Part A What is the minimum amount of 6.2 M H2SO4 necessary to produce 25.5 g...

Question

Question

Part A What is the minimum amount of 6.2 M H2SO4 necessary to produce 25.5 g of H2(g) according to the following reaction? 2A

science chemistry

Answer 1

Similar Homework Help Questions

How many g Al will react with 24.0 mL of 1.22 M H2SO4? 2Al (s) +...

How many g Al will react with 24.0 mL of 1.22 M H2SO4? 2Al (s) + 3H2SO4 (aq) → Al2(SO4)3 (aq) + 3 H2 (g)
Sulfuric acid dissolves aluminum metal according to the following reaction: 2Al(s)+3H2SO4(aq)-----=Al2(SO4)3(aq)+3H2(g) Suppose you wanted to dissolve...

Sulfuric acid dissolves aluminum metal according to the following reaction: 2Al(s)+3H2SO4(aq)-----=Al2(SO4)3(aq)+3H2(g) Suppose you wanted to dissolve an aluminum block with a mass of 14.9g . What minimum mass of H2SO4 would you need? What mass of H2 gas would be produced by the complete reaction of the aluminum block? Express your answer in grams.
Sulfuric acid can dissolve aluminum metal according to the following reaction. 2Al(s)+3H2SO4(aq)→Al2(SO4)3(aq)+3H2(g) Suppose you wanted to...

Sulfuric acid can dissolve aluminum metal according to the following reaction. 2Al(s)+3H2SO4(aq)→Al2(SO4)3(aq)+3H2(g) Suppose you wanted to dissolve an aluminum block with a mass of 30.0 g 1-What minimum amount of H2SO4 in grams would you need? 2-How many grams of H2 gas would be produced by the complete reaction of the aluminum block?

8. Sulfuric acid dissolves aluminum metal according to the following reaction: 2Al(s) + 3H2SO4(aq) → Al2(SO4)3(aq)...

8. Sulfuric acid dissolves aluminum metal according to the following reaction: 2Al(s) + 3H2SO4(aq) → Al2(SO4)3(aq) + 3H2(g) Suppose you wanted to dissolve an aluminum block with a mass of 15.9 g. [0.5] a. What minimum mass of H2SO4 would you need? b. What mass of H2 gas would be produced by the complete reaction of the aluminum block?
Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such...

Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l) H+⟶ CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 8.00 g of butanoic acid and excess ethanol, how many grams of...
what is the minimum amount volume of 2.5M HNO3 necessary to produce 3.45 g of H2...

what is the minimum amount volume of 2.5M HNO3 necessary to produce 3.45 g of H2 g according to the following reaction 4. What is the minimum amount (volume) of 2.5 M HNO3 necessary to produce 3.45 g of H2(g) according to the following reaction? (4 pts) Mg(s) + 2 HNO3(aq) + Mg(NO3)2(aq) + H2(g)

You may want to reference (Pages 295 - 299) Section 7.4 while completing this problem. Sulfuric...

You may want to reference (Pages 295 - 299) Section 7.4 while completing this problem. Sulfuric acid dissolves aluminum metal according to the following reaction: 2Al(s)+3H2SO4(aq)→Al2(SO4)3(aq)+3H2(g) Suppose you wanted to dissolve an aluminum block with a mass of 15.1 g a. What minimum mass of H2SO4 would you need? b. What mass of H2 gas would be produced by the complete reaction of the aluminum block?
What is the minimum amount of 5.5 M H 2 SO 4 necessary to produce 27.3...

What is the minimum amount of 5.5 M H 2 SO 4 necessary to produce 27.3 g of H 2 (g) according to the following reaction? 2Al(s)+3 H 2 SO 4 (aq)→ Al 2 ( SO 4 ) 3 (aq)+3 H 2 (g)
Q1 :- For the reaction shown, calculate how many grams of oxygen form when each quantity...

Q1 :- For the reaction shown, calculate how many grams of oxygen form when each quantity of reactant completely reacts. 2HgO(s)→2Hg(l)+O2(g) (C) 1.73 kgHgO (D) 3.60 mgHgO Q2:- For the reaction 2KClO3(s)→2KCl(s)+3O2(g) calculate how many grams of oxygen form when each quantity of reactant completely reacts. You may want to reference (Pages 253 - 256) Section 8.4 while completing this problem. A - 2.66 gKClO3 B- 0.400 gKClO3 C- 80.0 kgKClO3 D- 20.8 mgKClO3 Q3:- Sulfuric acid can dissolve aluminum...

Sulfuric acid (H2SO4) dissolves Aluminum metal according to the reaction: 2 Al(s)+ 3 H2SO4(aq) → Al2(SO4)3(aq)...

Sulfuric acid (H2SO4) dissolves Aluminum metal according to the reaction: 2 Al(s)+ 3 H2SO4(aq) → Al2(SO4)3(aq) + 3 H2(g) Suppose you want to dissolve an Aluminum block with a mass of 15.2 g. What minimum mass of H2SO4 (in g) do you need? What mass of H2 gas (in g) can the complete reaction of the aluminum block produce? Please Show Work