We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
QUESTION 30 4 po solve the following: Give the answer with the correct sign and in...
What is the product containing copper after the reaction of Cu(NO3)2(aq) + NaOH --> Cu(s) O Cu(NO3)2(aq) Cuo(s) Cu(OH)2(s) CuSO4(aq) none of these The previous problem had you calculate the mass of carbon dioxide produced when a given mass of potassium carbonate reacted with a given volume of nitric acid. In this reaction with the previously given amounts, what is the limiting reactant? K2CO3 (aq) + 2 HNO3 (aq) --> 2KNO3 (aq) + H20 (1) + CO2 (g) O CO2...
Use the References to access important values if needed for this question. When carbon dioxide reacts with potassium hydroxide, potassium carbonate and water are produced. The balanced equation for this reaction is: CO2(g) + 2KOH(aq) + K,CO3(aq) + H2O(1) If 4 moles of carbon dioxide react, The reaction consumes The reaction produces moles of potassium hydroxide. moles of potassium carbonate and _moles of water
Is this answer correct? Also, please help me with the 2nd
question.
1. A 1.500-g sample of potassium hydrogen carbonate is decomposed by heating to produce 1.040 g of potassium carbonate. Calculate the theoretical yield and percent yield of K CO. 2 KHCO3() 4 K2CO3(s) + H2O(g) + CO2(g) 1.500, KHEO3(-)x mo Brux Imot tos 138.2.109 K2CO3 100.129 Hle, 2 mot Kaso, x mol becos 1.0351x100 -0.996 2 (100% 1.040g 1.035 g K2CO3 - 100% 2. A 1.750-g sample containing...
Question 10 10 pts Choose the correct, balanced chemical equation for the following neutralization reaction: nitric acid reacts with aqueous barium hydroxide to form aqueous barium nitrate and water HNO3 + BaOH - BaNO3 + H2O 2 HNO3(aq) + Ba(OH)2(aq) - Ba(NO3)2(aq) + 2 H20(1) HNO3(aq) + Ba(OH)2(aq) + Ba(NO3)2(aq) + H2O(1)
QUESTION 19 4 points Save Ansv Tartaric acid, H6C406(aq), is present in grapes and unripe fruit and reacts with potassium permanganate, KMnO4, and hydrochloric acid in the following way: 2 KMnO4(aq) + H&C4O6(aq)+ 6 HCI (aq) → 2 MnCl2(aq) + 2 KCl (aq) + 6 H20 (1) + 4 CO2(9) An unknown sample containing tartaric acid reacts with excess potassium permanganate at 22.0°C and 587.2 torr. The resulting carbon dioxide gas was collected under conditions similar to the Analysis of...
Question 1 1 pts Calculate the mass of potassium chloride, KCI, (in grams) formed when 7.00 g of chlorine gas is allowed to react with 5.00 g of potassium. (write the chemical reaction first) 7.36 7.38 14.7 4.77 9.53 Question 2 1 pts Carbon dioxide is produced in the following reaction: 5 H2C204(aq) + 2 KMnO4 (aq) + 3 H2SO4 (aq) → 10 CO2(g) + 2 MnSO4 (aq) + K2SO4 (aq) + 8 H20 (1) What is the limiting reagent...
Question 1 (1 point) Reaction of chromium metal with phosphoric acid produces chromium(lI) phosphate and hydrogen gas. Select the correct balanced equation O2Cr(s)+2H3PO4laq)-- 2CrPO4(s)+6H(g) O2Cr(s)+2H3PO4laq)--2CrPO4(s)+3H2(g) O3Cr(s)+3H3PO4(aq)--Cr3(PO4]3(s)+3 H2{g) O2Cr(s)+2H3PO3(aq)--2CrPO3(s)+3H2(g) Question 2 (1 point) Methane gas (CH4) reacts with steam (H20 (g)) to produce hydrogen gas and carbon monoxide gas. Select the correct balanced equation. OCHalg) +H20(g) -- 6H(g)+CO(g) O2CH4(8)+H20(g)- 3H2(g)+2CO(g) OCH4(8) +H20(g) - 3H2(g)+CO(g) OCH4(8) +2H208)-- 4H2{g)+CO2{g) Question 3 (1 point) When the following equation is balanced using the smallest possible...
29999 POSTLAB Analysis of Alka-Seltzer via Gas Evolution NAME DATE SECTION Post-Laboratory Assignment Answer the following on additional sheets of paper: 1. Write balanced chemical equations for each of the following descriptions a potassium carbonate reacts with nitric acid b. calcium bicarbonate reacts with sulfuric acid c. strontium bicarbonate reacts with hydrochloric acid 2. The following reaction is known to occur between carbon dioxide and water CO, (g) + HọO ( - H D , (aq) If the system used...
for
the first question, simple formula is referring to empircial
formula
1. The compound thiophene contains carbon, hydrogen and sulfur. When a sample weighing 2.450 g is subjected to complete combustion analysis with oxygen, 5.126 g of carbon dioxide and 1.049 g of water are produced. What is the simplest formula of thiophene? 2. When zinc metal reacts with copper(II) nitrate, zinc(II) nitrate and copper metal are the products. How many grams of zinc metal are required to react completely...
balance each of the following equations
Fall 209 CHM 105.004 Exam 2 Answer all the question in order in the blue book. Plesse leave at least two lines between question and show your calculations for full credit. N-6.023 x 10” particles per mol: R 0.08.205 L-atm/(mol-K) b) Al2(PO4) 3 e) CuSO4-5 H2O 1. Calculate the molar masses of: a) (NH4)2SO4 2. Calculate: a) the number of atoms of calcium in a 10.50 g sample of the metal b) the mass...