Homework Answers
Add Answer to:
What mass of lead sulfate (PbSO4) is formed in a lead-acid storage battery when 1.00 g...
Question 10 0.5 pts What mass of lead sulfate (PbSO4) is formed in a lead-acid storage...
Question 10 0.5 pts What mass of lead sulfate (PbSO4) is formed in a lead-acid storage battery when 1.00 g of Pb undergoes oxidation? Hint: Lead-Acid batter cell: Pb(s) + PbO2(s) + 2 H2SO4(aq) → 2 PbSO4(s) + 2 H2O(1) Hint #2: Convert grams to moles and then moles back into grams. Mass of PbSO4 formed = 0.007 grams Mass of PbSO4 formed = 0.275 grams Mass of PbSO4 formed = 1.225 grams Mass of PbSO4 formed = 2.275 grams...
5. A lead storage battery involves the following two half-reactions: PbSO4(s) + 2e → Pb(s) +...
5. A lead storage battery involves the following two half-reactions: PbSO4(s) + 2e → Pb(s) + SO42- (aq); E = -0.36 V PbO2(s) + 4H*(aq) + SO42 (aq) + 2e → PbSO4(s) + 2H2O(1); E° = 1.69 V In the lead battery during the discharge reaction: A) PbSO4 is the cathode. B) PbSO4 is the anode. C) Pb is the anode. D) PbO, is the anode. E) H2SO4 is the cathode.
Use the following lead-acid battery cell to answer the related questions: PbO2 (s) │PbSO4 (s) │H2SO4...
Use the following lead-acid battery cell to answer the related questions: PbO2 (s) │PbSO4 (s) │H2SO4 (aq) (1 M) ‖ H2SO4 (aq) (1 M)│Pb (s) │PbSO4 (s) A. (5 pts) Determine the Cell potential for the battery at 25°C B. (5 pts) A high output alternator for a KIA soul can produce 220 Amp current. How long would it take to recharge/reform 4.03 kg of Pb at that rate (assuming your battery is near dead)?
In a lead acid battery (the battery that is used to start your car), the following...
In a lead acid battery (the battery that is used to start your car), the following reaction occurs: Pb(s) + PbO2(s) + 2 H2SO4(aq) → 2 PbSO4(s) + 2 H2O(l) How many electrons are transferred in this reaction? Enter your answer as an integer.
ch.19 answer each of them please Part A What mass of lead sulfate is formed in...
ch.19
answer each of them please
Part A What mass of lead sulfate is formed in a lead-acid storage battery when 1.12 g of Pb undergoes oxidation? IVO AQ ? Submit Request Answer Part A What mass of aluminum metal can be produced per hour in the electrolysis of a molten aluminum salt by a current of 29 A? Express your answer using two significant figures. VO AXO ? mo 8 Submit Request Answer Copper can be electroplated at the...
The standard half-cell reactions of lead acid battery is: 2) Half-cell reduction reaction form: red 1.69...
The standard half-cell reactions of lead acid battery is: 2) Half-cell reduction reaction form: red 1.69 +4Ht +so +2ePbSO4,()+2H2O) РЬОог.0) Red (aq) -Ox. PbSO4.()+2e Pb)+SO -0.36 4.(aq) Pb()+PbO2.(s)+2H2SO4.(ag) Tot. 2PBSO4.()+ 2H20() 2.05 a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery. I b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference potential?
The lead-acid storage battery is the oldest rechargeable battery in existence. It was invented in 1859...
The lead-acid storage battery is the oldest rechargeable battery in existence. It was invented in 1859 by French physician Gaston Plante and still retains application today, more than 150 years later. There are two reactions that take place during discharge of the lead-acid storage battery. In one step, sulfuric acid decomposes to form sulfur trioxide and water: H2SO4 (l) → SO3 (g) + H2O (l) ΔH=+113.kJ In another step, lead, lead(IV) oxide, and sulfur trioxide react to form lead(II) sulfate:...
The standard half-cell reactions of lead acid battery is: 2) ЕФN Half-cell reduction reaction form: red...
The standard half-cell reactions of lead acid battery is: 2) ЕФN Half-cell reduction reaction form: red PbOo2.(s) 4H+ + so2 4, (aq) PbSO4,()+2H20 Red 2e 1.69 Рo) + So?- 4.(aq) -Ox -0.36 Pbs04.(s)2e Pb()PbO2,(s)+ 2H2SO4,(ag) 2P6SO4.(6) +2H20D 2.05 Tot. a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference...
Problem 2 (chapter 18.3, 2 points): The lead-acid battery is commonly used in cars. One electrode...
Problem 2 (chapter 18.3, 2 points): The lead-acid battery is commonly used in cars. One electrode is a lead grid filled with spongy lead Pb(s). The other electrode is a lead grid filled with spongy lead oxide PbO2(s). The net reaction that occurs is: Pb(s)+PbO (s+2H(aq) 2HSO (aq) ->2PbSO4(s2H 0(0) a) Write down the half reactions that occur at each electrode. b) Identify the oxidation state of Pb in each of the species: Pb(s), PbO2(s) and PbSO4(s). Explain. c) Identify...
The spontaneous galvanic cell of a lead storage battery (a typical car battery) is composed of the following reduction half reactions reduced 1.69 v Pb02 (s)+ HSO, (aq)+3 Ha0 (aq) + 2 e Pbs04 (s)...
The spontaneous galvanic cell of a lead storage battery (a typical car battery) is composed of the following reduction half reactions reduced 1.69 v Pb02 (s)+ HSO, (aq)+3 Ha0 (aq) + 2 e Pbs04 (s)+5 H20) PbSO4 (s) + H3O (aq) 2 e Pb (s)+HSO (aq)+ H20 (I) E reduced 0.36 V How much current (in A) does a cell phone charger for your car use if your car dies after 14 hours of leaving the phone plugged in without...
Question 10 0.5 pts What mass of lead sulfate (PbSO4) is formed in a lead-acid storage battery when 1.00 g of Pb undergoes oxidation? Hint: Lead-Acid batter cell: Pb(s) + PbO2(s) + 2 H2SO4(aq) → 2 PbSO4(s) + 2 H2O(1) Hint #2: Convert grams to moles and then moles back into grams. Mass of PbSO4 formed = 0.007 grams Mass of PbSO4 formed = 0.275 grams Mass of PbSO4 formed = 1.225 grams Mass of PbSO4 formed = 2.275 grams...
5. A lead storage battery involves the following two half-reactions: PbSO4(s) + 2e → Pb(s) + SO42- (aq); E = -0.36 V PbO2(s) + 4H*(aq) + SO42 (aq) + 2e → PbSO4(s) + 2H2O(1); E° = 1.69 V In the lead battery during the discharge reaction: A) PbSO4 is the cathode. B) PbSO4 is the anode. C) Pb is the anode. D) PbO, is the anode. E) H2SO4 is the cathode.
ch.19
answer each of them please
Part A What mass of lead sulfate is formed in a lead-acid storage battery when 1.12 g of Pb undergoes oxidation? IVO AQ ? Submit Request Answer Part A What mass of aluminum metal can be produced per hour in the electrolysis of a molten aluminum salt by a current of 29 A? Express your answer using two significant figures. VO AXO ? mo 8 Submit Request Answer Copper can be electroplated at the...
The standard half-cell reactions of lead acid battery is: 2) Half-cell reduction reaction form: red 1.69 +4Ht +so +2ePbSO4,()+2H2O) РЬОог.0) Red (aq) -Ox. PbSO4.()+2e Pb)+SO -0.36 4.(aq) Pb()+PbO2.(s)+2H2SO4.(ag) Tot. 2PBSO4.()+ 2H20() 2.05 a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery. I b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference potential?
The standard half-cell reactions of lead acid battery is: 2) ЕФN Half-cell reduction reaction form: red PbOo2.(s) 4H+ + so2 4, (aq) PbSO4,()+2H20 Red 2e 1.69 Рo) + So?- 4.(aq) -Ox -0.36 Pbs04.(s)2e Pb()PbO2,(s)+ 2H2SO4,(ag) 2P6SO4.(6) +2H20D 2.05 Tot. a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference...
Problem 2 (chapter 18.3, 2 points): The lead-acid battery is commonly used in cars. One electrode is a lead grid filled with spongy lead Pb(s). The other electrode is a lead grid filled with spongy lead oxide PbO2(s). The net reaction that occurs is: Pb(s)+PbO (s+2H(aq) 2HSO (aq) ->2PbSO4(s2H 0(0) a) Write down the half reactions that occur at each electrode. b) Identify the oxidation state of Pb in each of the species: Pb(s), PbO2(s) and PbSO4(s). Explain. c) Identify...
The spontaneous galvanic cell of a lead storage battery (a typical car battery) is composed of the following reduction half reactions reduced 1.69 v Pb02 (s)+ HSO, (aq)+3 Ha0 (aq) + 2 e Pbs04 (s)+5 H20) PbSO4 (s) + H3O (aq) 2 e Pb (s)+HSO (aq)+ H20 (I) E reduced 0.36 V How much current (in A) does a cell phone charger for your car use if your car dies after 14 hours of leaving the phone plugged in without...
Most questions answered within 3 hours.
-
Where is the error in this code sequence?
String s1 = "Hello";
String s2 = "ello";...
asked 11 months ago -
Financial data for Joel de Paris, Inc., for last year
follow:
Joel de Paris, Inc.
Balance...
asked 11 months ago -
Consider this reaction:
Al2(SO4)3 (aq)+ BaCl3
(aq) Al2Cl6 (aq)- +
3BaSO4(s) . What is the...
asked 11 months ago -
Suppose that Savneet is considering increasing her
recent random sample from 20 car rentals to 40...
asked 11 months ago -
Trucks arrive at an unloading terminal at an average rate of 120
per hour.
Trucks arrive...
asked 11 months ago -
Why are methanol and ethanol completely soluble in water while
octanol is not very little soluble....
asked 11 months ago -
A facilities manager at a university reads in a research report
that the mean amount of...
asked 11 months ago -
When the CuSO4 is rehydrated by adding water to the anhydrous
compound, is this an endothermic...
asked 11 months ago -
A ray of sunlight is passing from diamond into crown glass; the
angle of incidence is...
asked 11 months ago -
A block of mass 0.249 kg is placed on top of a light, vertical
spring of...
asked 11 months ago -
how do the kidneys compensate in the presences of acidosis
a) trigger hyperventilate
b) reserve acid...
asked 11 months ago -
Question 501 pts
The rental rate of capital to the firm increases. Which of the
following...
asked 11 months ago