2. What four different groups are attached to the C in 3-methylhexane? H CH3CH2---C---CH2CH2CH3 CH3 CH,CH2--C--C...

Question

Question

2. What four different groups are attached to the C in 3-methylhexane? H CH3CH2---C---CH2CH2CH3 CH3

CH,CH2--C--CH2CH2CH3 CH3 3. Relating to the figure in question 2, which Carbon atom is the stereogenic carbon atom? a. Carbon

science chemistry

Add a comment Improve this question Transcribed image text

Answer 1

Answer #1

H H3C- H2 C- —C— H2H2 C —C—CH3 СН3 3-methylhexane Groups are H Methyl Ethyl n-propyl Stereogenic carbon is C-3

Add a comment

Answer 2

Similar Homework Help Questions

Which of the following is a tertiary alcohol? CH3CH2-CH-CH2CH2CH3 CH2CH2CH2OH CH3CH2-CH-CH3 OH CH2CH2CH3 CH3 CH2-C-CH2CH3 OH...

Which of the following is a tertiary alcohol? CH3CH2-CH-CH2CH2CH3 CH2CH2CH2OH CH3CH2-CH-CH3 OH CH2CH2CH3 CH3 CH2-C-CH2CH3 OH LOH CH2CH3 Reset Selection Type here to search
1) Which of the following is a secondary alcohol? A) CH3CH2-CH-CH2CH2CH3 CH2CH2CH2OH он - CH₂ CH3...

1) Which of the following is a secondary alcohol? A) CH3CH2-CH-CH2CH2CH3 CH2CH2CH2OH он - CH₂ CH3 CH2-CH-CH3 он CH2CH3 CH2CH2CH3 CH3CH2-C-CH2CH3 OH 2) The substance that precipitates in a positive Benedict test is: A) Cuo B) Cu2o C) Ag D) none of these 3) Galactose is called a(n): A) ketohexose B) aldopentose C) aldohexose D) ketopentose 4) Identify all the disaccharides from the following list: i) Lactose ii) Glucose iii) Ribose iv) Maltose A) iii B) iii + iv C)i...
QUESTION 18 Consider the reaction below OH + CH3CH2-C-H CH3CH2-C-H CH3CH2-CH-CH-C-H 48H CHCH CH3 What form...

QUESTION 18 Consider the reaction below OH + CH3CH2-C-H CH3CH2-C-H CH3CH2-CH-CH-C-H 48H CHCH CH3 What form is used to describe the reaction indicated above? TTTT Paragraph Arial 3 (121) TTBUS E.T- Words

Write the correct name for each compound below. H3C-CH3: H3C-CH2-CH2-CH2-CH2-CH2-CH2-CH=CH2: H-C≡C-H: H-C-(CH3)3: H3C-CH=CH-CH3:

Write the correct name for each compound below. H3C-CH3: H3C-CH2-CH2-CH2-CH2-CH2-CH2-CH=CH2: H-C≡C-H: H-C-(CH3)3: H3C-CH=CH-CH3:
Practice: Give IUPAC names for the following compounds. a. (CH3)3CCH2CH(CH2CH3)2 C. CH3(CH2)2CH(CH2CH2CH3)CH(CH3)2

Practice: Give IUPAC names for the following compounds. a. (CH3)3CCH2CH(CH2CH3)2 C. CH3(CH2)2CH(CH2CH2CH3)CH(CH3)2
What is the name of this molecule? CH3 7 CH3 - CH2 - CH - CH2...

What is the name of this molecule? CH3 7 CH3 - CH2 - CH - CH2 - CH3 methylpentane methylhexane O 3-methylpentane O 3-ethylpentane 3,3-dimethylhexane QUESTION 4 What is the name of the functional group on this molecule? CH3 -C=0 / CH3 O alcohol O ether aldehyde O ketone O carboxylic acid O amine

21. Consider the following: CHj CH2 CH-CHCH2 CH CH CH2 CH2 CH2 CH-CH2 CH3 CH-CHCH2 CH2...

21. Consider the following: CHj CH2 CH-CHCH2 CH CH CH2 CH2 CH2 CH-CH2 CH3 CH-CHCH2 CH2 CH3 CH2-CHCH2 CH2 CH2 CH3 IV which two structures represent the same compound? a. I and II b. II and III c. I and III d. II and IV e. None of these 22. In which of these cases, does the central atom have a zero forma.l charge? a. HEH CH3 OCH3 C. F FBF d. H CH3 H CH3 CH CH3 CCH CH3...
26.) The general formula for a carbohydrate is: A) CnH2n+2 B) Cn(H20)n C) CnH2n D) Cn(H20)...

26.) The general formula for a carbohydrate is: A) CnH2n+2 B) Cn(H20)n C) CnH2n D) Cn(H20) 27.) Which of the following functional groups comprises a carbon atom bonded to a hydroxyl group? A) Alcohol B) Thiol C) Carbonyl D) Ester 28.) A carbohydrate with 4 carbons is called a: A) hexose B) triose C) pentose D) tetrose 29.) A carbohydrate with 6 carbons and an aldehyde functional group is called a(n): A) ketohexose B) aldohexose C) ketopentose D) aldopentose A)...
-methylhexane C) heptane B) 3-methylhexane D) methylhexane 39. Denaturation of a protein A) changes the primary...

-methylhexane C) heptane B) 3-methylhexane D) methylhexane 39. Denaturation of a protein A) changes the primary structure of a protein. B) disrupts the secondary. tertiary or quaternary structure of a protein. C) is always irreversible. D) hydrolyzes peptide bonds. 40. The carbonyl group consists of A) a carbon-Oxygen-hydrogen structure. B) a carbon-Oxygen single bond. c) a carbon-Oxygen double bond. D) a carbon-oxygen triple bond. 41. The addition of hydrogen to an organic compound or the loss of oxygen is called...

Which of the following can exist in enantiomers? a. b. CH3 CH3-CH;-CH2-C-CH; CH3-CH2-CEC-CH, C. d. all...

Which of the following can exist in enantiomers? a. b. CH3 CH3-CH;-CH2-C-CH; CH3-CH2-CEC-CH, C. d. all of these choices CH3-CH-C-CHE -8-сон, CH,-8-3-CH, спесне: -он, 10. What type of compound is the second product in the reaction shown below? CH-0-2-CH, OCH & CHOCH, H,CH, +3 NaOH + CH-OH + CH-OH CH -0-C-(CH2)16CH, a, fatty acid salt b. ester CH-OH c. alcohol d. fatty acid

2. What four different groups are attached to the C in 3-methylhexane? H CH3CH2---C---CH2CH2CH3 CH3 CH,CH2--C--C...

Homework Answers

Add Answer to:
2. What four different groups are attached to the C in 3-methylhexane? H CH3CH2---C---CH2CH2CH3 CH3 CH,CH2--C--C...

Post as a guest

Earn Coins

Which of the following is a tertiary alcohol? CH3CH2-CH-CH2CH2CH3 CH2CH2CH2OH CH3CH2-CH-CH3 OH CH2CH2CH3 CH3 CH2-C-CH2CH3 OH...

1) Which of the following is a secondary alcohol? A) CH3CH2-CH-CH2CH2CH3 CH2CH2CH2OH он - CH₂ CH3...

QUESTION 18 Consider the reaction below OH + CH3CH2-C-H CH3CH2-C-H CH3CH2-CH-CH-C-H 48H CHCH CH3 What form...

Write the correct name for each compound below. H3C-CH3: H3C-CH2-CH2-CH2-CH2-CH2-CH2-CH=CH2: H-C≡C-H: H-C-(CH3)3: H3C-CH=CH-CH3:

Practice: Give IUPAC names for the following compounds. a. (CH3)3CCH2CH(CH2CH3)2 C. CH3(CH2)2CH(CH2CH2CH3)CH(CH3)2

What is the name of this molecule? CH3 7 CH3 - CH2 - CH - CH2...

21. Consider the following: CHj CH2 CH-CHCH2 CH CH CH2 CH2 CH2 CH-CH2 CH3 CH-CHCH2 CH2...

26.) The general formula for a carbohydrate is: A) CnH2n+2 B) Cn(H20)n C) CnH2n D) Cn(H20)...

-methylhexane C) heptane B) 3-methylhexane D) methylhexane 39. Denaturation of a protein A) changes the primary...

Which of the following can exist in enantiomers? a. b. CH3 CH3-CH;-CH2-C-CH; CH3-CH2-CEC-CH, C. d. all...

2. What four different groups are attached to the C in 3-methylhexane? H CH3CH2---C---CH2CH2CH3 CH3 CH,CH2--C--C...

Homework Answers

Add Answer to: 2. What four different groups are attached to the C in 3-methylhexane? H CH3CH2---C---CH2CH2CH3 CH3 CH,CH2--C--C...

Post as a guest

Earn Coins

Add Answer to:
2. What four different groups are attached to the C in 3-methylhexane? H CH3CH2---C---CH2CH2CH3 CH3 CH,CH2--C--C...