write the common and systematic (IUPAC) names of the ether that has the following structure CH3---O---CH2CH3...
write the common and systematic (IUPAC) names of the ether that has the following structure
CH3---O---CH2CH3
Common name:
Systematic name:
Homework Answers
Add Answer to:
write the common and systematic (IUPAC) names of the ether that
has the following structure
CH3---O---CH2CH3...
Write the common and systematic (IUPAC) names of the ether that has the following structure. H3C-O-CH2CH3...
Write the common and systematic (IUPAC) names of the ether that has the following structure. H3C-O-CH2CH3 Common name: Systematic name
Write the common and systematic (IUPAC) names of the ether that has the given structure. -O -CH3 common name: ethyl...
Write the common and systematic (IUPAC) names of the ether that has the given structure. -O -CH3 common name: ethyl methyl ether systematic name: methoxyethane
Write the common and systematic (IUPAC) names of the ether that has the given structure. -O-CH₂...
Write the common and systematic (IUPAC) names of the ether that has the given structure. -O-CH₂ common name: S E systematic name:
1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH...
1. Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
CH3C(CH3)CH2
CH2O
CH3CH(NH2)CH3
CH3OCH2CH2CH3
CH(CH3)2COOH
For the list above I currently put the following as the IUPAC
names. If any are wrong can you please correct them!
Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
IUPAC Name: 3,3,4-trimethylhexane
IUPAC Name:
3-methyl-4-ol-heptane
CH3C(CH3)CH2 IUPAC Name:
2-methylpropene
CH2O IUPAC Name: methanal
CH3CH(NH2)CH3 IUPAC Name:
isopropylamine
CH3OCH2CH2CH3 IUPAC
Name: methoxyethane (ethyl methyl ether)
CH(CH3)2COOH IUPAC Name:
2-methylpropanoic acid
Problem 47. 'rovide proper IUPAC names for each compound. CH2CH2CH3 CH2CHCH2CHCHCH; CH2CH3 CH3 48. Provide a...
Problem 47. 'rovide proper IUPAC names for each compound. CH2CH2CH3 CH2CHCH2CHCHCH; CH2CH3 CH3 48. Provide a name for the structure below. (IUPAC) CH3 419. Provide a name for the compound below. ĆUPAC) CH; CH,CECCHCH,CH2CH3 50. Provide the correct IUPAC name for the following compound. NOZ G CH 57. Give an acceptable name for the following substance. I UPAC HOCH,CH,OH S. Provide the IUPAC name for the structure below. H NO2 1. 53. Provide the IUPAC name for the following structure....
? What is the common name of the ether that has the structure shown? H3C-O-CH2CH3 common...
?
What is the common name of the ether that has the structure shown? H3C-O-CH2CH3 common name:
What is the common name of the ether that has the structure shown? H3C-O-CH2CH3 common name:
What is the common name of the ether that has the structure shown? H3C-O-CH2CH3 common name:
Write an acceptable IUPAC name for the compound below. (Only systematic names, not common names are...
Write an acceptable IUPAC name for the compound below. (Only systematic names, not common names are accepted by this question.) Keep the information page open for feedback reference. The IUPAC name is Submit Answer Retry Entire Group 3 more group attempts remaining Write an acceptable IUPAC name for the compound below. (Only systematic names, not common names are accepted by this question.) Keep the information page open for feedback reference. The IUPAC name is Submit Answer Retry Entire Group 3...
Write an acceptable IUPAC name for the compound below. (Only systematic names, not common names are...
Write an acceptable IUPAC name for the compound below. (Only systematic names, not common names are accepted by this question.) Keep the information page open for feedback reference. The IUPAC name is
Write the systematic (IUPAC) names for the amines shown below. The names should have the format...
Write the systematic (IUPAC) names for the amines shown below. The names should have the format alkanamine H3C-CH2-N- CH2CH3 CH2 CH2 CH3 H3C-NCH2 CH3 H3C-CH2CH2CH2 amines. These compounds are Select answer
Write the common and systematic (IUPAC) names of the ether that has the following structure. H3C-O-CH2CH3 Common name: Systematic name
Write the common and systematic (IUPAC) names of the ether that has the given structure. -O -CH3 common name: ethyl methyl ether systematic name: methoxyethane
Write the common and systematic (IUPAC) names of the ether that has the given structure. -O-CH₂ common name: S E systematic name:
1. Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
CH3C(CH3)CH2
CH2O
CH3CH(NH2)CH3
CH3OCH2CH2CH3
CH(CH3)2COOH
For the list above I currently put the following as the IUPAC
names. If any are wrong can you please correct them!
Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
IUPAC Name: 3,3,4-trimethylhexane
IUPAC Name:
3-methyl-4-ol-heptane
CH3C(CH3)CH2 IUPAC Name:
2-methylpropene
CH2O IUPAC Name: methanal
CH3CH(NH2)CH3 IUPAC Name:
isopropylamine
CH3OCH2CH2CH3 IUPAC
Name: methoxyethane (ethyl methyl ether)
CH(CH3)2COOH IUPAC Name:
2-methylpropanoic acid
Problem 47. 'rovide proper IUPAC names for each compound. CH2CH2CH3 CH2CHCH2CHCHCH; CH2CH3 CH3 48. Provide a name for the structure below. (IUPAC) CH3 419. Provide a name for the compound below. ĆUPAC) CH; CH,CECCHCH,CH2CH3 50. Provide the correct IUPAC name for the following compound. NOZ G CH 57. Give an acceptable name for the following substance. I UPAC HOCH,CH,OH S. Provide the IUPAC name for the structure below. H NO2 1. 53. Provide the IUPAC name for the following structure....
?
What is the common name of the ether that has the structure shown? H3C-O-CH2CH3 common name:
What is the common name of the ether that has the structure shown? H3C-O-CH2CH3 common name:
Write an acceptable IUPAC name for the compound below. (Only systematic names, not common names are accepted by this question.) Keep the information page open for feedback reference. The IUPAC name is Submit Answer Retry Entire Group 3 more group attempts remaining Write an acceptable IUPAC name for the compound below. (Only systematic names, not common names are accepted by this question.) Keep the information page open for feedback reference. The IUPAC name is Submit Answer Retry Entire Group 3...
Write an acceptable IUPAC name for the compound below. (Only systematic names, not common names are accepted by this question.) Keep the information page open for feedback reference. The IUPAC name is
Write the systematic (IUPAC) names for the amines shown below. The names should have the format alkanamine H3C-CH2-N- CH2CH3 CH2 CH2 CH3 H3C-NCH2 CH3 H3C-CH2CH2CH2 amines. These compounds are Select answer
Most questions answered within 3 hours.
-
Where is the error in this code sequence?
String s1 = "Hello";
String s2 = "ello";...
asked 10 months ago -
Financial data for Joel de Paris, Inc., for last year
follow:
Joel de Paris, Inc.
Balance...
asked 10 months ago -
Consider this reaction:
Al2(SO4)3 (aq)+ BaCl3
(aq) Al2Cl6 (aq)- +
3BaSO4(s) . What is the...
asked 10 months ago -
Suppose that Savneet is considering increasing her
recent random sample from 20 car rentals to 40...
asked 10 months ago -
Trucks arrive at an unloading terminal at an average rate of 120
per hour.
Trucks arrive...
asked 10 months ago -
Why are methanol and ethanol completely soluble in water while
octanol is not very little soluble....
asked 10 months ago -
A facilities manager at a university reads in a research report
that the mean amount of...
asked 10 months ago -
When the CuSO4 is rehydrated by adding water to the anhydrous
compound, is this an endothermic...
asked 10 months ago -
A ray of sunlight is passing from diamond into crown glass; the
angle of incidence is...
asked 10 months ago -
A block of mass 0.249 kg is placed on top of a light, vertical
spring of...
asked 10 months ago -
how do the kidneys compensate in the presences of acidosis
a) trigger hyperventilate
b) reserve acid...
asked 10 months ago -
Question 501 pts
The rental rate of capital to the firm increases. Which of the
following...
asked 10 months ago