When aqueous solutions of Pb(NO3)2 and NaCl are mixed, PbCl2precipitates. The balanced net ionic equation is?
When aqueous solutions of Pb(NO3)2 and NaCl are mixed, PbCl2precipitates. The balanced net ionic equation is?
Write the balanced net ionic equation for the reactions that occur when the given aqueous solutions are mixed. Include the physical states. A. nitric acid, HNO3, and calcium hydroxide, Ca(OH)2 B. lead (II) nitrate, Pb(NO3)2, and potassium iodide, KI
Write the balanced NET ionic equation for the reaction when HCIO4 and HI are mixed in aqueous solution. If no reaction occurs, write only NR. Write the balanced NET ionic equation for the reaction when Znl2 and Pb(CIO4)2 are mixed in aqueous solution. If no reaction occurs, write only NR.
(a) When aqueous solutions of Pb(NO3)2 and NiCl2 are mixed, does a precipitate form? _____yesno (b) Write a balanced equation for the precipitation reaction that occurs when aqueous solutions of lead(II) nitrate and sodium phosphate are combined. Use the pull-down boxes to include states such as (s) or (aq). (aq)(s)(l)(g) + (aq)(s)(l)(g) -> (aq)(s)(l)(g) + (aq)(s)(l)(g)
Write the balanced net ionic equation for the reactions that occur when the given aqueous solutions are mixed. Include the physical states. A. silver nitrate, AgNO3, and magnesium bromide, MgBr, net ionic equation: B. perchloric acid, HCIO , and potassium hydroxide, KOH net ionic equation: C. ammonium sulfide, (NH),S, and cobalt(II) chloride, COCI, net ionic equation:
Write the balanced net ionic equation for the reactions that occur when the given aqueous solutions are mixed. Include the physical states. A. silver nitrate, AgNO3 , and magnesium bromide, MgBr2 net ionic equation: B. perchloric acid, HClO4 , and potassium hydroxide, KOH net ionic equation: C. ammonium sulfide, (NH4)2S , and cobalt(II) chloride, CoCl2 net ionic equation:
Write the balanced net ionic equation for the reactions that occur when the given aqueous solutions are mixed. Include the physical states. A. silver nitrate, AgNO, and magnesium bromide, MgBr net ionic equation: B. perchloric acid, HCIO, and potassium hydroxide, KOH net ionic equation: C. ammonium sulfide, (NH),S, and cobalt(II) chloride, CoCl, net ionic equation:
44.2 mL of aqueous 0.255 M Pb(NO3)2 is mixed with 31.6 mL of 0.415 M NaCl. The equation for the precipitate reaction is: Pb(NO3)2 (aq) + 2 NaCl (aq) --> PbCl2 (s) + 2 NaNO3 (aq) The concentration of NO3- ion in the reaction solution is _____ M.
44.1 mL of aqueous 0.255 M Pb(NO3)2 is mixed with 38.5 mL of 0.415 M NaCl. The equation for the precipitate reaction is: Pb(NO3)2 (aq) + 2 NaCl (aq) --> PbCl2 (s) + 2 NaNO3 (aq) The concentration of Pb2+ ion in the solution is _____ M after the reaction is complete.
Na2SO4+Pb(NO3)2=Na2(NO3)2+PbSO4 Balanced equation: Ionic equation:
i
need the answers please
4. Write a balanced, ionic equation for the reaction that occurs when aqueous solutions of calcium chloride (CaCl2) and silver nitrate (AgNO) are mixed. CaCl2 + 2AgNO3 + Ca(NO3)2 + 2Agci