
or
H2C2O4 (aq) + H2O (l) < ------ > HC2O4 - (aq) + H3O+ (aq)
for this reaction Ka1 = 5.4*10^-2
assume the reaverse reaction, HC2O4- (aq) + H2O (l) < ------ > H2C2O4 (aq) + OH- (aq)
for the above base dissociation reaction k b = kw / Ka1 = 10 ^-14 / 5.2 * 10 ^ -2 = 1.92 * 10^-13

HC2O4 - (aq) + H2O (l) < ------ > C2O4 2- (aq) + H3O+ (aq)
for this reaction Ka2 = 6.4 *106-5
so the acid dissocition constant for HC2O4 > base dissociation constant
i.e Ka > Kb
so answer is D
4 (1 Point) The hydrogen oxalate ion, HC,04 , is amphiprotic. The predominant reaction is.... A....
1. Determine which reactant is limiting the rate of
reaction. Justify the answer.
2. Determine the rate of reaction in trial 1,2,3
3. What are the experimental values for n and m?
Thank you so so much for your help.
Experiment: Reaction Kinetics Aim: To find the reaction orders and rate constants for the following reaction: 3 H2C2O4(aq) + 2 MnO4 (aq) --> 6 CO2+ 2 OH(aq) + 2 H2O + 2 MnO2s In other words to obtain m, n,...
Question 1 (1 point) Reaction of chromium metal with phosphoric acid produces chromium(lI) phosphate and hydrogen gas. Select the correct balanced equation O2Cr(s)+2H3PO4laq)-- 2CrPO4(s)+6H(g) O2Cr(s)+2H3PO4laq)--2CrPO4(s)+3H2(g) O3Cr(s)+3H3PO4(aq)--Cr3(PO4]3(s)+3 H2{g) O2Cr(s)+2H3PO3(aq)--2CrPO3(s)+3H2(g) Question 2 (1 point) Methane gas (CH4) reacts with steam (H20 (g)) to produce hydrogen gas and carbon monoxide gas. Select the correct balanced equation. OCHalg) +H20(g) -- 6H(g)+CO(g) O2CH4(8)+H20(g)- 3H2(g)+2CO(g) OCH4(8) +H20(g) - 3H2(g)+CO(g) OCH4(8) +2H208)-- 4H2{g)+CO2{g) Question 3 (1 point) When the following equation is balanced using the smallest possible...
I hope the answer is clear and correct thanks
Question 1 (1 point) What is the change in enthalpy (in kJ mol'?) for the following reaction F2(g) + Cabr,(s) CaF() + Brz(1) O 1) -112 kJmo12 O2) 504 kJmo11 03) -504 kJmol 1 04) 537 kJmo11 O 5) -537 kJmol'i Question 2 (1 point) What is true about the following reaction at 25°C? F,(g) + 2HCl(g) 2 2017(g) + H (9) Ahrº=76 kJ mol'i Asr°=-10.13 J mol'i Ki Agrº=79 kJ...
Please help with solving Question 1 (A-C) Thank you!
Unless otherwise specified in the problem, you may assume that all solutions are at 25°C. 1. 50.0 mL of a pH 6.00 carbonic acid buffer is titrated with 0.2857 M NaOH, requiring 17.47 mL to reach the second equivalence point. a. Calculate the molarity of carbonic acid and bicarbonate in the original buffer. Carbonic acid: Bicarbonate: b. Calculate the pH of the solution after a total of 100.0 mL of 0.2857...