3. d) aud e) ito-c-CHzCHtzCtzCH CH2 Li ラD Cwates soluble Se-H NaNH 2)H90t G -0-CH3 +...
LES BELOW FOR QUESTIONS 23-28. CH3 F. CH2-CH2-C J. СН 3-C-OH H. NH2-C-NH2 G. CH3-CH2 9 CH3 K. CH3 -CH2-CH2-c M. CH3-CH-CH3 L. CH3-C-O-C H3 NH2 N.0%-O- (CH2)5-CMg P. CH3-C-CH3 S. CH3-CH2-N CH3-CH-CH3 CH3 CH3 CH3-CH2-C-CH 3 CH3 Х. V. W. CH3-CH-CH-CH2-CH2-CH2 CH3 -CH- CH2 CH2-CH3 C2Hs CH3-CH- C-CH2-CH3 AA. -(CH 2- CH)- Z. -(CH2-CH) CH3-CH2-CH-CH3 CH3 он но AB. -(CH2 - CH)- Ac.-|-o-(CH 2)40-C-N-(CH2)6N-C- 23. Which molecule would produce a ketone when oxidized? a. F b. G c. J...
5. Consider the following compounds: b) сH.CH.CH a) CH3(CH2)CH c) CeHsCCHy d) CHs(CH2)COH e) CHs(CH2) CH=CHCHs )CHs(CH2) CEN h) CHs(CH2) N(CHs) g) CeHsOH D CH-CH-CH,&N(CH,CH,сH,) i) C H5CH ) CH5(CH2)-COCH k) CH,CH2OH Which one(s) of the above would be soluble in water? Which one(s) would not be soluble in water but would be soluble in 5% HCI? Which one(s) would not be soluble in water but would be soluble in 5 % NaOH? Which one(s) would not be soluble in...
Give common names: a. C CHZ CH-CH3 OH ?. d. CH3 CH2-0-CH2-CH2-CH2-CH3 b. 0 CH2 CH CH2 CH2 CH3 CH2CH3 2 e. CH3 N CH2-CH2-CH3
5. Consider the following compounds a) CH(CH2).CH b) CH.CHEH d) CH.CH. BOH C) CHEECH e) CH(CH2).CH-CHCH, 1) CH (CH2),CEN g) C&H OH h) CH (CH2),N(CH3)2 D) CH.CH CHEN(CH_CH2CH3)2 i) CHCH k) CH3CH2OH ) CH,(CH2), COCH Which one(s) of the above would be soluble in water? Which one(s) would not be soluble in water but would be soluble in 5% HCI? Which one(s) would not be soluble in water but would be soluble in 5% NaOH? Which one(s) would not be...
CH2-0-CO-(CH2)12-CH3 | CH-O-CO-(CH2)12-CH3 Structure (2) | CH2-PO4-CHOLINE part A Classify the Structure part-B Name of the fatty acid bonded to the structure part-C Classify CHOLINE part-D What is the net charge for PO4-CHOLINE ? part-E Is this structure water soluble? Explain briefly
g) Which structure is Z-2-bromo-3-methyl-2-pentene? CH3 H3C CH2CH3 H C=C CH-CH,CH, CH3 CH3 Вісн. C=C CH3 Br н Br | BÁ CHẠCH, C=C CH, CHỊCH, 10) Which compounds contain stereocenters? D) 1-chloropentane II) 2-chloropentane III) 3-chloropentane IV) 1,2-dichloropentane 11) Aspartame is an artificial, non-saccharide sweetener. It is made from two amino acids phenylalanine (methyl ester) and aspartic acid. Both aminoacids have one stercocenter. Both stereocenters have S-stereoconfiguration. Which of the two structures is aspartame? H2N-C-C-N-C-0-0 CH2 CH2 c=0 HO HO...
19) The structure is that of a CH3-(CH2)14-0-0-(CH2)25-CH3 A) fatty acid B) steroid C) wax D) triacylglycerol E) glycerophospholipid 20) What type of lipid is the following compound? CH,OC(CH2) 16CH3 10 CHOC(CH2) 14CH3 CHOC(CH2)18CH A) steroid B) bile salt C) glycerophospholipid D) triacylglycerol E) wax
5) The IUPAC name for CH3-CH2-C = C-CH3 is A) 3-pentyne B) 2-pentyne C) pentyne D) 1-methylbutyne. 6) What is the name of the compound shown below? H CHCH CEC H3CH A) 2-pentene B) trans-2-pentene C) trans-3-pentene D) cis-2-pentene 9) What is the name of the compound below? CH3 ΟΙ A) 1-chlorotoluene C) 3-chlorotoluene B) 2-chlorotoluene D) 4-chlorotoluene 17) What is the product when this compound undergoes oxidation? CH3 CH3 -C- CH2 - CH2-OH CH3 A) hexanal B) 2,2-dimethylbutanal C)...
Which of the following can exist in enantiomers? a. b. CH3 CH3-CH;-CH2-C-CH; CH3-CH2-CEC-CH, C. d. all of these choices CH3-CH-C-CHE -8-сон, CH,-8-3-CH, спесне: -он, 10. What type of compound is the second product in the reaction shown below? CH-0-2-CH, OCH & CHOCH, H,CH, +3 NaOH + CH-OH + CH-OH CH -0-C-(CH2)16CH, a, fatty acid salt b. ester CH-OH c. alcohol d. fatty acid
Practice Set-lll CH3 o 1. H3c-C- CHa a HaC, CH3 PY ? H-C-N H Нас + OH T CH2 2. ? CH2 he N(CH3)2 O2N HaC CH3 Phosgene, ? (Review a 3. O-CC2 2 CO2H PY ? HaC 4. Нас OH +CH3 NH2 ? H + excess CH30H ? 6. CH(CH2)16 heat b-(CH2)1CH3 heat ? 7. CaHs-C O-CH2 + NH2-OH hydrorylarnine O-
Practice Set-lll CH3 o 1. H3c-C- CHa a HaC, CH3 PY ? H-C-N H Нас + OH T...