Complete and balance the equation. Pb(NO3)2.caq) + HCl caps >

Question

Question

Complete and balance the equation.
Pb(NO3)2.caq) + HCl caps >

science chemistry

Answer 1

Answer #1

Dute Page: - Pb(NO₃ h (aq) + hu lag) PbCl(s) + UNO3 Car Balance equation Pb = 1 NO₃ = 2 1 = 1x2 = 2 ce 1x2=2 РЬ 2 1 NO3 = 1 X

Answer 2

Similar Homework Help Questions

balancing equation Zn(s) +HCl(aq) HCl+ Na2SO3 HCl +ZnS Pb(NO3) +HCl

balancing equation Zn(s) +HCl(aq) HCl+ Na2SO3 HCl +ZnS Pb(NO3) +HCl
Complete the following molecular equation Pb(NO3)2(aq) + 2KI(aq) →

Complete the following molecular equation Pb(NO3)2(aq) + 2KI(aq) →
MgCl2(aq)+H2(g)→ C4H10(g)+O2(g)Δ ⟶ Al(s)+O2(g)→ HCl(aq)+Pb(NO3)2(aq)→ complete and balance the following equations

MgCl2(aq)+H2(g)→ C4H10(g)+O2(g)Δ ⟶ Al(s)+O2(g)→ HCl(aq)+Pb(NO3)2(aq)→ complete and balance the following equations

how to balance this equation? MnO2 + PbO2 + HNO3 → HMnO4 + Pb(NO3)2 + H2O...

how to balance this equation? MnO2 + PbO2 + HNO3 → HMnO4 + Pb(NO3)2 + H2O thanks
Balance the following equation: V + HNO3 -----> V(NO3)3 + N2O + H2O

Balance the following equation: V + HNO3 -----> V(NO3)3 + N2O + H2O
7. 8. Na2SO3 + HCI — K,CrO4 + Pb(NO3)2 —> NaC,H,O, + HCl — NaOH +...

7. 8. Na2SO3 + HCI — K,CrO4 + Pb(NO3)2 —> NaC,H,O, + HCl — NaOH + NH4NO3 → 09HHH - .100 ,00 HO, 00 → BiClg + H2S Dan 13. | 14. 15. K,C,04 + HCI — H,PO, + Ca(OH)2 — (NH) CO, + HNO3 - K.CO, + NiBr-

Na2SO4+Pb(NO3)2=Na2(NO3)2+PbSO4 Balanced equation: Ionic equation:

Na2SO4+Pb(NO3)2=Na2(NO3)2+PbSO4 Balanced equation: Ionic equation:
1)balance the following equations KI+Pb(NO3)2==PbI+KNO3 and HCL+AgNO3===Agcl(s)+HNO3 2) What happens when hcl is mixed with AgNO3,...

1)balance the following equations KI+Pb(NO3)2==PbI+KNO3 and HCL+AgNO3===Agcl(s)+HNO3 2) What happens when hcl is mixed with AgNO3, What colour pf the precipitate does it from? Can you observe for silver
Classify the following reaction and balance the equation by entering the smallest possible integer coefficients. Pb(NO3)2...

Classify the following reaction and balance the equation by entering the smallest possible integer coefficients. Pb(NO3)2 (aq) + Mnly (aq) —> Pblz (s) + Mn(NO3)2 (aq) Reaction Type: ___ Submit Answer

Complete and balance the equations below by ½ reaction method. 6. _ _C _HNO - Cu(NO3)+...

Complete and balance the equations below by ½ reaction method. 6. _ _C _HNO - Cu(NO3)+ NO (dilute acid) Write balanced equation: 7. _Cus+ _ _HNO3) => _ _Cu(NO3)2) + NO2 (cono, acid) Write balanced equation: 8. MnO + CO2) => Costa) + MnO2is) (basic soln.) Write balanced equation: