The correct formula is Pb(SO3)2. And it is a ternary compound . Since it is made up of 3 different elements so the answer is
Ternary salt- Pb(SO3)2 .(b) option is correct
Select the correct class and formula for lead (IV) sulfite. ternary salt, Pb2(SO3)4 ternary salt, Pb(SO3)2...
86. What is the formula for lead (IV) sulfide? B) PbS A) PbS C) Pb S D) Pb,S E) Pb,S 87. What is the name of H3PO4? A) hydrochloric acid C) sulfuric acid D) phosphoric acid E) none of these B) nitric acid 88. What is the name of Co,O,? A) dicobalt trioxide cobalt (II) oxide D) cobalt (III) oxide B) cobalt trioxide C) E) dicobalt (I) trioxide 89. What is the name of H2SO4 A) hydrosulfuric acid C) sulfuric...
35. The formula for the compound formed from the 4. NH(PO4h. b. NHPOA c. (NH4)2PO4 d. (NH4)2PO4h from the polyatomic ions NH. and PO, is The correct name for NiO is a. nickel(II)oxide b. nickel(l) oxide c. nickel oxide d. nickel monoxide e nickel(I) monoxide 37. The correct name for an aqueous solution of HBr is a. bromic acid b. hydrobromic acid c. hypobromic acid d. hydrobromous acid c. hypobromous acid 38. Which of the following is named correctly? a....
1.) What is the formula for manganese(VI) oxide? 2.) Write the formula for the ion. cyanide ammonium hydrogen sulfate dichromate hydrogen phosphate carbonate chlorate 3.) Write the formulas of the following salts lead(II) phosphate cobalt(III) sulfate manganese(IV) permanganate . 4.) Finally, write the names of the following salts, using the rules discussed above. When using Roman Numerals, don't leave any space between the metal name and the (numeral), but do leave a space before the name of the non-metal. Pb(C2H3O2)4...
Worksheet. ll: Stock Nomenclature 1. Cu,P2 2. Pb,(PO)2 3. Fez(SO) 4. Pbo, 5. PbSO. 6. Cul 7. Pbo 8. Fe(CN) 9. Sn (PO)2 10. Cu(CIO), 11. FePO, 12.HgBr2 13.Fe2(SO) 14.Sn(SO) 15.Cu(OH)2 iron(II)sulfide tin(ll)oxalate copper(II)oxide iron(II)hydroxide tin(IV)carbonate copper(I)sulfite TODOS copper(II)nitrate lead(11)nitrite lead(IV)iodide iron(II)sulfide copper(t)acetate lead(l)phosphate tin(II)phosphide iron(III)permanganate lead(11)fluoride copper(II) nitrate tin(IV)chloride
Question 2 (2 points) Select the combination of name and formula that are correct. O titanium(1) carbonate TiCO3 O tin(IV) sulfate Sn(SO4)2 O aluminum sulfate AISO4 O phosphorus oxide P4010 Question 3 (2 points) Write a balanced equation to show the reaction of aqueous aluminum acetate with aqueous ammonium phosphate to form solid aluminum phosphate and aqueous ammonium acetate. Al(C2H302)2(aq) + (NH4)2PO4(aq) → AlPO4(s) + 2 NH4C2H302(aq) O Al(C2H302)2(aq) + (NH3)2PO4(aq) → AIPO4(s) + 2 NH3C2H302(aq) OAI(CO3)2(aq) + (NH3)2PO4(aq) →...
General Chem: questions 1-10 1. 9.73 g of lead(IV) chloride contains enough Cl- ions to make ____ g of magnesium chloride. a) 5.31 g b) 0.188 g c) 17.8 g d) 1.32 g e) 0.0557 g 2. What are the spectator ions when Co(OH)3 reacts with H2SO4? a) none b) H+ and OH- c) Co+3 and SO4-2 d) SO4-2 e) Co+3 3. When the molecular reaction between sodium silicate and copper(II) nitrite is balanced correctly...
please answer all 4 thanks so much
2. Select the correct ranking of base strength for the amines shown (from weakest to strongest). NH2 NH2 NH2 NH2 I II III IV A. I<lll<ll<IV B. Ill<ll<IV</ k<ll<l/kIV D. IV<ll<lll</ Ware strong because the halorens are electronegative 3. Identify the product formed when 3-phenyl-3-oxopropanal is reacted with the ethylene diamine. NH2 Ho@ B.N C. DI E. None 4. What is the most probable structure for the intermediate in the reaction shown below...
Select the correct chemical formula for iron(II)acetate A. CH3COOFe B. CH3COOFe2 C. (CH3COO)2Fe D. (CH3COO)3Fe QUESTION 2 During the oxidation process of cream of tartar with H2O2 and catalyst Fe2+, you observed a gas evolution. Identify the gas that is produced in this process. A. H2O(g) B. CO2(g) C. N2(g) D. O2(g) 2 QUESTION 3 The reaction you observed in part-2 can be described as A. exothermic reaction B. endothermic reaction C. metathesis reaction D. double displacement reaction QUESTION 4...
What is the condensed formula notation for 1,4-dibromo-2-methylpentane? Select the correct answer below: O Br-CH-CH, -C(Br)(CH,) -CH, CH, -CH-CH(Br)-CH(Br) -CH(CHA)-CH, O Br-CH-CH(CH)-CH-CH(Br)-CH, OCH, -CH(Br)-CH-CH(CH,)-CH-CH, --Br Fill in the blanks (in order!) to balance the reaction. Use a "1" if necessary - don't leave any boxes blank. KOH + H3PO4 -> H2O + K3PO4 Blank # 1 A Blank # 2 AV Blank # 3 Blank # 4 AM What is the name of the compound CoF2?
What results when a secondary alcohol is oxidized? a. a ketone d. an acid b. an amine e. no reaction c. an aldehyde Which of the following combinations will react spontaneously? A. 12 + Cu2+ B. Pb2+ + Ag C. Zn2+ + Mg D. Sn2+ + Ni2+ The general formula for a cycloalkane can be represented by which of the following? a. C,H, C. CH b. C.H2n+2 d. C.H21-2 In a certain reaction AH =-136 kJ and E, = 96...