(NH4)2CO3(aq) + Cu(NO3)2(aq) ------------> CuCO3(s) + 2NH4NO3(aq)
2NH4^2+(aq) +CO3^2-(aq) + Cu^2+(aq) +2(NO3)-(aq) ------------> CuCO3(s) + 2NH4^+(aq)+2NO3^-(aq)
removal of spectator ions NH4^+, NO3^- to get net ionic equation
spectator ions are NH4^+, NO3^-
CO3^2-(aq) + Cu^2+(aq) ------------> CuCO3(s) net ionic equation
spectator ions are NH4^+, NO3^-
2. Write the net ionic equation for the following. Which ions are spectator ions? (NH4)2CO3(aq) +...
Write the net ionic equation for this precipitation reaction. Include physical states. (NH4)2CO3(aq)+Ca(ClO4)2(aq)⟶CaCO3(s)+2NH4ClO4(aq) net ionic equation:
1(i). Balance the following equations, and then write the net ionic equation (a) (NH4)2CO3(aq) + Cu(NO3)2(aq) → CuCO3(s) + NH4NO3(aq) (b) Mg(OH)2(s) + HCl(aq) → MgCl2(aq) + H2O(l) (c) BaCO3(s) + HBr(aq) → BaBr2(aq) + H2O(l) + CO2(g) (ii). For each reaction equation, identify the driving force of the reaction 2. What is an electrolyte? How can you experimentally differentiate between a weak electrolyte and a strong electrolyte? Name and give the formulas of a strong electrolyte and a weak...
Write the complete ionic and net ionic equations for each of the following reactions: To write complete ionic equations and net ionic equations follow the steps below: (I) Write the molecular equation and balance it. (II) Determine the state of each substance(gas, liquid, solid, aqueous). Use the solubility rules! (III) Write the ionic equation by breaking all the soluble ionic compounds (those marked with an (aq) into their respective ions. (IV) Write the net ionic equation by removing the spectator...
Given the following balanced chemical reaction answer questions a-c below. Cr2(SO4)3 (aq) + 3 (NH4)2CO3 (aq) -> Cr2CO3 (s) + 3 (NH4)2 SO4 (aq) Write the overall ionic balanced chemical equation. Write the net ionic balanced chemical equation. List the spectator ion(s). Given the following balanced chemical reaction answer questions a-c below. Ca(OH)2 (aq) + 2 HClO4 (aq) -> 2 H2O (l) + Ca(ClO4)2 (aq) Write the overall ionic balanced chemical equation. Write the net ionic balanced chemical equation. List...
16. Alexa wants to balance and write net ionic equations for the following equations. a. (8 pts)_HCl(aq) + _NaHCO, (aq) →_NaCl(aq) + _H20 (1) +_CO2 (g) Net ionic equation: Spectator ions: b. (7 pts)__AI (s) + 3 HCl(aq) → __AICI: (ag) + _H2(g) Net ionic equation: Spectator ions: c. (Bonus, +10 pts) NH.NO, (aq) Ca(NO3)2(aq) + (NH4) C3O4 (aq) + CaC104 (s)+ Net ionic equation: Spectator ions:
Write the molecular, total ionic, and net ionic formulas for each: 1. (NH4)2CO3 (aq) + CaCl2 (aq) 2.(NH4)2CO3 (aq) + CuBr2 (aq) 3. (NH4)2CO3 (aq) + Ag2SO4 4. (NH4)2CO3 (aq) + SrNO3 5. Ba(C2H3O2) (aq) + K2CrO4 6. Ba(C2H3O2) (aq) + AgSO4 7. Ba(C2H3O2) (aq) + NaOH 8. AgSO4 + CaCl2 9. CaCl2 + NaOH 10. CuBr2 + K2CrO7 11. CuBr2 + Ag2SO4 12. CuBr2 + NaOH 13. K2CrO7 + Ag2SO4 14. Ag2SO4 + NaOH 15. NaOH + SrNO3 Pls...
Write the molecular equation, ionic equation and net ionic equation for the following reaction: (Predict the spectator ions) sodium chloride(aq) + silver nitrate(aq) → sodium nitrate(aq) + silver chloride(s)
Write molecular, ionic, and net ionic equations for the following Na3PO4 + FeSO4 (NH4)2CO3 + Cr(NO3)3 . Na2S + Zn(NO3)2 NaCl + KNO3
Write the net ionic equation of the following reaction. Al(NO3)3(aq)+(NH4)3PO4(aq)->AlPO4(s)+3NH4NO3(aq)
Na2SO4+(NH4)2CO3=Na2CO3+(NH4)2SO4 Balanced equation: Ionic equation: Net ionic equation: