Spermine (structure shown) is a compound isolated from sperm. Which of the following statements correctly describes...
Spermine (structure shown) is a compound isolated from sperm.
Which of the following statements correctly describes an aqueous
solution of spermine?
NH2(CH2)3NH(CH2)4NH(CH2)3NH2
Question 2 options:
|
|||
|
|||
|
|||
|
Homework Answers
ANSWER- OPTION A, The hydroxide ion concentration in the solution would be greater than that in pure water.
Solution-
Spermine is basic in nature as it contains di-amine group (NH2), which is basic in nature i.e. it easily gives off electrons.
Thus being basic spermine solution will have more concentration of Hydroxide ion [OH-].
PLEASE RATE :-)
Add Answer to:
Spermine (structure shown) is a compound isolated from sperm.
Which of the following statements correctly describes...
please answer quickly Which of the following statements correctly describes the hydronium-hydroxide balance in the given...
please answer quickly
Which of the following statements correctly describes the hydronium-hydroxide balance in the given solution? In acids, [OH-] is less than [ H30+). In acids, [OH-] = [H3O+]. In neutral solutions, [H3O+] = [H20). In bases, [H3O+] is more than [H20] In acids, [OH-] is greater than [H3O+]. O
9. Consider a 0.15 M solution of H2SO4. Which of the following statements is NOT true?...
9. Consider a 0.15 M solution of H2SO4. Which of the following statements is NOT true? A) This solution would turn litmus to red. B) This solution could neutralize a base. C) This solution has a pH of 11.20. D) This solution could dissolve metal. E) none of the above 10. What is the concentration of the hydronium [Halo ons in a neutral solution? 11. What is the concentration of hydronium ions in an acidic solution? A) 0.0 M B)...
5. In the following reaction CH, NH, +H,0— CH, NH; + OH CH,NH, + H2O ---→...
5. In the following reaction CH, NH, +H,0— CH, NH; + OH CH,NH, + H2O ---→ CH,NH,+ + OH- the compound CH,NH, behaves as: a) an acid b) a base c) a salt d) a conjugate acid 26. In an acidic solution the a) concentration of hydronium ion is greater than that of hydroxide ion. b) concentration of hydroxide ion greater than that of hydronium ion. C) concentration of hydronium ion and hydroxide ion are equal 27. In which of...
1. Which pH value indicates the higher concentration of OH–? Question 5 options: A) pH =...
1. Which pH value indicates the higher concentration of OH–? Question 5 options: A) pH = 8.8 B) pH = 10.2 C) pH = 3.7 D) pH = 11.4 E) pH = 6. 2. A sample of water from the Chesapeake Bay has [H3O+]=3.1 × 10–9 M. Which statement below accurately describes this water sample? Question 8 options: A) The water sample is a basic solution. B) The water sample doesn't contain any hydroxide ions. C) The water sample has...
D Question 23 4 pts When a 0.100 mol of a pure compound is dissolved in...
D Question 23 4 pts When a 0.100 mol of a pure compound is dissolved in 1.0 L of water, the solution pH changes from 7.00 to 4.24. Which of the following is most likely the identity of the substance? A weak base A neutral salt A weak acid A strong base A strong acid Question 24 4 pts If the hydronium ion concentration, [H30*), in a solution is 5.6x10-10 M, what is the hydroxide ion concentration, [OH"), and the...
Help Save & Exit Sub Assessment A sample of water from the Chesapeake Bay has [H307-31...
Help Save & Exit Sub Assessment A sample of water from the Chesapeake Bay has [H307-31 x 109 M. Which statement below accurately describes this water sample? Multiple Choice The water sample is a basic solution oo The water sample doesn't contain any hydroxide ions. The water sample has a higher concentration of hydronium ions than pure water does O o O The pH of the water sample is 75 < Prev 16 of 41 HI N est > A...
Which of the following statements describes a basic solution? 1. [H30+]> [OH] 2. [H30]<[OH] 3. [H30']...
Which of the following statements describes a basic solution? 1. [H30+]> [OH] 2. [H30]<[OH] 3. [H30'] x [OH] #1 x 10-14 4. [H3O+]/[OH] = 1 x 10-14 5. [H3O+]/[OH]=1 If the pH of a solution is 10, what is the hydronium, H ion concentration? 1. A) 1 x 10-10 M 2. B) 1 x 1010 M 3. C) 10 M 4. D) 10 M 5.E) * 1 1010 M As the pH increases the hydroxide ion concentration 1. A) goes...
A) H20 c) нсоз- E) H2CO3 DOH. 22) Which of the following statements correctly describes the...
A) H20 c) нсоз- E) H2CO3 DOH. 22) Which of the following statements correctly describes the hydronium-hydroxide balance in the given solution? A) In acids, [OH-] is greater than [H3O* B) In bases, [OH-]- [H3o*]. C) In neutral solutions, [H3O"] = [H20]. D) In bases, [OH-] is greater than [H3o*]. E) In bases, [OH-] is less than [H30*]. 23) Which of the following is a buffer system? A) NaCl(aq) and NaNO3(aq) C) H2CO3(aq) and KHCO3 (aq) E) H20(0) and HCl(aq)...
5. Which of the following species is amphiprotic in aqueous solution? (a) CH3NH2 c) NH4 (e)...
5. Which of the following species is amphiprotic in aqueous solution? (a) CH3NH2 c) NH4 (e) HSO (d) F (b) Н:0" 6, Use Table 15.2 (page 529) to decide whether the species on the left or those on the right are favored by the reaction. a. NH4 (aq) + H2PO4" (aq) # NH3(aq) + HsPO b. HCN (aq) + HS(aq) CN" (aq) +H2S c. HCO +OH CO2 H2S d. Al(H20)6 3+ +OH = Al(H20) s2+ OH 7. The equilibrium constant...
i want answer to all questions please Answer: 29) Consider the following generalized buffer solution equilibrium: When a small amount of a strong base such as sodium hydroxide is added to the so...
i want answer to all questions please
Answer: 29) Consider the following generalized buffer solution equilibrium: When a small amount of a strong base such as sodium hydroxide is added to the solution, which of the four species shown would experience an increase in concentration? A) BH B)H C) HO D)B E None of the species would increase in concentration. Answer: ( 30) What is true about a solution whose pH is less than 7 at 25°C? A) It has...
please answer quickly
Which of the following statements correctly describes the hydronium-hydroxide balance in the given solution? In acids, [OH-] is less than [ H30+). In acids, [OH-] = [H3O+]. In neutral solutions, [H3O+] = [H20). In bases, [H3O+] is more than [H20] In acids, [OH-] is greater than [H3O+]. O
9. Consider a 0.15 M solution of H2SO4. Which of the following statements is NOT true? A) This solution would turn litmus to red. B) This solution could neutralize a base. C) This solution has a pH of 11.20. D) This solution could dissolve metal. E) none of the above 10. What is the concentration of the hydronium [Halo ons in a neutral solution? 11. What is the concentration of hydronium ions in an acidic solution? A) 0.0 M B)...
5. In the following reaction CH, NH, +H,0— CH, NH; + OH CH,NH, + H2O ---→ CH,NH,+ + OH- the compound CH,NH, behaves as: a) an acid b) a base c) a salt d) a conjugate acid 26. In an acidic solution the a) concentration of hydronium ion is greater than that of hydroxide ion. b) concentration of hydroxide ion greater than that of hydronium ion. C) concentration of hydronium ion and hydroxide ion are equal 27. In which of...
D Question 23 4 pts When a 0.100 mol of a pure compound is dissolved in 1.0 L of water, the solution pH changes from 7.00 to 4.24. Which of the following is most likely the identity of the substance? A weak base A neutral salt A weak acid A strong base A strong acid Question 24 4 pts If the hydronium ion concentration, [H30*), in a solution is 5.6x10-10 M, what is the hydroxide ion concentration, [OH"), and the...
Help Save & Exit Sub Assessment A sample of water from the Chesapeake Bay has [H307-31 x 109 M. Which statement below accurately describes this water sample? Multiple Choice The water sample is a basic solution oo The water sample doesn't contain any hydroxide ions. The water sample has a higher concentration of hydronium ions than pure water does O o O The pH of the water sample is 75 < Prev 16 of 41 HI N est > A...
Which of the following statements describes a basic solution? 1. [H30+]> [OH] 2. [H30]<[OH] 3. [H30'] x [OH] #1 x 10-14 4. [H3O+]/[OH] = 1 x 10-14 5. [H3O+]/[OH]=1 If the pH of a solution is 10, what is the hydronium, H ion concentration? 1. A) 1 x 10-10 M 2. B) 1 x 1010 M 3. C) 10 M 4. D) 10 M 5.E) * 1 1010 M As the pH increases the hydroxide ion concentration 1. A) goes...
A) H20 c) нсоз- E) H2CO3 DOH. 22) Which of the following statements correctly describes the hydronium-hydroxide balance in the given solution? A) In acids, [OH-] is greater than [H3O* B) In bases, [OH-]- [H3o*]. C) In neutral solutions, [H3O"] = [H20]. D) In bases, [OH-] is greater than [H3o*]. E) In bases, [OH-] is less than [H30*]. 23) Which of the following is a buffer system? A) NaCl(aq) and NaNO3(aq) C) H2CO3(aq) and KHCO3 (aq) E) H20(0) and HCl(aq)...
5. Which of the following species is amphiprotic in aqueous solution? (a) CH3NH2 c) NH4 (e) HSO (d) F (b) Н:0" 6, Use Table 15.2 (page 529) to decide whether the species on the left or those on the right are favored by the reaction. a. NH4 (aq) + H2PO4" (aq) # NH3(aq) + HsPO b. HCN (aq) + HS(aq) CN" (aq) +H2S c. HCO +OH CO2 H2S d. Al(H20)6 3+ +OH = Al(H20) s2+ OH 7. The equilibrium constant...
i want answer to all questions please
Answer: 29) Consider the following generalized buffer solution equilibrium: When a small amount of a strong base such as sodium hydroxide is added to the solution, which of the four species shown would experience an increase in concentration? A) BH B)H C) HO D)B E None of the species would increase in concentration. Answer: ( 30) What is true about a solution whose pH is less than 7 at 25°C? A) It has...
Most questions answered within 3 hours.
-
Where is the error in this code sequence?
String s1 = "Hello";
String s2 = "ello";...
asked 10 months ago -
Financial data for Joel de Paris, Inc., for last year
follow:
Joel de Paris, Inc.
Balance...
asked 10 months ago -
Consider this reaction:
Al2(SO4)3 (aq)+ BaCl3
(aq) Al2Cl6 (aq)- +
3BaSO4(s) . What is the...
asked 10 months ago -
Suppose that Savneet is considering increasing her
recent random sample from 20 car rentals to 40...
asked 10 months ago -
Trucks arrive at an unloading terminal at an average rate of 120
per hour.
Trucks arrive...
asked 10 months ago -
Why are methanol and ethanol completely soluble in water while
octanol is not very little soluble....
asked 10 months ago -
A facilities manager at a university reads in a research report
that the mean amount of...
asked 10 months ago -
When the CuSO4 is rehydrated by adding water to the anhydrous
compound, is this an endothermic...
asked 10 months ago -
A ray of sunlight is passing from diamond into crown glass; the
angle of incidence is...
asked 10 months ago -
A block of mass 0.249 kg is placed on top of a light, vertical
spring of...
asked 10 months ago -
how do the kidneys compensate in the presences of acidosis
a) trigger hyperventilate
b) reserve acid...
asked 10 months ago -
Question 501 pts
The rental rate of capital to the firm increases. Which of the
following...
asked 10 months ago