-methyl-2-pentene O trans-3-methyl-3-pentene O (Z)-3-methyl-2-pentene
What is the correct IUPAC name for the compound shown below? CH3 HC С=С H CH2CH3...
What is the correct IUPAC name for the compound shown below? CH3 HC С=С H CH2CH3 O (E)-3-methyl-2-pentene O trans-3-methyl-3-pentene O cis-2-ethyl-2-butene O (Z)-2-ethyl-2-butene O (Z)-3-methyl-2-pentene
ter 5 HW Assignment ter 5 Reading Question 2 Part A 2,5-Diethyl-2-hexene is an incorrect IUPAC...
ter 5 HW Assignment ter 5 Reading Question 2 Part A 2,5-Diethyl-2-hexene is an incorrect IUPAC name for the following. CH3CH2CH(CH3)CH2CH=C(CH3)CH2CH3 The correct IUPAC name would be View Available Hint(s) 3-ethyl-5-methyl-4-octene 3,5-diethyl-4-hexene 3-methyl-5-ethyl-3-octene 3.5-dimethyl-3-octene Subm
What is the correct IUPAC name for the following alkene? CH CHỊCH,CHC-CH CH2CH3 O a. octene b. 3-methyl-4-ethylpent-4-ene C. 3-(isobutyl)but-3-ene d. 4-ethyl-3-methylpent-4-ene e. 2-ethyl-3-methylhex-2-ene f. 2-(sec-butyl)but-1-ene g. 2-ethyl-3-methylpent-1-ene
What is the systematic IUPAC name for the following Organic compound? OH O a. 2-Ethyl-7-oxodecanoic acid O b. 2-Ethyl-1,7-dioxodecan-1-ol c. 3-Carboxy-8-oxoundecane d. 9-Ethyl-4-oxodecanoic acid e. 1-Hydroxydecan-1,7-dione f. 9-Ethyl-4-oxodecanal What is the correct IUPAC name for the following alkene? CH3 CH3CH2CHC=CH2 CH2CH3 a. 2-(sec-butyl)but-1-ene b. 3-isobutylbut-3-ene c. 4-ethyl-3-methylpent-4-ene d. 2-ethyl-3-methylpent-l-ene e. 3-methyl-4-ethylpent-4-ene f. 2-ethyl-3-methylhex-2-ene g. octene
1. What is the IUPAC name for the following compound? CH3 CI CH3-CH-C- CH-CH CH3 CH3 A) 4-chloro-4,5-dimethyl-2-hexene B) 3-chloro-1,3,4-trimethyl-1-pentene C) 3-chloro-2,3-dimethyl-4-hexene D) 3-chloro-2,3,5-trimethyl-4-pentene E) 3-chloro-1,3,4,4-tetramethyl-1-butene 2. Name the following compound. CH-CH2 CH,CH CH CCH H-CH A) 2,2-diethylpenatane B) 2,2-diethylpentene C) 4-ethyl-4-methyl-5-hexene D) 3-ethyl-3-methyl-1-hexene E) 4-ethyl-4-methylhexane 3. Name the following compound. CH CH CH, CH,CH CC CH CH2CH CH A) 3-butyl-3-propyl-1-pentyne B) 3-butyl-3-propyl-4-pentyne C) 3-ethyl-3-propyl-1-heptyne D) 5-ethyl-5-propyl-6-heptyne E) 3-ethyl-3-butyl-1-hexyne
Select the correct IUPAC name for the following branched
alcohol.
Select the correct IUPAC name for the following branched alcohol. CH3CHCH2CHCH2CH2CH2CH3 CH2CHCH2CHCH2CH3 CH3 CH2CH3 O 3-butyl-7-ethyl-1,5-dimethyl-2-nonanol 7-methyl-9-ethyl-5-(2-hydroxypropyl)undecane 4-butyl-8-ethyl-6-methyl-2-decanol 7-butyl-3-ethyl-5-methyl-9-decanol O
Give the correct IUPAC name for the following compound, CH3 CEC CH3-CH, CH, CH3 O a. 3-methyl-3-hexene Ob. 3-methyl-trans-3-hexene Oc. 2-ethyl-trans-2-pentene O d. 3-methyl-cis-3-hexene Oe. 2-ethyl-2-pentene QUESTION 6 The systematic name for the following is CH3CH2-C-CH-CH3 CH3 a. 2-methyl-3-pentanal b.2-methyl-3-pentanone c. ethyl isopropyl ketone d. 2-methyl-3-propanol e. 2-methyl-3-propanone
1. Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
CH3C(CH3)CH2
CH2O
CH3CH(NH2)CH3
CH3OCH2CH2CH3
CH(CH3)2COOH
For the list above I currently put the following as the IUPAC
names. If any are wrong can you please correct them!
Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
IUPAC Name: 3,3,4-trimethylhexane
IUPAC Name:
3-methyl-4-ol-heptane
CH3C(CH3)CH2 IUPAC Name:
2-methylpropene
CH2O IUPAC Name: methanal
CH3CH(NH2)CH3 IUPAC Name:
isopropylamine
CH3OCH2CH2CH3 IUPAC
Name: methoxyethane (ethyl methyl ether)
CH(CH3)2COOH IUPAC Name:
2-methylpropanoic acid
1. What is the IUPAC name of the following compound? CH, CH,CHCH.SH a. isobutyl mercaptan C. 2-methyl-1-propanthiol b. sec-butyl mercaptan d. 2-methyl-1-propanethiol
What is the correct IUPAC name for the compound shown below? H3C CH3 C=C H CH2CH3 O cis-2-ethyl-2-butene (Z)-2-ethyl-2-butene O (E)-3-methyl-2-pentene O trans-3-methyl-3-pentene O (Z)-3-methyl-2-pentene
What is the correct IUPAC name for the compound shown below? CH3 HC С=С H CH2CH3 O (E)-3-methyl-2-pentene O trans-3-methyl-3-pentene O cis-2-ethyl-2-butene O (Z)-2-ethyl-2-butene O (Z)-3-methyl-2-pentene
ter 5 HW Assignment ter 5 Reading Question 2 Part A 2,5-Diethyl-2-hexene is an incorrect IUPAC name for the following. CH3CH2CH(CH3)CH2CH=C(CH3)CH2CH3 The correct IUPAC name would be View Available Hint(s) 3-ethyl-5-methyl-4-octene 3,5-diethyl-4-hexene 3-methyl-5-ethyl-3-octene 3.5-dimethyl-3-octene Subm
Most questions answered within 3 hours.
-
Where is the error in this code sequence?
String s1 = "Hello";
String s2 = "ello";...
asked 10 months ago -
Financial data for Joel de Paris, Inc., for last year
follow:
Joel de Paris, Inc.
Balance...
asked 10 months ago -
Consider this reaction:
Al2(SO4)3 (aq)+ BaCl3
(aq) Al2Cl6 (aq)- +
3BaSO4(s) . What is the...
asked 10 months ago -
Suppose that Savneet is considering increasing her
recent random sample from 20 car rentals to 40...
asked 10 months ago -
Trucks arrive at an unloading terminal at an average rate of 120
per hour.
Trucks arrive...
asked 10 months ago -
Why are methanol and ethanol completely soluble in water while
octanol is not very little soluble....
asked 10 months ago -
A facilities manager at a university reads in a research report
that the mean amount of...
asked 10 months ago -
When the CuSO4 is rehydrated by adding water to the anhydrous
compound, is this an endothermic...
asked 10 months ago -
A ray of sunlight is passing from diamond into crown glass; the
angle of incidence is...
asked 10 months ago -
A block of mass 0.249 kg is placed on top of a light, vertical
spring of...
asked 10 months ago -
how do the kidneys compensate in the presences of acidosis
a) trigger hyperventilate
b) reserve acid...
asked 10 months ago -
Question 501 pts
The rental rate of capital to the firm increases. Which of the
following...
asked 10 months ago