


3. Use the lipid drawn to complete the reactions below. Use as much of the nonorganic reactants (water, acid/bas...
Question 3 5 pts Identify the class of lipid to which the following molecule belongs. CH2-0-C-(CH)6- (CH2-CH=CH2-CH2) -CH, CH-0-C-(CH2),CH=CH-(CH2)7 – CH3 CH2 –0-C-(CH), –(CH2 -CH=CH), –CH2 –CH; phospholipid fatty acid wax triglyceride Identify the class of lipid to which the following molecule belongs.. CH2 -0-C-(CH2) 16CH; CH-0-C-(CH)-CH=CH(CH2)-CH, O = CH,-o-P-0-(CH)-N(CH) triglyceride fatty acid wax phospholipid We were unable to transcribe this imageQuestion 13 5 pts A saturated fatty acid is a fatty acid chain in which a carbon chain has...
4. Classify each of the following reactions as: Acid/ Base, Addition, Elimination, Reduction, Oxidation, Condensation, or Hydrolysis. (7 points each) a. CH3CH2OH [O] + CH3-CH (H2) [O] P → CH-E-OH (+0) (conc. Acid and heat) b. CH3-CH2-CH2-OH CH3-CH=CH2 + H2O (Pt cat) c. CH3-CH=CH2 + H2 → CH3CH2CH3
reactants are in second picture! circled
Label your assigned reactants in these acid-base reactions as Lewis acids (electrophiles) or Lewis bases (nucleophiles) 2. The following compound can become protonated on any of the three N atoms. However, one of the N is much more basic than the others. a. Draw the molecule with all three N protonated and then draw resonance structures for this protonated molecule. NH CH-NH-C NH b. For each resonance structure, give the formal charges on each...
____ 1. The diagram below represents serine, a polar, uncharged
amino acid. Which functional group gives serine its
distinct property?
a. H3
b. CH2OH
c. –H
d. COO–
____ 2. The monomers shown below are monomers for which of the
following natural polymers?
a. polysaccharides
b. plastics
c. DNA
d. proteins
____ 3. Which of the following processes illustrates the production
of a protein?
a. specific code for amino acids --> amino acid chain -->
gene --> DNA --> specific...
What is the correct name for the following compound? d) 5-oxo-3-octenoic acid What is the defining functional group of a carboxylic acid? a) an-H attached to a carbonyl group b) an-H attached to a carbon-carbon triple bond c) an-OH attached to a carbonyl group d) an -OH group attached to a O-C double bond e) an-OH group attached to an aromatic ring To convert a carboxylic acid to an aldehyde a) convert the acid to an acid chloride, then use...
Part A:
Part B:
Need help ASAP!!
2. For the reactions that were to be completed in Part A of the experiment, prepare a table with the formulas from Group A as headings of the columns and the formulas of Group B as headings of the ows. Within the table, fill in the formula and systematic name of the predicted precipitates that will form. If no precipitate is expected from the reaction, write 'No Reaction'. For each predicted precipitate, look...
A 0.704 g of a pure acid, HA, is dissolved in water and an acid- base indicator added. The solution requires 33.78 mL of 0.256 M NaOH solution to reach the end point. What is the molar mass of the acid? HA(aq) + NaOH(aq) → NaA(aq) + H2O(aq) 145 g/mol 81.4 g/mol 20.0 g/mol 199 g/mol Based on the equation below, which is correct? 2 C2H2(g) + 5 O2(g) → 4 CO2(g) + 2 H2O(g) C2H2(g) is reduced O2(g) is...
question 7 8 9 10 11 12
(7) Use HSAB theory to predict the following reactions will go or not go (a) CH3-CH3 + H2O → CH,OH+CH (AH = 12 kcal/mol) (b) CH3COCH3 + H2O → CH3COOH + CH, (AH--13 kcal/mol ) (6%) (8) Predict the order of solubility: (9%) (a) MgSO4, CaSO4, SISOs, and Baso. (c) AgF, AgCl, AgBr, and Ag! (b) PbCI, PbBry, and Pbi! (9) List the following acids in order of acid strength in aqueous solution:...
4. (4 points) Complete each of the acid base reactions below and determine which direction the reaction will favor. Use the Ka table below. a. NH" + CO2 b. HCN + H2PO4 → c. CH,COOH + HS → d. H2S + HCO » КА 7.5 x 10 Acid H3PO4 CH,COOH H.CO, HS 1.8 x 10% 4.3 x 107 9.1 x 10% 6.2 x 10* 6.2 x 10-10 5.6 x 10-0 H PO. HCN NH.
Can someone help with the 4 POST LAB questions thanks
Carboxylic Acids and Esters acid). like citric acid. Face crearboxyl the name implies, a Carbexylic Aclds A salad dressing made of The sour taste of fruits such as lemons is due to the presence of acids like citric acid. tcarboxyl a-hydroxy acids such functional group - that is, a carbonyl group attached to a hydroxyl group. AS dicarboxylic acid carboxylic acid of benzene is called benzoic acid (Figure 1). oil...