
Under each of the following molecules, write its classification its number of C and O Then...
At each of the following pairs of fatty acids or carboxylic acids, circle or that has highlight the acid that has higher melting point. Palmitic acid (C16:0 and Stearic acid Oliec acid and Stearic acid (C18:0) Oleic acid (C18:1) and Linolenic acid (C18:3) d) Linolenic acid (C18:2) and Linolenic acid (c18.3)
4. A list of fatty acids is given below. The number of carbons each contains, as well as the number of double bonds, are listed right after the name. Rank the fatty acids 1-5 from highest melting point to lowest melting point. 1 - highest melting point, 5 - lowest melting point. Palmitic acid (16 carbons, 0 double bonds) Oleic acid (18 carbons, 1 double bond) Linolenic acid (18 carbons, 3 double bonds) Lauric acid (12 carbons, 0 double bonds)...
Tor F 1. With the exception of steroids, all lipids contain at least one fatty acid. 2. Some lipids contain monosaccharides as part of their structure. 3. Some lipids contain an amino acid as part of their structure. 4. Glycerophospholipids contain a phosphate portion in their structure. 5. All lipids have a molecule of glycerin as their backbone. 6. Polyunsaturated fatty acids have more than one C-C double bond in their "backbone." 7. Fatty acids are soluble in water. 8....
What are the products when the following triglyceride undergoes saponification with NaOH? 11.1 CH20-C-(CH)12CH3 CHOC-(CH214CH3 CH20C (CH)CH CH(CH2)-CH 11.2 Write an equation for the full hydrogenation of a triglyceride containing glycerol, oleic acid, linoleic acid, and palmitic acid. How many moles of H2 are required to completely hydrogenate one mole of this triglyceride? 11.3 A drug called RU486 has the following structure: CH3 CH CH3 он CEC-CH3 RU486 a. How is the structure of RU486 similar to that of progesterone?...
Question 14 4 pts For the following fatty acid molecules, which of the following is correct? Oleic acid CH-(CH2)-CH=CH(CH2),COOH Lauric acid CHECH COOH Arachidonic acid CH3(CH2).CH=CHCH2CH=CHCH2CH=CHCH2CH=CH(CH3),COOH Stearic acid CH-(CH2)76COOH Linoleic acid CH(CH2).CH=CHCH2CH=CH(CH2),COOH Oleic acid is a polyunsaturated fatty acid and lauric acid is a saturated fatty acid. O Both oleic acid and arachidonic acid are polyunsaturated fatty acids. Lauric acid is a saturated fatty acid and arachidonic acid is a polyunsaturated fatty acid. O Both lauric acid and stearic acid...
14.Sucrose is composed of A. 1 molecule each of glucose and fructose. B. 1 molecule each of glucose and galactose. C. 2 glucose molecules. D. 2 galactose molecules. 15.Which hormone comes into play when the blood sugar dips too low? A. glucagon B. insulin C. gastrin D. estrogen 16.Which sweetener provides no calories to humans? A. sucrose B. sucralose (Splenda) C. xylitol D. fructose 17.______ and ______ acids are essential fatty acids. A. Acetic and butyric B. Oleic and linolenic...
b) Water "softeners" work via the principle of ion-exchange. The tank ork via the principle of ion-exchange. The tank of a water softener is filled with a soluble salt such as sodium chloride. As "hard" water passes through the tank, the . AS "hard" water passes through the tank, the undesirable ions in hard water (e.g., calcium, magnesium, and iron IIT) are exchanged for the more desirable "soft" (m 1) are exchanged for the more desirable "soft" (meaning more soluble)...
General Module 1. Identify the fumily of each of the following compounds b) CH, CH,O CH, CH, CH, 2. Write siructural formulas for the following compounds: s a) 3-chloro-2-methylheptanal @ d) 3-methyl-4-hexene-2-ol II-H cz 3. Which of the following are nonsaponifiable lipids? i) waxes j) leukotrienes k) plasmalogens a) triacylglycerols b) oils c) sphingomyelins d) steroids c) terpenes f)" sphyngolipids g) glycolipids h) prostoglandins 4. Write the equation showing triacylglycerol from glycerol and oleic, palmitic and stearic acids 5. Point...
Help me please??
16. Which of the following types of compounds are expected products from the saponification of an oil? a. glycerol and fatty acids b. glycerol and fatty acid salts c. fatty acid salts and fatty acids d. fatty acids and glycine 17. Prostaglandins and thromboxanes are classes of eicosanoids. a. TRUE b. FALSE In general, lipids are substances that are only sparingly soluble in water a. TRUE b. FALSE 18. 19. In activ e transport, a substance crosses...
A8. Which of the following describes carbohydrates? (a) a base, a sugar, and a phosphate b) aldchydes and ketones with two or more hydroxyl groups. c) acids with two or more hydroxyl groups. d) amines with two or more hydroxyl groups. e) always contain a phosphate group. A9. Which of the following is NOT correct regarding reducing sugars? a) Sugars that react with oxidizing agents are called reducing sugars. b) The cyclic form of a monosaccharide reacts with oxidizing agents....