1-Each of the following metals reacts with nitric acid
to form the metal chloride and hydrogen gas. Complete and bal- ance
the reactions to show the formation of these products.
a. Zn (s) +HNO, (aq)->
b. Pb (s) +HNO3 (aq) -
c. Na (s) HNO3 (aq)- d. Al (s) HNO, (aq)-
2- Complete and balance these acid-base neutralization
reactions: a. CSOH (aq) HBr (aq)
b. HBr (aq) Fe(OH)2 (s)
c. H,PO4 (aq) +KOH (aq)-
3-In a titration experiment, two drops of phenolphthalein are added to 25.0 mL of aq. NaOH solution, causing it to turn bright pink. A solution of 3.05-M hydrochloric acid is added to the solution. It is found that 5.2 mL of the acid solution is required to turn the solution colorless. What is the concentration of the original base solution?
Please note a) that there formation of nitrates (instead of chloride, as mentioned in question) .
b) Most of the metals when react with nitric acid (dilute or concentrated) does not liberate hydrogen gas, because nitric acid is very strong oxidising agent and so it oxidises the H gas into H2O and other oxides of nitrogen are also formed. Mg is the metal that can give hydrogen gas only with very dilute nitric acid.
So lets answer these questions
1 a) Zn(s) + 4HNO3(aq) -----> Zn(NO3)2(aq) + 2NO2(g) + 2H2O
b) 3Pb(s) + 8 HNO3(aq) -----> 3 Pb(NO3)2(aq) + 2NO(g) + 4H2O
c) Na(s) + HNO3(aq) -----> NaNO3(aq) + NO(g) + N2O(g) + H2
d) Al(s) + 6HNO3 (aq) -----> Al(NO3)3(aq) + 3NO2(g) + 3H2O
2 a) CsOH(aq) + HBr(aq) -----> CsBr(aq) + H2O
b) Fe(OH)2(aq) + 2HBr(aq) -----> FeBr2(aq) + 2H2O
c) H3PO4(aq) + 3KOH(aq) -------> K3PO4(aq) + 3H2O
3) As the neautrallization reaction always occur by simple rule, one equivalent base reacts with one equivalent of acid, and in this case as the solution turns pink immediately, which indicates it to be basic, when it is neutralized by the acid then it turns colorless
for mono basic acids like HCl and monoacid bases like NaOH 1 equivalent = 1 mole
so, applying equation MbVb(base) = MaVa(acid)
MbX25.0 mL = 3.05X5.2 mL
Mb = 0.6344 M = 0.63 M (approx)
so, the initial concentration of the base was 0.63 M
1-Each of the following metals reacts with nitric acid to form the metal chloride and hydrogen gas. Complete and bal- an...
Analysis of Vinegar EXPERIMENT NAME SECTION DATE POSTLABORATORY ASSIGNMENT 1. A standard nitric acid solution is prepared using 0.425 g of sodium carbonate, NaCO3. Find the molarity of the acid if 33.25 mL are required to reach a permanent endpoint. 2 HNO, (aq) + Na2CO3(s) + 2 NaNO3(aq) + H2O(l) + CO2(g) 2 H OT 2. A 10.0-ml sample of household ammonia solution required 27.50 mL of 0.241 M HNO3 for neutralization. Calculate (a) the molar concentration of the ammonia...
need help with number 74
Complete and balance each of the following double- replacement reactions. la) AgC2HO2(aq) +Srl2(aq) b) AIBr3(ag) +Na,CO3 (aq) Neutralization Reactions (Sec. 7.11) Write a balanced equation for each of the following neutral- 75 ization reactions. (a) Lithium hydroxide solution is added to carbonic acid. (b) Calcium hydroxide solution is added to nitric acid. 76. Write a balanced equation for each of the following neutral- ization reactions. (a) Potassium hydroxide solution is added to phosphoric acid. (b)...
Question 1 (1 point) Reaction of chromium metal with phosphoric acid produces chromium(lI) phosphate and hydrogen gas. Select the correct balanced equation O2Cr(s)+2H3PO4laq)-- 2CrPO4(s)+6H(g) O2Cr(s)+2H3PO4laq)--2CrPO4(s)+3H2(g) O3Cr(s)+3H3PO4(aq)--Cr3(PO4]3(s)+3 H2{g) O2Cr(s)+2H3PO3(aq)--2CrPO3(s)+3H2(g) Question 2 (1 point) Methane gas (CH4) reacts with steam (H20 (g)) to produce hydrogen gas and carbon monoxide gas. Select the correct balanced equation. OCHalg) +H20(g) -- 6H(g)+CO(g) O2CH4(8)+H20(g)- 3H2(g)+2CO(g) OCH4(8) +H20(g) - 3H2(g)+CO(g) OCH4(8) +2H208)-- 4H2{g)+CO2{g) Question 3 (1 point) When the following equation is balanced using the smallest possible...
please answer
Titration Homework 1. Copper reacts with dilute nitric acid according to the equation 3 Cu(s) + 8 HNO, (aq) + 3 Cu(NO3)2 (aq) + 2NO(g) + 4H20 (1) If a copper penny weighs 3.020g is dissolved in a small amount of nitric acid and the resulting solution is diluted to 50.0 mL with water, what is the molarity of the Cu(NO3)?
For each of the following, i. Identify the type of reaction using the letters designated below: – Precipitation Reaction (P) – Acid-Base Neutralization Reaction (N) – Oxidation-Reduction (Redox) Reaction (R) ii. Balance the equation TYPE ______ A. ______ Al (s) + ______ H2SO4 (aq) Þ ______ H2 (g) + ______ Al2(SO4)3 (aq) ______ B. ______ C5H12 (l) + ______ O2 (g) Þ ______ CO2 (g) + ______ H2O (g) ______ C. ______ Cu(NO3)2 (aq) +...
Zinc reacts with hydrochloric acid to form hydrogen gas. A 0.258 g sample of Zinc reacts with 25.0 mL of 0.250 M HCI solution. What volume does the hydrogen has formed occupy at 24.0 °C and 0.990 atm? Zn(s) + 2HCl(aq) --ZnCl2(aq) + H2(g) 33.0 mL 97.3 mL 6.21 mL 77.0 mL
Part A Manganese reacts with hydrochloric acid to produce manganese(II) chloride and hydrogen gas. Mn(s) + 2 HCl(aq) + MnCl, (aq) + H (9) When 0.620 g Mn is combined with enough hydrochloric acid to make 100.0 mL of solution in a coffee-cup calorimeter, all of the Mn reacts, raising the temperature of the solution from 23.5°C to 28.6 °C. Find AHxn for the reaction as written. (Assume that the specific heat capacity of the solution is 4.18 J/g °C...
2. Balance the following equations. Identify each of the following reactions as belonging to one of the following categories: precipitation, acid-base (neutralization), or oxidation- reduction (8 points) a. H2SO4 (aq) + Fe(s) → FeSO4(aq) + H2(g) b. Ca(OH)2(aq) +HNO3(aq) → Ca(NO3)2(aq) + H2O(1) c.2 Fe(s) +3 Cl2(g) +2 FeCl3(s) d. AgNO3(aq) + CaCl2(aq) → AgCl(s) + Ca(NO3)2(aq) 3. Write the balanced molecular and net ionic equations for each of the following reactions. Identify the spectator ions. (6 points) a. Solid...
QUESTION 1 6 points Save Answer The purpose of an indicator in an acid-base titration is to indicate the of the titration. Use Table 10.2 for the following question. If an acidic solution is titrated with a basic solution and methyl violet is used as an indicator, the solution color will change from to QUESTION 2 3 points Save Answer The molarity of a solution prepared by dissolving 17.0 g of hydrochloric acid (HCI (aq) in 133 mL of water...
16 Cts with aqueous copper(II) chloride accord- 101. Zinc metal reacts with aqueous copper(1) ing to this equation: Zn (s) + CuCl2 (aq) → ZnCl2 (aq) + Cu (s) In this reaction, what mass of copper metal can be pro- duced from the reaction of 500 mL of 1.20-M aq. cu 2 with excess zinc? 10 103. The concentration of bromide ion may be determined by gravimetric analysis, using this reaction: Ag+ (aq) + Br (aq) → AgBr (s) A...