Calculate the pH and the equilibrium
concentrations of
HC2O4- and
C2O42- in a
0.0782 M oxalic acid solution,
H2C2O4
(aq).
For H2C2O4,
Ka1 = 5.9×10-2 and
Ka2 = 6.4×10-5
| pH =_______ | |
| [HC2O4-] =___________ | M |
| [C2O42-] =___________ | M |
Oxalic acid ionizes as
HCOOH HCOOH + H2O ----------> HC2O4- + H3O+
Ka1= [HC2O4-][H3O+]/[H2C2O4]=5.9*10-2
preparing the ICE table
componen initial concentration (M) change in concentration(M) Equilibrium concentration(M)
H2C2O4 0.0782 -x 0.0782-x
HC2O4- 0 x x
H3O+ 0 x x
Ka1= x2/0.0782-x)= 0.059, when sovled for x, x= [H3O+]= 0.0446, [HC2O4-]= 0.0446 and H2C2O4= 0.0782-0.0446= 0.0336
[HC2O4-] undergoes further ionization as HC2O4-+ H2O --------->C2O4-+ H3O+
Ka2= [H3O+][C2O4-]/[HC2O4-] = 6.4*10-5
let x= drop in concentration of HC2O4- to reach equilibrium, at Equilibrium,[H3O+]= [C2O4-]=x
preparing the second ICE Table , x2/(0.0446-x)= 6.4*10-5, when solved for x, x= [H3O+]= 0.00166 and [C2O4-]= 0.00166
total of [H3O+]= 0.00166+0.0446=0.04626, pH= -log [H3O+]= 1.33
Calculate the pH and the equilibrium concentrations of HC2O4- and C2O42- in a 0.0782 M oxalic...
Calculate the pH and the equilibrium concentrations of HC2O4- and C2O42- in a 0.1160 M oxalic acid solution, H2C2O4 (aq). For H2C2O4, Ka1 = 5.9×10-2 and Ka2 = 6.4×10-5 pH = [HC2O4-] = M [C2O42-] = M
Oxalic acid (HOOC-COOH) is a simple diprotic acid. It is used commercially in bleaching straw and leather and removing rust and ink stains. a. Write each dissociation step for the acid including the K values from appendix C. b. What are the equilibrium concentrations of [H2C2O4], [HC2O4- ], and [C2O42- ] in a 0.150M H2C2O4 solution. (Hint: the concentrations of [H2C2O4], [HC2O4- ] are found together and used to find concentration of [C2O42- ].) c. What is the pH of...
Calculate the pH and the equilibrium concentrations of HSO3- and SO32- in a 0.1770 M sulfurous acid solution, H2SO3 (aq). For H2SO3, Ka1 = 1.7×10-2 and Ka2 = 6.4×10-8 pH = [HSO3-] = _______ M [SO32-] = ______ M
Polyprotic acids contain more than one dissociable proton. Each dissociation step has its own acid-dissociation constant, Ka1, Ka2, etc. For example, a diprotic acid H2A reacts as follows: H2A(aq)+H2O(l)⇌H3O+(aq)+HA−(aq) Ka1=[H3O+][HA−][H2A] HA−(aq)+H2O(l)⇌H3O+(aq)+A2−(aq) Ka2=[H3O+][A2−][HA−] In general, Ka2 = [A2−] for a solution of a weak diprotic acid because [H3O+]≈[HA−]. Many household cleaning products contain oxalic acid, H2C2O4, a diprotic acid with the following dissociation constants: Ka1=5.9×10−2, Ka2=6.4×10−5 Part A) Calculate the equilibrium concentration of H3O+ in a 0.20 M solution of oxalic...
calculate the pH and pOH for a 0.15 M oxalic acid H2C2O4 solution. (ka1-6.0x10^-2, Ka2-6.1x10^-5)
Question 1 Oxalic acid is a diprotic acid (Ka1 = 5.9 x 10-2 and Ka2 = 6.4 x 10-5). Identify each of the following statements as true or false regarding a titration of 1.0 M oxalic acid with a 1.0M NaOH solution at 25 degrees Celsius. a) At pH = 3, the predominant species of oxalic acid in solution is amphiprotic. b) One mole of NaOH will fully neutralize one mole of oxalic acid. c) The pH at the second...
Determine the concentration of all chemical species found in a solution of 0.20M oxalic acid (H2C2O4) a diprotic acid with Ka1=5.9*10^-2 and Ka2=6.5*10^-5. (Hint: start by writing the two equilibrium that describes the dissociation of the diprotic acid) Determine the pH of the solution. is H3O+ produced in the second equilibrium negligible?
The pH of a 0.20-M solution of oxalic acid (H2C2O4) is measured to be 1.10. Use this information to determine a value of Ka for oxalic acid. H2C2O4(aq) + H2O(l) HC2O4-(aq) + H3O+(aq) Ka =
Can somebody work through this problem for me? Consider an aqueous solution of oxalic acid (H2C2O4), used in bleaching leather and removing rust and ink strains. What is the pH and [C2O42– ] in a 0.15 M H2C2O4 solution (Ka1= 6.5 × 10–6; Ka2 = 6.1 × 10–10)? (The answer is 3.0 and 6.1 × 10–10)
Calculate the pH of 1.00 x 10^-2 M oxalic acid solution. Calculate the pH of 1 x 10^-2 M solution of sodium oxalate. Ka1 = 5.62 x 10^-2, Ka2 = 5.42 x 10^-5