Determine which of the following is Oxidized and which is reduced. Include the charges as the...
Determine which of the following is Oxidized and which is reduced. Include the charges as the substance changes from the reactants side of the reaction to the products side of the reaction.
1). P4(s)+5O2(g)=P4O10(s)
2) P4O10(s)+6H2O(l)=4H3PO4(aq)
Homework Answers
increase oxidation number is called oxidation and decrease oxidation number is called reduction
Add Answer to:
Determine which of the following is Oxidized and which is
reduced. Include the charges as the...
5&6 5) Identify the oxidizing agent, reducing agent, substance oxidized, and substance reduced. a) Consider the...
5&6
5) Identify the oxidizing agent, reducing agent, substance oxidized, and substance reduced. a) Consider the reaction Fe(NO3)3(aq) + H2S(aq) → FeS(s) + HNO3(aq) + S(s). b) Consider the reaction CuO(s) + H2(g) → Cu(s) + H2O(l). 6) Consider the reaction C(g) + O2(g) + CO2(g). (a) Determine the oxidation states of carbon and oxygen in CO2. (Drawing a Lewis struc- tures may help here.) (b) What are the oxidation states of the reactants carbon and oxygen? (c) Which substance...
When a substance is oxidized, it electrons and its oxidation number When a substance is reduced,...
When a substance is oxidized, it electrons and its oxidation number When a substance is reduced, it electrons and its oxidation number Determine the oxidation number of each clement in: HCIO_4 C-2O_4^2- In each of the following redox reactions, determine which element is oxidized and which is reduced. Cl_2 (aq) + 2 I (aq) rightarrow I_2 (aq) + 2 Cl' (aq) Fe_2O_3 (s) + 3 CO (g)rightarrow 2 Fe (s) + 3 CO_2 (g) Write balanced molecular and net ionic...
3. In the following reactions, identify which of the elements are oxidized and which are reduced...
3. In the following reactions, identify which of the elements are oxidized and which are reduced and enter the name of the element on the line. (3 points for each equation, 9 points total) a. 2Ca(s) + O2(g) - Cal is oxidized is reduced b. MnO2 (aq) + 4 HBr(aq) -Bra(l) + MnBr2 (aq) + 2 H2O(0) is oxidized is reduced C. Cl2(g) +2 NaBr(ag) 2NaCl(aq) + Br2 () (Here Cl is chlorine) is oxidized is reduced
5) Determine which element is oxidized and which element is reduced in the following redox reactions....
5) Determine which element is oxidized and which element is reduced in the following redox reactions. (4) Fe2O3 + CO ® Fe + CO2 Element oxidized ____________________ Element reduced _________________ Cr2O72- + H2C2O4 ® Cr3+ + CO2 Element oxidized ____________________ Element reduced ___________________ 6) Determine the balanced molecular, ionic and net ionic equations for the following single displacement (replacement) reaction. (9) (ME) Al(s) + HCl(aq) ® (IE) (NIE)
ach chemical reaction listed in the table below decide whether the highlighted atom is being oxidized...
ach chemical reaction listed in the table below decide whether the highlighted atom is being oxidized highlighted atom is being... reaction neither oxidized reduced oxidized nor reduced 2H20 (g) CH4(g)+H2O(g) CO(g) +3 H2(g) P4 (s) 502 (g) +6H2O() 4 H3PO4(aq)
a In the following reaction, identify which element is oxidized and which is reduced by assigning...
a In the following reaction, identify which element is oxidized and which is reduced by assigning oxidation numbers: Ba(s)S(s)BaS (s) barium is reduced; sulfur is reduced barium is reduced; sulfur is oxidized barium is oxidized; sulfur is oxidized barium is oxidized; sulfur is reduced Submit b In the following reaction, identify which element is oxidized and which is reduced by assigning oxidation number 2Sr(s)02(g)> 2SrO(s) strontium is reduced; oxygen is reduced strontium is oxidized; oxygen is reduced strontium is oxidized;...
Identify which substance is reduced and which is oxidized in each of the following reactions. (aq)3 Mg? (aq) + 2 Au...
Identify which substance is reduced and which is oxidized in each of the following reactions. (aq)3 Mg? (aq) + 2 Au (s) 2. 3 Mg (s)+ 2 Au a. 2 Na (s)+ 2 H2O (I)->2 NaOH (aq) + H2 (g) b.
1. Provide the oxidation number for each of the underlined elements in following compounds or ions:...
1. Provide the oxidation number for each of the underlined elements in following compounds or ions: (6) a) H3AsO3 b) d) H4P207 C202² KCIO4 N2H4 2. Which one of the following is not a oxidation-reduction reaction? (2) A) 2H2(g) + O2(g) → 2H2O(1) B) Zn(s) + H2SO4(aq) → ZnSO4(aq) + H2(g) C) H2O(l) + NH3(g) → NH(aq) + OH(aq) D) FeSO4(aq) + K2Cr2OH(aq) + 7H2SO4(aq) → Cr2(SO4)3(aq) + 3Fe2(SO4)3(aq) + K2SO4(aq) + 7H2O(1) E) Cl2(g) +2KBr(aq) + Bra(l) + 2KCl(aq)...
In the following equation H3O+ is being oxidized or reduced. 2 H3O+ + 2 e- -> H2+ 2 H2O reduced oxidized Flag this Question Question 19 4 pts The reason redox reactions occur is the atmosphere is 2...
In the following equation H3O+
is being oxidized or reduced. 2 H3O+ + 2 e- -> H2+ 2 H2O reduced
oxidized Flag this Question Question 19 4 pts The reason redox
reactions occur is the atmosphere is 21% oxygen. the sum of the
bond energies of the reactants is greater than the sum of the bond
energies of the products. the substance being oxidized has a
greater affinity for substance being reduced. the substance being
reduced has a greater affinity...
Express the equilibrium constant for the following reaction. P4(s) + 5O2(g) ⇌ P4O10(aq) K =___ A....
Express the equilibrium constant for the following reaction. P4(s) + 5O2(g) ⇌ P4O10(aq) K =___ A. A) = [P4O10] / [P4] B. B) = [P4O10] / [P4][O2]5 C. C) = [P4O10] / [O2]5 D. D) [O2]-5 E. E) none of these
5&6
5) Identify the oxidizing agent, reducing agent, substance oxidized, and substance reduced. a) Consider the reaction Fe(NO3)3(aq) + H2S(aq) → FeS(s) + HNO3(aq) + S(s). b) Consider the reaction CuO(s) + H2(g) → Cu(s) + H2O(l). 6) Consider the reaction C(g) + O2(g) + CO2(g). (a) Determine the oxidation states of carbon and oxygen in CO2. (Drawing a Lewis struc- tures may help here.) (b) What are the oxidation states of the reactants carbon and oxygen? (c) Which substance...
When a substance is oxidized, it electrons and its oxidation number When a substance is reduced, it electrons and its oxidation number Determine the oxidation number of each clement in: HCIO_4 C-2O_4^2- In each of the following redox reactions, determine which element is oxidized and which is reduced. Cl_2 (aq) + 2 I (aq) rightarrow I_2 (aq) + 2 Cl' (aq) Fe_2O_3 (s) + 3 CO (g)rightarrow 2 Fe (s) + 3 CO_2 (g) Write balanced molecular and net ionic...
3. In the following reactions, identify which of the elements are oxidized and which are reduced and enter the name of the element on the line. (3 points for each equation, 9 points total) a. 2Ca(s) + O2(g) - Cal is oxidized is reduced b. MnO2 (aq) + 4 HBr(aq) -Bra(l) + MnBr2 (aq) + 2 H2O(0) is oxidized is reduced C. Cl2(g) +2 NaBr(ag) 2NaCl(aq) + Br2 () (Here Cl is chlorine) is oxidized is reduced
ach chemical reaction listed in the table below decide whether the highlighted atom is being oxidized highlighted atom is being... reaction neither oxidized reduced oxidized nor reduced 2H20 (g) CH4(g)+H2O(g) CO(g) +3 H2(g) P4 (s) 502 (g) +6H2O() 4 H3PO4(aq)
a In the following reaction, identify which element is oxidized and which is reduced by assigning oxidation numbers: Ba(s)S(s)BaS (s) barium is reduced; sulfur is reduced barium is reduced; sulfur is oxidized barium is oxidized; sulfur is oxidized barium is oxidized; sulfur is reduced Submit b In the following reaction, identify which element is oxidized and which is reduced by assigning oxidation number 2Sr(s)02(g)> 2SrO(s) strontium is reduced; oxygen is reduced strontium is oxidized; oxygen is reduced strontium is oxidized;...
Identify which substance is reduced and which is oxidized in each of the following reactions. (aq)3 Mg? (aq) + 2 Au (s) 2. 3 Mg (s)+ 2 Au a. 2 Na (s)+ 2 H2O (I)->2 NaOH (aq) + H2 (g) b.
1. Provide the oxidation number for each of the underlined elements in following compounds or ions: (6) a) H3AsO3 b) d) H4P207 C202² KCIO4 N2H4 2. Which one of the following is not a oxidation-reduction reaction? (2) A) 2H2(g) + O2(g) → 2H2O(1) B) Zn(s) + H2SO4(aq) → ZnSO4(aq) + H2(g) C) H2O(l) + NH3(g) → NH(aq) + OH(aq) D) FeSO4(aq) + K2Cr2OH(aq) + 7H2SO4(aq) → Cr2(SO4)3(aq) + 3Fe2(SO4)3(aq) + K2SO4(aq) + 7H2O(1) E) Cl2(g) +2KBr(aq) + Bra(l) + 2KCl(aq)...
In the following equation H3O+
is being oxidized or reduced. 2 H3O+ + 2 e- -> H2+ 2 H2O reduced
oxidized Flag this Question Question 19 4 pts The reason redox
reactions occur is the atmosphere is 21% oxygen. the sum of the
bond energies of the reactants is greater than the sum of the bond
energies of the products. the substance being oxidized has a
greater affinity for substance being reduced. the substance being
reduced has a greater affinity...
Most questions answered within 3 hours.
-
Where is the error in this code sequence?
String s1 = "Hello";
String s2 = "ello";...
asked 11 months ago -
Financial data for Joel de Paris, Inc., for last year
follow:
Joel de Paris, Inc.
Balance...
asked 11 months ago -
Consider this reaction:
Al2(SO4)3 (aq)+ BaCl3
(aq) Al2Cl6 (aq)- +
3BaSO4(s) . What is the...
asked 11 months ago -
Suppose that Savneet is considering increasing her
recent random sample from 20 car rentals to 40...
asked 11 months ago -
Trucks arrive at an unloading terminal at an average rate of 120
per hour.
Trucks arrive...
asked 11 months ago -
Why are methanol and ethanol completely soluble in water while
octanol is not very little soluble....
asked 11 months ago -
A facilities manager at a university reads in a research report
that the mean amount of...
asked 11 months ago -
When the CuSO4 is rehydrated by adding water to the anhydrous
compound, is this an endothermic...
asked 11 months ago -
A ray of sunlight is passing from diamond into crown glass; the
angle of incidence is...
asked 11 months ago -
A block of mass 0.249 kg is placed on top of a light, vertical
spring of...
asked 11 months ago -
how do the kidneys compensate in the presences of acidosis
a) trigger hyperventilate
b) reserve acid...
asked 11 months ago -
Question 501 pts
The rental rate of capital to the firm increases. Which of the
following...
asked 11 months ago