Question

How do you calculate the half life for this reaction?Image for The first-order reaction of decomposition of azomethane is given below: At a certain temperature, the rate con

0 0
Add a comment Improve this question Transcribed image text
Answer #1
Concepts and reason

This problem is based on calculating half life of a first order reaction. Half-life of a reaction is the time needed for the decrease in concentration of a reactant to half its initial value.

Fundamentals

The formula to calculate half-life period for a first order reaction is as follows:

t1/2=0.693k{t_{1/2}} = \frac{{0.693}}{k}

Here, t1/2{t_{1/2}} is half-life of the reaction and k is rate constant.

The reaction is as follows:

CH3N=NCH3(g)N2(g)+C2H6(g){\rm{C}}{{\rm{H}}_3} - {\rm{N}} = {\rm{N}} - {\rm{C}}{{\rm{H}}_3}\left( g \right) \to {{\rm{N}}_2}\left( g \right) + {{\rm{C}}_{\rm{2}}}{{\rm{H}}_6}\left( g \right)

The formula for calculating half life period of a reaction is as follows:

t1/2=0.693k{t_{1/2}} = \frac{{0.693}}{k}

Substitute 3.05×101s1{\rm{3}}{\rm{.05}} \times {\rm{1}}{{\rm{0}}^{ - 1}}{\rm{ }}{{\rm{s}}^{ - 1}} for k.

t1/2=0.6933.05×103s1=227.213s\begin{array}{c}\\{t_{1/2}} = \frac{{0.693}}{{{\rm{3}}{\rm{.05}} \times {\rm{1}}{{\rm{0}}^{ - 3}}{\rm{ }}{{\rm{s}}^{ - 1}}}}\\\\ = 227.213{\rm{ s}}\\\end{array}

Ans:

The half-life for the reaction is 227.213s227.213{\rm{ s}} .

Add a comment
Know the answer?
Add Answer to:
How do you calculate the half life for this reaction? The first-order reaction of decomposition of...
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Not the answer you're looking for? Ask your own homework help question. Our experts will answer your question WITHIN MINUTES for Free.
Similar Homework Help Questions
  • the first order decomposition of C3H6 at a given temperature had a half life of 4.576...

    the first order decomposition of C3H6 at a given temperature had a half life of 4.576 *10^2 seconds. what is the rate constant for C3H6

  • The first order decomposition of HI(g) at a given temperature has a half-life of 5.453 x...

    The first order decomposition of HI(g) at a given temperature has a half-life of 5.453 x 101 seconds. What is the rate constant for HI(g)?

  • Question 6 (18 marks) (a) Given that the rate constant k for the first-order decomposition of...

    Question 6 (18 marks) (a) Given that the rate constant k for the first-order decomposition of compound X is 2.65 x 10-9 s', calculate the percentage of compound X that has decomposed in the first 2250 seconds after the reaction begins. (4 marks) (b) Consider the first order reaction: W2 → 2 Y. If [W2]=0.8 M initially and 0.17 M after 160 seconds, what will [W2] be after 350 seconds? (4 marks) (c) Data for the reaction 3A + 5B...

  • Half-life equation for first-order reactions: t1/2=0.693k   where t1/2 is the half-life in seconds (s), and k...

    Half-life equation for first-order reactions: t1/2=0.693k   where t1/2 is the half-life in seconds (s), and k is the rate constant in inverse seconds (s−1). a) What is the half-life of a first-order reaction with a rate constant of 4.80×10−4  s−1? b) What is the rate constant of a first-order reaction that takes 188 seconds for the reactant concentration to drop to half of its initial value? Express your answer with the appropriate units. c)A certain first-order reaction has a rate constant...

  • 2. Answer the following questions by connecting the half-life of each first-order reaction to the rate...

    2. Answer the following questions by connecting the half-life of each first-order reaction to the rate constant. a. The rate constant of a first-order reaction is 2.43 × 10–2 min–1. What is the half-life of the reaction? (2 points) b. A first-order reaction has a rate constant of 0.547 min-1. How long will it take a reactant concentration 0.14 M to decrease to 0.07 M? (2 points) c. The half-life of a first-order reaction is 5.47 min. What is the...

  • 1. What is the half-life of a first-order reaction with a rate constant of 1.90×10−4  s−1? Express...

    1. What is the half-life of a first-order reaction with a rate constant of 1.90×10−4  s−1? Express your answer with the appropriate units. 2. What is the rate constant of a first-order reaction that takes 244 seconds for the reactant concentration to drop to half of its initial value? 3. A certain first-order reaction has a rate constant of 1.80×10−3 s−1. How long will it take for the reactant concentration to drop to 18 of its initial value?

  • The decomposition reaction of A to B is a first-order reaction with a half-life of 6.19×102...

    The decomposition reaction of A to B is a first-order reaction with a half-life of 6.19×102 seconds: A → 2B If the initial concentration of A is 0.147 M, how many minutes will it take for the concentration of A to be 18.5% of the initial concentration?

  • For a first-order reaction, the half-life is constant. It depends only on the rate constant k...

    For a first-order reaction, the half-life is constant. It depends only on the rate constant k and not on the reactant concentration. It is expressed as t1/2=0.693kt1/2=0.693k For a second-order reaction, the half-life depends on the rate constant and the concentration of the reactant and so is expressed as t1/2=1k[A]0 Part A. A certain first-order reaction (A→products) has a rate constant of 3.00×10−3 s−1 at 45 ∘C∘C. How many minutes does it take for the concentration of the reactant, [A],...

  • For a first-order reaction, the half-life is constant. It depends only on the rate constant k...

    For a first-order reaction, the half-life is constant. It depends only on the rate constant k k and not on the reactant concentration. It is expressed as t1/2=0.693k t 1 / 2 = 0.693 k For a second-order reaction, the half-life depends on the rate constant and the concentration of the reactant and so is expressed as t1/2=1k[A]0. A certain first-order reaction (A→products A → p r o d u c t s ) has a rate constant of 9.30×10−3...

  • a first order reaction with a single reactant (A) is found to have a half-life of...

    a first order reaction with a single reactant (A) is found to have a half-life of 69.4 seconds. 1) calculate the rate constant for the reaction 2) if [A]0=0.100 M , calculate [A]t at 60.0 seconds 3) how long will it take , in mintues for 90.0 % of A to decompose ?

ADVERTISEMENT
Free Homework Help App
Download From Google Play
Scan Your Homework
to Get Instant Free Answers
Need Online Homework Help?
Ask a Question
Get Answers For Free
Most questions answered within 3 hours.
ADVERTISEMENT
ADVERTISEMENT