
2. For the following example, identify the following.
H2O(l) → H2O(s)
question 2 options
|
a negative ΔH and a negative ΔS |
|||||||||||||||||||||||||||||||
|
a positive ΔH and a negative ΔS |
|||||||||||||||||||||||||||||||
|
a negative ΔH and a positive ΔS |
|||||||||||||||||||||||||||||||
|
a positive ΔH and a positive ΔS |
|||||||||||||||||||||||||||||||
|
It is not possible to determine without more information. 3. Calculate ΔS°rxn for the following reaction. The S° for each species is shown below the reaction. C2H2(g) + H2(g) →
C2H4(g) Question 4 options:
|
Entropy is degree of disorder. When ever, the solid becomes a liquid, the degree of disorder increases and when ever a liquid becomes a gas also entropy increases. In case of gaseous reaction, entropy increases or decreases depending upon the no of moles of reactants and products. If moles of products are more than moles of reactants, entropy change increases while if the moles of products are less than moles of reactants, entropy change decreases.
For the reaction, CH3OH(l) --->CH3OH(s), entropy change decreases since q liquid is becoming a solid
For the reaction, N2(g)+3H2(g) ---->2NH3(g), the moles of products are less than moles of reactants. So entropy change decreases.
For the reaction, CH4(g)+ H2O(g)---->Co(g)+3H2, moles pf products are more than moles of reactants. So entropy change increases.
For the reaction Na2CO3(s)+H2O(g)+CO2(g)---->2NaHCO3(s)
Moles of gaseous products are more on reactants side. So entropy change decreases.
2. H2O(l)------>H2O(s),a liquuid is converted to solid by removing heat of fusion. Since heat is removed from system, enthalpy change is -ve. Since a liquid becomes solid, entropy change decreases. hence negative deltaH and negative deltaS.
3. For the reaction, C2H2(g)+ H2(g) ------>C2H4(g), entropy change= sum of entropy of products- sum of entropy of reactants
entropy change= 1* entropy of C2H4- (1* entropy of C2H2+1* entropy of H2), 1,1, 1 are coefficients o C2H4, C2H2 and H2 respectively.
=219.3- (200.9+130.7)=-112.3 J/K ( C is correct)
4. Calculate ΔS°rxn for the following reaction. The S° for each species is shown below the reaction.
for the reaction, entropy change= 229.2-( 200.9+2*130.7) =-233.1 J/K ( D is correct)
5.
Calculate the ΔG°rxn using the following information.
2 HNO3(aq) + NO(g) → 3 NO2(g) + H2O(l)
deltaG= 1* deltaG of H2O+3* deltaG of NO2- (2* deltaG of HNO3+1* deltaG of NO)
=-237.1+3*(51.3)- {2*-110.9+1*87.6)
ΔG°f (kJ/mol) -110.9 87.6 51.3 -237.1=51 KJ ( B is correct)
2. For the following example, identify the following. H2O(l) → H2O(s) question 2 options a negative...
Use standard enthalpies of formation (in Appendix G in text) to calculate ∆H°rxn for each reaction. ∑ m∆H°f (products) - ∑n∆H°f (reactants), where m and n are coefficients. C2H4(g) + H2(g) ----- > C2H6(g) CO (g) + H2O (g) ----- > H2(g) + CO2(g) 3NO2(g) + H2O (l) ----- > 2HNO3(aq) + NO (g) 2SO2(g) + O2(g) -----------> 2SO3(g) 2C4H10 (g) + 13O2 (g) -----------> 8CO2 (g) + 10H2O (g) Substance --- ΔH° (kJ mol–) --- ΔG° (kJ mol–1) --- S°298 (J K–1 mol–1) C2H4 52.4 86.4 219.3 H2 0 0 130.7 C2H6 -84.0 -32.0 229.2 CO -110.52 -137.15 197.7 H2O -285.83 -237.1 70.0 CO2 -393.51 -394.36 213.8 NO2 33.2 51.30 240.1 NO 90.25 87.6 210.8 SO2 -296.83 -300.1 248.2 O2 0 0 205.2 SO3 -395.72 -371.06 256.76
A) A reaction has an equilibrium constant of Kp=0.280 at 44 ∘C. Find ΔG∘rxn for the reaction at this temperature. Find for the reaction at this temperature. 3.35 kJ -3.35 kJ 0.404 kJ 0.466 kJ B) Above what temperature does the following reaction become nonspontaneous? FeO(s) + CO(g) → CO2(g) + Fe(s) ΔH= -11.0 kJ; ΔS = -17.4 J/K Above what temperature does the following reaction become nonspontaneous? FeO(s) + CO(g) → CO2(g) + Fe(s) = -11.0 kJ; = -17.4...
Which of the following processes have a ΔS > 0? A) Na2CO3(s) + H2O(g) + CO2(g) → 2 NaHCO3(s) B)CH4(g) + H2O(g) → CO(g) + 3 H2(g) C)CH3OH(l) → CH3OH(s) D)N2(g) + 3 H2(g) → 2 NH3(g) E)All of the above processes have a DS > 0.
Calculate the ΔG°rxn using the following information. 2 HNO3(aq) + NO(g) → 3 NO2(g) + H2O(l) ΔG°rxn = ? ΔH°f (kJ/mol) -207.0 91.3 33.2 -285.8 S°(J/mol∙K 146.0 210.8 240.1 70.0 -151 kJ +50.8 kJ -186 kJ +222 kJ -85.5 kJ
3) Answer all parts of the following question. a. The reaction: Al(s) + Fe2O3(s) → Fe(s) + Al2O3(s) has ΔH = -847.6 kJ and ΔS = -41.3 J/K at 25°C. Calculate ΔG and determine if it is spontaneous. b. Above what temperature does the following reaction become nonspontaneous? FeO(s) + CO(g) → CO2(g) + Fe(s) ΔH = -11.0 kJ; ΔS = -17.4 J/K c. Find ΔSsurr and predict whether or not this reaction will be spontaneous at 398 K. NH3(g)...
Determine ΔG°rxn using the following information. H2(g) + CO(g) → CH2O(g) ΔH°= +1.9 kJ; ΔS°= -109.6 J/K (Hint- What is the temperature when measuring standard heat of energy and change in entropy) Determine the equilibrium constant for the following reaction at 298 K. SO3(g) + H2O(g) → H2SO4(l) ΔG° = -90.5 kJ 7.31 × 1015 0.964 1.37 × 10-16 4.78 × 1011
1. Consider a process at 286 K with ΔH = -72.5 kJ/mol and ΔS = -96.8 J/K mol Which of the following is true? ΔG = -44.8 kJ/mol and the process will not be spontaneous ΔG = +39.4 kJ/mol and the process will be spontaneous ΔG = -44.8 kJ/mol and the process will be spontaneous ΔG = -19.1 kJ/mol and the process will not be spontaneous ΔG = +39.4 kJ/mol and the process will not be spontaneous 2. Consider a...
Metal oxides can be reduced with hydrogen gas to give the metal. H2(g) ZnO(s) H2O(g) +Zn(s) Compound Ha(g) Zno AH(kJ/mol) AG (kJ/mol) S (J/Kemol) 130.7 -348.3 43.6 -318.3 H2O(g) Zn(s) -241.8 188.8 -228.6 41.6 What is the entropy change for the reaction? Errent 13 56.1 J/K 2. -56.1 J/K Cacb180.8)- (u 190.) 3. 404.7 J/K 43.6 J/K 4. Metal oxides can be reduced with hydrogen gas to give the metal. H2O(g) +Zn(s) H2(g)+ZnO(s) AG (kJ/mol) AH (kJ/mol) S(J/Kemol) 130.7 Compound...
Calculate the ΔG°rxn using the following information. 2 HNO3(aq) + NO(g) → 3 NO2(g) + H2O(l) ΔG°rxn = ? ΔG°f (kJ/mol) -110.9 87.6 51.3 -237.1
For each of the following reactions, calculate ΔH∘rxn, ΔS∘rxn, and ΔG∘rxn at 25 ∘C. State whether or not the reaction is spontaneous. If the reaction is not spontaneous, would a change in temperature make it spontaneous? If so, should the temperature be raised or lowered from 25 ∘C? N2(g)+O2(g)→2NO(g) Express your answer using three significant figures. ΔH∘rxn ΔHrxn∘ = 183 kJ SubmitPrevious Answers Correct Part H Part complete Calculate ΔS∘rxn at 25 ∘C. Express your answer to one decimal place....