![1. (a) Give the systematic IUPAC names for each of the following complexes/ions (1) (NH4) [NiCl4] (ii) [Cr(H204(NH3)2]2+ (iii](http://img.homeworklib.com/questions/09abe560-d3bf-11eb-9311-a93d179fa1e0.png?x-oss-process=image/resize,w_560)
Homework Answers
![| 1 (ANH), Ni ] In this case, Ni is in the anionic part. So, as per IUPAC nomenclature, Ni will be Nickelate. So, IUPAC Name](http://img.homeworklib.com/questions/521db3c0-d3bf-11eb-8755-c98d024bc0f7.png?x-oss-process=image/resize,w_560)
Add Answer to:
1. (a) Give the systematic IUPAC names for each of the following complexes/ions (1) (NH4) [NiCl4]...
Nomenclature Coordinate Complexes | <Br< SCN < Cl< O=N-0 <F <OH <C:0-(oxalato) < 0,2-<H2O <SCN <NH;...
Nomenclature Coordinate Complexes | <Br< SCN < Cl< O=N-0 <F <OH <C:0-(oxalato) < 0,2-<H2O <SCN <NH; <en (H2NCH2CH2NH2) NO2 <CN <CO Formula Name # of lone de [Cr. (NH3)3 (+20)})( triamminetriaquachromium(III) chloride [Fe(NH3).](NO2) hexaammineiron (111) nitrate [pt leng (12232 dithicyanodi(ethylenediamine)platinum(IV) chloride [Co(C204)(CO)]* Owlbunyoleation contu) lon ammonium tetraiodicuprate(II) INHO), [LUIGI Ke[Fe(ONO).] [ Fel NH3)6] hexaammineiron(III) hexahydroxochromate(III) [Co(H2NCH2CH2NH3)4](SO4)3 | +r15 4+ hy • he ºlfa wine) ¢e bal} (1) v10a4e pentaaquahydroxoiron(III) ion [Fe(H2E), GH) +2. (NH4)[Ni(O2)2(H2O)2] ammunium cinquabiscova lato) nickelate CI) AN...
2. Give a systematic name for each of the following compounds, and give the number of...
2. Give a systematic name for each of the following compounds, and give the number of d electrons for the transition metal: a. Cs2[FeCl4] b. W(CO)6 c. Na2[Cr(CO)5] d. [Ni(NH3)2(en)2](PF6)2 (PF6 is a (1-) ion, and is named as if phosphorus were a metal) e. [Ru(CN)6]3– f. K[OsF6]
1. Name the following transition metal complexes AND give the coordination number for each metal in the complex ion...
1. Name the following transition metal complexes AND give the coordination number for each metal in the complex ion: Name Coordination # (a) K[Fe(CN).] (b)Ks[Fe(ox).] (c) Cr(en).]C13 (d) (Cr(NH3):(HO)](NO3) (e)ky [Cr(NH3),Cla]
3. Assign a systematic name to each of the following chemical compounds: (a) NH4[Cr(NH3)2(NCS)4] (b) [Tc(CO)s]I...
3. Assign a systematic name to each of the following chemical compounds: (a) NH4[Cr(NH3)2(NCS)4] (b) [Tc(CO)s]I (c) K[Mn(CN)s] (d) [CO(NH3)4(OH2)Cl]Br2
Please answer all of the following: a) Give the correct IUPAC name and sketch the structure...
Please answer all of the following: a) Give the correct IUPAC name and sketch the structure of the transition metal complex for each of the following compounds. If multiple stereoisomers are possible, give both names and structures: 1) [Pt(NH3)2Cl2] 2) [Cr(NMe3)4Br2]PF6 3) K[Co(edta)], where H4(edta) = ethylenediaminetetraacetic acid 4) [Ir(CO)Cl(PPh3)2] 5) Hg[Co(NCO)4] 6) [Fe(acac)3], where H(acac) = acetylacetone 7) [Co(NH3)6]3+[Cr(CN)6]3- 8) [{Co(NH3)5}2(μ-OH)]Cl5 9) [TiCl3(thf)3], where thf = tetrahydrofuran 10) [Ru(bpy)2Cl2], where bpy = 2,2’-bipyridine 11) V(O)(acac)2, where H(acac) = acetylacetone...
1. For each of the following complexes, give the electron configurations of the d-type M Os,...
1. For each of the following complexes, give the electron configurations of the d-type M Os, for tetrahedral complexes. Also ie ) (e) for octahedral complexes and (e( ch complex in units of the Bohr , Fe(CN) 3, CoCl , Ni(CO)4, Ti(H2O) +, magnet n f.в Co ( NH3) 3+, Co(FLO)r", Fe(CN) V Fa". Cu(H2O) г., CuCl? , V(CO), Cr(CO) each octahedral complex is high-spi the ligand field theory notes). ust use your judgment as to whether n or low-spin...
just part d please 1. For the following complexes: i) give the formal oxidation state of...
just part d please
1. For the following complexes: i) give the formal oxidation state of the metal ii) the d count for the metal ions (e.g. Fe → d). iii) sketch the compound iv) give its point group v) provide a qualitative o-only d-orbital splitting diagram indicating the correct symbols for the point group (i.e. a10) vi) Indicate if you would predict a Jahn-Teller distortion (no need to distort to splitting diagram) vii) Calculate the spin-only value of Weft,...
1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH...
1. Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
CH3C(CH3)CH2
CH2O
CH3CH(NH2)CH3
CH3OCH2CH2CH3
CH(CH3)2COOH
For the list above I currently put the following as the IUPAC
names. If any are wrong can you please correct them!
Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
IUPAC Name: 3,3,4-trimethylhexane
IUPAC Name:
3-methyl-4-ol-heptane
CH3C(CH3)CH2 IUPAC Name:
2-methylpropene
CH2O IUPAC Name: methanal
CH3CH(NH2)CH3 IUPAC Name:
isopropylamine
CH3OCH2CH2CH3 IUPAC
Name: methoxyethane (ethyl methyl ether)
CH(CH3)2COOH IUPAC Name:
2-methylpropanoic acid
just part f please 1. For the following complexes: i) give the formal oxidation state of...
just part f please
1. For the following complexes: i) give the formal oxidation state of the metal ii) the d count for the metal ions (e.g. Fe → d) iii) sketch the compound iv) give its point group v) provide a qualitative o-only d-orbital splitting diagram indicating the correct symbols for the point group (i.e. a1g) vi) Indicate if you would predict a Jahn-Teller distortion (no need to distort to splitting diagram) vii) Calculate the spin-only value of off,...
1. Which of the followi ch of the following reactions is not readily explained by the...
1. Which of the followi ch of the following reactions is not readily explained by the Arrhenius concept of acids and bases? a. A. HCl(aq) + NaOH(aq) - NaCl(aq) + H20() b. H30(aq) + OH-(aq) + 2H20(1) c. HCI(g) + NH3(g) - NH4Cl(s) d. HC2H302(aq) + H2O(l) H30*(aq) + C2H302-(ag) e. H30 (aq) + OH-(aq) + 2H2O(aq) 2. Classify each of the following species as Brønsted acid or base or both: a) H20, b) OH", c) H30, d) NH3, e)...
Nomenclature Coordinate Complexes | <Br< SCN < Cl< O=N-0 <F <OH <C:0-(oxalato) < 0,2-<H2O <SCN <NH; <en (H2NCH2CH2NH2) NO2 <CN <CO Formula Name # of lone de [Cr. (NH3)3 (+20)})( triamminetriaquachromium(III) chloride [Fe(NH3).](NO2) hexaammineiron (111) nitrate [pt leng (12232 dithicyanodi(ethylenediamine)platinum(IV) chloride [Co(C204)(CO)]* Owlbunyoleation contu) lon ammonium tetraiodicuprate(II) INHO), [LUIGI Ke[Fe(ONO).] [ Fel NH3)6] hexaammineiron(III) hexahydroxochromate(III) [Co(H2NCH2CH2NH3)4](SO4)3 | +r15 4+ hy • he ºlfa wine) ¢e bal} (1) v10a4e pentaaquahydroxoiron(III) ion [Fe(H2E), GH) +2. (NH4)[Ni(O2)2(H2O)2] ammunium cinquabiscova lato) nickelate CI) AN...
1. Name the following transition metal complexes AND give the coordination number for each metal in the complex ion: Name Coordination # (a) K[Fe(CN).] (b)Ks[Fe(ox).] (c) Cr(en).]C13 (d) (Cr(NH3):(HO)](NO3) (e)ky [Cr(NH3),Cla]
3. Assign a systematic name to each of the following chemical compounds: (a) NH4[Cr(NH3)2(NCS)4] (b) [Tc(CO)s]I (c) K[Mn(CN)s] (d) [CO(NH3)4(OH2)Cl]Br2
1. For each of the following complexes, give the electron configurations of the d-type M Os, for tetrahedral complexes. Also ie ) (e) for octahedral complexes and (e( ch complex in units of the Bohr , Fe(CN) 3, CoCl , Ni(CO)4, Ti(H2O) +, magnet n f.в Co ( NH3) 3+, Co(FLO)r", Fe(CN) V Fa". Cu(H2O) г., CuCl? , V(CO), Cr(CO) each octahedral complex is high-spi the ligand field theory notes). ust use your judgment as to whether n or low-spin...
just part d please
1. For the following complexes: i) give the formal oxidation state of the metal ii) the d count for the metal ions (e.g. Fe → d). iii) sketch the compound iv) give its point group v) provide a qualitative o-only d-orbital splitting diagram indicating the correct symbols for the point group (i.e. a10) vi) Indicate if you would predict a Jahn-Teller distortion (no need to distort to splitting diagram) vii) Calculate the spin-only value of Weft,...
1. Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
CH3C(CH3)CH2
CH2O
CH3CH(NH2)CH3
CH3OCH2CH2CH3
CH(CH3)2COOH
For the list above I currently put the following as the IUPAC
names. If any are wrong can you please correct them!
Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
IUPAC Name: 3,3,4-trimethylhexane
IUPAC Name:
3-methyl-4-ol-heptane
CH3C(CH3)CH2 IUPAC Name:
2-methylpropene
CH2O IUPAC Name: methanal
CH3CH(NH2)CH3 IUPAC Name:
isopropylamine
CH3OCH2CH2CH3 IUPAC
Name: methoxyethane (ethyl methyl ether)
CH(CH3)2COOH IUPAC Name:
2-methylpropanoic acid
just part f please
1. For the following complexes: i) give the formal oxidation state of the metal ii) the d count for the metal ions (e.g. Fe → d) iii) sketch the compound iv) give its point group v) provide a qualitative o-only d-orbital splitting diagram indicating the correct symbols for the point group (i.e. a1g) vi) Indicate if you would predict a Jahn-Teller distortion (no need to distort to splitting diagram) vii) Calculate the spin-only value of off,...
1. Which of the followi ch of the following reactions is not readily explained by the Arrhenius concept of acids and bases? a. A. HCl(aq) + NaOH(aq) - NaCl(aq) + H20() b. H30(aq) + OH-(aq) + 2H20(1) c. HCI(g) + NH3(g) - NH4Cl(s) d. HC2H302(aq) + H2O(l) H30*(aq) + C2H302-(ag) e. H30 (aq) + OH-(aq) + 2H2O(aq) 2. Classify each of the following species as Brønsted acid or base or both: a) H20, b) OH", c) H30, d) NH3, e)...
Most questions answered within 3 hours.
-
Where is the error in this code sequence?
String s1 = "Hello";
String s2 = "ello";...
asked 10 months ago -
Financial data for Joel de Paris, Inc., for last year
follow:
Joel de Paris, Inc.
Balance...
asked 10 months ago -
Consider this reaction:
Al2(SO4)3 (aq)+ BaCl3
(aq) Al2Cl6 (aq)- +
3BaSO4(s) . What is the...
asked 10 months ago -
Suppose that Savneet is considering increasing her
recent random sample from 20 car rentals to 40...
asked 10 months ago -
Trucks arrive at an unloading terminal at an average rate of 120
per hour.
Trucks arrive...
asked 10 months ago -
Why are methanol and ethanol completely soluble in water while
octanol is not very little soluble....
asked 10 months ago -
A facilities manager at a university reads in a research report
that the mean amount of...
asked 10 months ago -
When the CuSO4 is rehydrated by adding water to the anhydrous
compound, is this an endothermic...
asked 10 months ago -
A ray of sunlight is passing from diamond into crown glass; the
angle of incidence is...
asked 10 months ago -
A block of mass 0.249 kg is placed on top of a light, vertical
spring of...
asked 10 months ago -
how do the kidneys compensate in the presences of acidosis
a) trigger hyperventilate
b) reserve acid...
asked 10 months ago -
Question 501 pts
The rental rate of capital to the firm increases. Which of the
following...
asked 10 months ago