What is the product of the reaction of glyceryl trioleate with LiAlO4 then H3O+?

Question

Question

science chemistry

Answer 1

Answer #1

LiAlH4 is a strong reducing agent and reduces the ester into alcohols. And won't affect the double bond.

Answer 2

Similar Homework Help Questions

Olive Oil is almost pure glyceryl trioleate, C57H104O6. The equation for the combustion of glyceryl trioleate...

Olive Oil is almost pure glyceryl trioleate, C57H104O6. The equation for the combustion of glyceryl trioleate is: C57H104O6 + 80 O2 -> 57 CO2 + 52 H20. What is the change in the internal energy, delta E, in kJ for the combustion of 1 mol glyceryl trioleate? ANS: -1.93*10^3 kJ/mol glycerol trioleate I was provided the answer, but I don't know how to solve. Please show your work so I can understand. Previous question before this was: 1.000 g olive...
Draw the condensed structural formula for the products obtained from the NaOH saponification of glyceryl trioleate...

Draw the condensed structural formula for the products obtained from the NaOH saponification of glyceryl trioleate (triolein).
Part A The product of this reaction is CH2-0-C-(CH2)7-CH=CH-(CH2)2-CHz Ni, CH-0C-(CH3)3-CH=CH-(CHỊ)-CH, + 3H, 10 CH...

Part A The product of this reaction is CH2-0-C-(CH2)7-CH=CH-(CH2)2-CHz Ni, CH-0C-(CH3)3-CH=CH-(CHỊ)-CH, + 3H, 10 CH2-0-C-(CH2)-CH=CH-(CH2)-CH glyceryl trioleate. e glyceryl tristearate. glyceryl tripalmitate glyceryl tricaprate. Submit Request Answer Provide Feedback

Identify the expected major product of the following reaction. H3O* What is the mejor product of...

Identify the expected major product of the following reaction. H3O* What is the mejor product of the reaction below? HCI Cl CI + enantiomer + enantiomer enantiomer hat is the expected major product for the following reaction? ROOR
What is the correct product for the reaction of 1-methylcyclohexene with KMnO4, H3O+?

What is the correct product for the reaction of 1-methylcyclohexene with KMnO4, H3O+?
the reaction of glyceryl tristearate with water in the presence of of a lipase enzyme?

the reaction of glyceryl tristearate with water in the presence of of a lipase enzyme?

draw the product of the following reaction of this compound H3O+ and toluene

draw the product of the following reaction of this compound H3O+ and toluene Draw the product of the following reaction. Draw the product of the following reaction.
What will be the major organic product of this reaction? 1) KMnO4, OH, heat 2) H3O+...

What will be the major organic product of this reaction? 1) KMnO4, OH, heat 2) H3O+ COOH COOH COOH COOH COOH COOH соон COOH CHO SCHO CHO CHO No reaction CHO
What does H3O+ do in this reaction? Thanks! Write the major product formed in the following reaction. 1. NaOEIEIOH O...

What does H3O+ do in this reaction? Thanks! Write the major product formed in the following reaction. 1. NaOEIEIOH OE: -CHE 3.H,00 4. host

Draw the condensed structural formula for the product obtained from the hydrogenation of glyceryl tripalmitoleate.

Draw the condensed structural formula for the product obtained from the hydrogenation of glyceryl tripalmitoleate.