1) No net ionic equation
2) No net ionic equation
3) No net ionic equation
4) No net ionic equation
Note: Reaction (4) is same as reaction (1).

What is the Net ionic equation for 1) KCl + Na2CO3 2)NaCl + Na2SO4 3)KBr +...
Na2SO4+(NH4)2CO3=Na2CO3+(NH4)2SO4 Balanced equation: Ionic equation: Net ionic equation:
Write molecular equation, ionic equation, net ionic equation for the following reactions 1. reaction of AgNO3 and NaCl 2. reaction of AgNO3 and NaOH 3. reaction of AgNO3 and Na2SO4 4. reaction of AgNO3 and Na3PO4 5. reaction of AgNO3 and Na2CO3 6. reaction of AgNO3 and NaC2H3O2
Please help me write molecular , total, net ionic equation for the following reactions: Ca(NO3)2 +NaCl Na2CO3 + Ca(NO3)2 Na2SO4 + CuCl2 Na2SO4 +Pb(NO3)2 Pb(NO3)2 +CuCl2 AgNO3 + Na2SO4 AgNO3 +CuCl2
KCl and KBr are both ionic solids. A mixture of KCl and KBr has a mass of 3.595 g. When this mixture is heated in the presence of excess Cl2, all of the KBr is converted to KCl. If the total mass of KCl present after this reaction is 3.129 g, what percentage (by mass) of the original mixture was KBr? (HINT: Be sure that you understand why the mass of the sample has decreased. It may help if you...
what is the ionic and net ionic equation?
NA2CO3 + CuSO4
NA2CO3 + CuSO4
What is the net ionic equation that is obtained (if any) by reacting Na2CO3 and HCl?
For
each reactions, write the complete ionic equation ( including
physical states). NOT NET IONIC EQUATION!
a. KI (aq) + NaCl (aq) →N b. AgNO3 (aq) + KBr (aq) – c. Na2CO3 (aq) + CaCl2 (aq) d. Pb(NO3)2 (aq) + KI (aq)
in the reaction KBr + NH4CL = NH4Br + KCL I have the complete ionic equation as K+ + Br- + NH4+ + Cl- = NH4++ Br-+ K++ Cl- Because the equation is already balanced, would this also be the net ionic equation since no precipitate formed from this reaction? Would they all be spectator ions, or are there no spectator ions since the equation does not form a precipitate?
Help me solve and understand this
3 Balanced Reaction - CaCl2(aq) + Complete Ionic Equation: Net Ionic Reaction Balanced: Na2CO3 (aa) 4 Balanced Reaction - H₂SO4 (aq) + NaOH (aa) → Complete Ionic Equation: Net Ionic Reaction Balanced (5) Balanced Reaction _HCl(aq) + NaOH (as) Complete Ionic Equation: Net ionic Reaction Balanced: (6) Balanced Reaction -NH₂ NO3(aq) + Na2SO4 (99) Complete Ionic Equation: Net Ionic Reaction Balanced: 6 Balanced Reaction AgNO3(aq)+ NaBr (aq) → Complete Ionic Equation: Net Ionic Equation...
What is the molecular, complete ionic, and net ionic equation for Na2SO4 + CuCl2?