Homework Answers
Add Answer to:
if
a solution containing 0.12 M CO32-, N3, Br-, and CN- is treated
with Ag+, in...
If a solution containing 0.16 M CO_3^2- BrO_3, I^-, and N_3^- is treated with Ag^+, in...
If a solution containing 0.16 M CO_3^2- BrO_3, I^-, and N_3^- is treated with Ag^+, in what order will the anions precipitate? (order your answer from first to last. Use the appropriate or symbol to separate <, =, or > substances in the list.)
1. If a solution containing 0.100 M Cl, Br,I and CrO4 is treated with Hg22* in...
1. If a solution containing 0.100 M Cl, Br,I and CrO4 is treated with Hg22* in what order will the ions precipitate? (There are 2 values for HgaBr2 you should use 5.6 x 1023) (ignore Activities) hw 20.0 What is the pH in a saturated solution of Ca(OH)2? (solvent is Pure Water with u = 0) 2.
please help If a solution containing 0.100M CI, Br,t and CrO is treated with Hg22 in...
please help
If a solution containing 0.100M CI, Br,t and CrO is treated with Hg22 in what order will the ions precipitate? (There are 2 values for HgaBr2 you should use 5.6 x 1023) (lgnore Activities) 1.
Commercial silver plating operations frequently use a solution containing the complex |Ag(CN)_2] ion. Because the formation...
Commercial silver plating operations frequently use a solution containing the complex |Ag(CN)_2] ion. Because the formation constant K_f is quite large, this procedure ensures that the free Ag+ concentration in solution is low to promote uniform electrodeposition. In one process, a chemist added 9.0 L of 1.1M NaCN to 90.0 L of 0.12 M AgN0_3. Calculate the concentration of free Ag+ ions at equilibrium. K_f for this reaction is 1.0 times 10^21. Enter your answer in scientific notation.
Refer to the precipitation reaction below. CoCl2(aq)+2NaOH(ag) Co(OH)2(s)+2NaCI(aq) How much 0.5 M NaOH solution in liters...
Refer to the precipitation reaction below. CoCl2(aq)+2NaOH(ag) Co(OH)2(s)+2NaCI(aq) How much 0.5 M NaOH solution in liters will completely precipitate the Co+ in 1.6 L of 0.12 M CoCl solution? Round to two significant figures, and do not include units in your answer Provide your answer below
What is the activity coefficient of H in a solution containing 0.073 M HCI and 0.0090...
What is the activity coefficient of H in a solution containing 0.073 M HCI and 0.0090 M Ca(CIO,)? Activity coefficients at various ionic strengths can be found in this table. Y = What is the pH of this solution? pH Charge +/-1 H* Activity coefficient (y) 900 (CaH5i2CHCO2, (C3H7)4N* (02N)3CH20",(C3H7) NH*, CH3OgH4Co2 0.967 0.933 0.914 0.96 800 0.966 0.931 0.83 0.912 0.85 0.82 700 0.965 0.930 0.909 0.845 0.81 L CeHsCO2, HOC H4CO, CICeH4CO, CsHgCH2C02 CH2-CHCH2CO2(CH3)2CHCH2CO2, (CH3CH2)4N, (C3H7)2NH2+ 600 0.965...
Convert playlist Diction QUESTIONS 1. (2 Points) Why is it essential to keep the diazonium salt...
Convert playlist Diction QUESTIONS 1. (2 Points) Why is it essential to keep the diazonium salt at zero degrees while you are preparing the sodium 2-naphthoxide solution? 2. (2 Points) Would you need to use sodium carbonate for the diazotization of meta- nitroaniline? Explain your answer. 3. (2 Points) What would be the IUPAC name for the azo dye if you would have used p-chloroaniline instead of sulfanilic acid? Experiment 12 4. (4 Points) Calculate the theoretical yield for Orange...
10. Write a one-page summary of the attached paper? INTRODUCTION Many problems can develop in activated...
10. Write a one-page summary of the attached paper? INTRODUCTION Many problems can develop in activated sludge operation that adversely affect effluent quality with origins in the engineering, hydraulic and microbiological components of the process. The real "heart" of the activated sludge system is the development and maintenance of a mixed microbial culture (activated sludge) that treats wastewater and which can be managed. One definition of a wastewater treatment plant operator is a "bug farmer", one who controls the aeration...
If a solution containing 0.16 M CO_3^2- BrO_3, I^-, and N_3^- is treated with Ag^+, in what order will the anions precipitate? (order your answer from first to last. Use the appropriate or symbol to separate <, =, or > substances in the list.)
1. If a solution containing 0.100 M Cl, Br,I and CrO4 is treated with Hg22* in what order will the ions precipitate? (There are 2 values for HgaBr2 you should use 5.6 x 1023) (ignore Activities) hw 20.0 What is the pH in a saturated solution of Ca(OH)2? (solvent is Pure Water with u = 0) 2.
please help
If a solution containing 0.100M CI, Br,t and CrO is treated with Hg22 in what order will the ions precipitate? (There are 2 values for HgaBr2 you should use 5.6 x 1023) (lgnore Activities) 1.
Commercial silver plating operations frequently use a solution containing the complex |Ag(CN)_2] ion. Because the formation constant K_f is quite large, this procedure ensures that the free Ag+ concentration in solution is low to promote uniform electrodeposition. In one process, a chemist added 9.0 L of 1.1M NaCN to 90.0 L of 0.12 M AgN0_3. Calculate the concentration of free Ag+ ions at equilibrium. K_f for this reaction is 1.0 times 10^21. Enter your answer in scientific notation.
Refer to the precipitation reaction below. CoCl2(aq)+2NaOH(ag) Co(OH)2(s)+2NaCI(aq) How much 0.5 M NaOH solution in liters will completely precipitate the Co+ in 1.6 L of 0.12 M CoCl solution? Round to two significant figures, and do not include units in your answer Provide your answer below
What is the activity coefficient of H in a solution containing 0.073 M HCI and 0.0090 M Ca(CIO,)? Activity coefficients at various ionic strengths can be found in this table. Y = What is the pH of this solution? pH Charge +/-1 H* Activity coefficient (y) 900 (CaH5i2CHCO2, (C3H7)4N* (02N)3CH20",(C3H7) NH*, CH3OgH4Co2 0.967 0.933 0.914 0.96 800 0.966 0.931 0.83 0.912 0.85 0.82 700 0.965 0.930 0.909 0.845 0.81 L CeHsCO2, HOC H4CO, CICeH4CO, CsHgCH2C02 CH2-CHCH2CO2(CH3)2CHCH2CO2, (CH3CH2)4N, (C3H7)2NH2+ 600 0.965...
Convert playlist Diction QUESTIONS 1. (2 Points) Why is it essential to keep the diazonium salt at zero degrees while you are preparing the sodium 2-naphthoxide solution? 2. (2 Points) Would you need to use sodium carbonate for the diazotization of meta- nitroaniline? Explain your answer. 3. (2 Points) What would be the IUPAC name for the azo dye if you would have used p-chloroaniline instead of sulfanilic acid? Experiment 12 4. (4 Points) Calculate the theoretical yield for Orange...
Most questions answered within 3 hours.
-
Where is the error in this code sequence?
String s1 = "Hello";
String s2 = "ello";...
asked 10 months ago -
Financial data for Joel de Paris, Inc., for last year
follow:
Joel de Paris, Inc.
Balance...
asked 10 months ago -
Consider this reaction:
Al2(SO4)3 (aq)+ BaCl3
(aq) Al2Cl6 (aq)- +
3BaSO4(s) . What is the...
asked 10 months ago -
Suppose that Savneet is considering increasing her
recent random sample from 20 car rentals to 40...
asked 10 months ago -
Trucks arrive at an unloading terminal at an average rate of 120
per hour.
Trucks arrive...
asked 10 months ago -
Why are methanol and ethanol completely soluble in water while
octanol is not very little soluble....
asked 10 months ago -
A facilities manager at a university reads in a research report
that the mean amount of...
asked 10 months ago -
When the CuSO4 is rehydrated by adding water to the anhydrous
compound, is this an endothermic...
asked 10 months ago -
A ray of sunlight is passing from diamond into crown glass; the
angle of incidence is...
asked 10 months ago -
A block of mass 0.249 kg is placed on top of a light, vertical
spring of...
asked 10 months ago -
how do the kidneys compensate in the presences of acidosis
a) trigger hyperventilate
b) reserve acid...
asked 10 months ago -
Question 501 pts
The rental rate of capital to the firm increases. Which of the
following...
asked 10 months ago