Molar mass of Pb = 207.2 g/mol
mass of Pb = 1 g
mol of Pb = (mass)/(molar mass)
= 1/2.072*10^2
= 4.826*10^-3 mol
According to balanced equation
mol of PbSO4 formed = (2/1)* moles of Pb
= (2/1)*4.826*10^-3
= 9.653*10^-3 mol
Molar mass of PbSO4,
MM = 1*MM(Pb) + 1*MM(S) + 4*MM(O)
= 1*207.2 + 1*32.07 + 4*16.0
= 303.27 g/mol
mass of PbSO4 = number of mol * molar mass
= 9.653*10^-3*3.033*10^2
= 2.927 g
Answer: 2.927 g
Question 10 0.5 pts What mass of lead sulfate (PbSO4) is formed in a lead-acid storage...
What mass of lead sulfate (PbSO4) is formed in a lead-acid storage battery when 1.00 g of Pb undergoes oxidation? Hint: Lead-Acid batter cell: Pb(s) + PbO2(s) + 2 H2SO4(aq) – 2 PbSO4(s) + 2 H2 O(1) Hint #2: Convert grams to moles and then moles back into grams.
5. A lead storage battery involves the following two half-reactions: PbSO4(s) + 2e → Pb(s) + SO42- (aq); E = -0.36 V PbO2(s) + 4H*(aq) + SO42 (aq) + 2e → PbSO4(s) + 2H2O(1); E° = 1.69 V In the lead battery during the discharge reaction: A) PbSO4 is the cathode. B) PbSO4 is the anode. C) Pb is the anode. D) PbO, is the anode. E) H2SO4 is the cathode.
Use the following lead-acid battery cell to answer the related questions: PbO2 (s) │PbSO4 (s) │H2SO4 (aq) (1 M) ‖ H2SO4 (aq) (1 M)│Pb (s) │PbSO4 (s) A. (5 pts) Determine the Cell potential for the battery at 25°C B. (5 pts) A high output alternator for a KIA soul can produce 220 Amp current. How long would it take to recharge/reform 4.03 kg of Pb at that rate (assuming your battery is near dead)?
The lead-acid storage battery is the oldest rechargeable battery in existence. It was invented in 1859 by French physician Gaston Plante and still retains application today, more than 150 years later. There are two reactions that take place during discharge of the lead-acid storage battery. In one step, sulfuric acid decomposes to form sulfur trioxide and water: H2SO4 (l) → SO3 (g) + H2O (l) ΔH=+113.kJ In another step, lead, lead(IV) oxide, and sulfur trioxide react to form lead(II) sulfate:...
ch.19
answer each of them please
Part A What mass of lead sulfate is formed in a lead-acid storage battery when 1.12 g of Pb undergoes oxidation? IVO AQ ? Submit Request Answer Part A What mass of aluminum metal can be produced per hour in the electrolysis of a molten aluminum salt by a current of 29 A? Express your answer using two significant figures. VO AXO ? mo 8 Submit Request Answer Copper can be electroplated at the...
In a lead acid battery (the battery that is used to start your car), the following reaction occurs: Pb(s) + PbO2(s) + 2 H2SO4(aq) → 2 PbSO4(s) + 2 H2O(l) How many electrons are transferred in this reaction? Enter your answer as an integer.
Problem 2 (chapter 18.3, 2 points): The lead-acid battery is commonly used in cars. One electrode is a lead grid filled with spongy lead Pb(s). The other electrode is a lead grid filled with spongy lead oxide PbO2(s). The net reaction that occurs is: Pb(s)+PbO (s+2H(aq) 2HSO (aq) ->2PbSO4(s2H 0(0) a) Write down the half reactions that occur at each electrode. b) Identify the oxidation state of Pb in each of the species: Pb(s), PbO2(s) and PbSO4(s). Explain. c) Identify...
The standard half-cell reactions of lead acid battery is: 2) Half-cell reduction reaction form: red 1.69 +4Ht +so +2ePbSO4,()+2H2O) РЬОог.0) Red (aq) -Ox. PbSO4.()+2e Pb)+SO -0.36 4.(aq) Pb()+PbO2.(s)+2H2SO4.(ag) Tot. 2PBSO4.()+ 2H20() 2.05 a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery. I b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference potential?
The standard half-cell reactions of lead acid battery is: 2) ЕФN Half-cell reduction reaction form: red PbOo2.(s) 4H+ + so2 4, (aq) PbSO4,()+2H20 Red 2e 1.69 Рo) + So?- 4.(aq) -Ox -0.36 Pbs04.(s)2e Pb()PbO2,(s)+ 2H2SO4,(ag) 2P6SO4.(6) +2H20D 2.05 Tot. a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference...
QUESTION 7 How many grams of sodium sulfate will be formed if you start with 10.00 grams of sodium hydroxide and you have an excess of sulfuric acid? How many grams of water will be formed? 2 NaOH + H2SO4 -> 2H2O + Na2S04 QUESTION 8 How many grams of lithium nitrate will be needed to make 200.0 grams of lithium sulfate, assuming that you have an adequate amount of lead (IV) sulfate to do the reaction? How much lead...