


need help with these two rxns please NaNO2, HCl (CH3CH2)2NH, HT 2 CH3 CH2CH3
Please Help!!
QUESTION 1 What is the IUPAC name for this compound? CH3 CH3CH2 QUESTION 2 What is the IUPAC name for this compound? CH2CH3 QUESTION 3 What is the IUPAC name for this compound? снэ HE
Question 5 Which structure below is a tertiary amine? (CH3CH2)3CNHCH2CH3 (CH3)3CHNH2 CH3CH2NHCH(CH3)2 CH3CH2N(CH3)CH2CH3 Question 6 What is the IUPAC name of CH3C(CH3)2CH2CH(CH2CH3)CH2CH2CH3? 4-isopropyl-2,2-dimethyheptane 2,2,3,4-tetramethylheptane 4-ethyl-2,2-dimethylheptane 2,2,4-trimethyloctane
Please provide an IUPAC name for each of the following structures CH3 HзС, CH2CH3CHCH3 F CH2CH3 CH3CH2 CH3 Br CI BrCH2CH2CH-CCH3 CH2CH3 CH3CH2CH2CH2CCH2CH2CH3 CH2 CHз CH3CH2CH2 CH2CH3CH2CH3 н н НзС CH3
could someone help with this plz
Identify the correct structure of trans-2-methyl-3-hexene Select one CH3CH2 CH 3 CH3 CH2CH3 CH CH2 CH2CH3 CH3 CH CH CH2CH3 ?-? CH CH CH C=C CH2CH3
A. 1. CCN 2.Ht, H2O, a B. 1. NaNO2, HCl 2. Cu CN c. 1. Mg D. INGH 2. CO2 3. H3O+ 2. ^ Br E. 1. mg 2. To 3. H+, H2O F. PCC G. KMn DA H2O, HO- Jo ling H. 1. mg 2.co 3. Haot 4. PCC 3. Ht, H2O + PCC He Ko Al Cly carry *Determine the reagents necessary to out each of the following transformation. -NH2 .CN -OH OH -OH 16 ibis
please help
Which reaction sequence would best accomplish this transformation? ON N(CH3)2 LIN(CH3)2 SOCI (CH3)2NH NH, CH 1 (excess) O NaBH (CH3)NH Question 5 (2 points) Which reaction sequence is preferred for this conversion? chyckéon --ch,CH.CH O soc. CHUMBO SOCCHIO Which reaction sequence is preferred for this conversion? chyce.Con -ca.ch.ch O sock CHxMgBr – H40 O soch. (CH)Culi. OCHMBYMO O sock, CHL. HO
Which of following is the best starting material for the reaction below? 1. (CH3)2NH ? 2. LIAIHA 3. H20 'N NK CN NH2 What is the major product in the following reaction? 1. DIBAL 2. H20 O H O OH OH СІ Which reaction sequence would accomplish this transformation? CN H2SO4/HNO3 Br2 NaNO2/HCI CuCN O Br2/FeBr3 H2SO4/HNO3 KF NaNO2/HCI O H2SO4/HNO3 Zn(Hg)/HCI NaNO2/HCI CuCN o H2SO4/HNO3 Zn(Hg/HCI NaNO2/HCI HBF4
need help please
나hur 5. OH Ht
Organic Chemistry Name the following alkenes, please show steps to solve these types. Thank You. (CH3)3CCH=CCl2 (CH3CH2)2C=CHCH3 (CH3CH2)2C=C(CH2CH3)2
please help with these 2 questions
the following is formed in the step shown below? CH3CH2 CI +NH3 CH3CH2NH3 3) CH3CH2CCI NH3 OH CH3CH2 C NH3 re more acidic than alcoh