(CH3)2CH(CH2)3OC(CH3)3

Question

Question

science chemistry

Answer 1

Answer #1

CH3 H H2 H2 H2 CH3 CH3 1-(tert-butoxy)-4-methylpentane

Answer 2

Similar Homework Help Questions

Practice: Give IUPAC names for the following compounds. a. (CH3)3CCH2CH(CH2CH3)2 C. CH3(CH2)2CH(CH2CH2CH3)CH(CH3)2

Practice: Give IUPAC names for the following compounds. a. (CH3)3CCH2CH(CH2CH3)2 C. CH3(CH2)2CH(CH2CH2CH3)CH(CH3)2
1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH...

1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH For the list above I currently put the following as the IUPAC names. If any are wrong can you please correct them! Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 IUPAC Name: 3,3,4-trimethylhexane IUPAC Name: 3-methyl-4-ol-heptane CH3C(CH3)CH2 IUPAC Name: 2-methylpropene CH2O IUPAC Name: methanal CH3CH(NH2)CH3 IUPAC Name: isopropylamine CH3OCH2CH2CH3 IUPAC Name: methoxyethane (ethyl methyl ether) CH(CH3)2COOH IUPAC Name: 2-methylpropanoic acid
convert this formula into Bond-line notation with correct bond angles. (CH3)3CCONH(CH2)2CH(CH2CH3)2

convert this formula into Bond-line notation with correct bond angles. (CH3)3CCONH(CH2)2CH(CH2CH3)2

1:06 Exit (CH3)3C, CH2=CHCH2, CH3CH2, CH3 , (CH3)2CH Label each radical species above as either: methyl,...

1:06 Exit (CH3)3C, CH2=CHCH2, CH3CH2, CH3 , (CH3)2CH Label each radical species above as either: methyl, primary, secondary, tertiary, or allylic. A. [Select ] B. [Select] C. [Select] D. (Select ] E. [Select] Rank the species in order from LEAST stable to MOST stable. [ Select] [ Select] [ Select ]
Gaseous butane (CH3(CH2)2CH) reacts with gaseous oxygen gas (O2) to produce gaseous carbon dioxide (CO2)

Gaseous butane (CH3(CH2)2CH) reacts with gaseous oxygen gas (O2) to produce gaseous carbon dioxide (CO2) and gaseous water (H2O) theoretical yield of water formed from the reaction of 1.7 g of butane and 5.9 g of oxygen gas? what is the Round your answer to 2 significant figures
Write the correct name for each compound below. H3C-CH3: H3C-CH2-CH2-CH2-CH2-CH2-CH2-CH=CH2: H-C≡C-H: H-C-(CH3)3: H3C-CH=CH-CH3:

Write the correct name for each compound below. H3C-CH3: H3C-CH2-CH2-CH2-CH2-CH2-CH2-CH=CH2: H-C≡C-H: H-C-(CH3)3: H3C-CH=CH-CH3:

Which of the following pairs of compounds are isomers? A) CH3 -CH2-O-CH2-CH3 and CH2-0 - CH2-CH3...

Which of the following pairs of compounds are isomers? A) CH3 -CH2-O-CH2-CH3 and CH2-0 - CH2-CH3 CH3 B) 0 CH3-CH2-C- CH3 and CH3 - CH2 - CH2-CH ОН CH3-CH2-CH-OH and CH3 - CH-CH2-CH3 CH3 D) CH3-CH2-CH2-OH and CH3-O-CH3 CH3CH2OH and HC CH3
name the compounds b. CH3 CH3-CH2-CH-CH-CECH CH2-CH3 CH3 CH=C-C-CH3 CH2-CH2-CH3 1 CH3 - CH2 - CH...

name the compounds b. CH3 CH3-CH2-CH-CH-CECH CH2-CH3 CH3 CH=C-C-CH3 CH2-CH2-CH3 1 CH3 - CH2 - CH = CH-CH3
give the compound name = 0 CH3-CHY-CH2-CH2CH3 H3C-CH2-CH3 = H3C-CH2-CH2-CH2CH2-CH3 H2C=CH2 = H-C=C-CH3 = = H3C-CH2-CH2-OH...

give the compound name = 0 CH3-CHY-CH2-CH2CH3 H3C-CH2-CH3 = H3C-CH2-CH2-CH2CH2-CH3 H2C=CH2 = H-C=C-CH3 = = H3C-CH2-CH2-OH = H2C=CH-CH2-CH2-CH3 = H3C-CH2-CH2-CH3 H3C-CH=CH-CH3 = = CH3-OH = CH3-CH2-OH = CH3-CH2-CH2-CH2-OH = CH3-CH-CH2-CH2-CH2-CH3 = 64 CH3-CH2-CH2-CH2-CH-OH = CH3-CH-CH2-CH, = H3C-CH2-C=0 H.C-CH2-CH2-CH2-C=0 HC-OH = H3C-CHCH2-f-OH H,C-CH2-COH

g. Ph-C(O)-NH2 4 NaOH Br2 h. (HC)2CH-C(CHa)2 -> HO N(CH3)3 i. Ph-N2, CI- + CuCN -->...

g. Ph-C(O)-NH2 4 NaOH Br2 h. (HC)2CH-C(CHa)2 -> HO N(CH3)3 i. Ph-N2, CI- + CuCN --> H30* (cat) Na/ETOH j. cyclohexanone+ H2NOH Pd(OAc)2 (1 mole%) k. Ph-I + 4-O2N-C&H4-HC=CH2 Cul/Pd(PPH3)4) L. HO-CH2-CH2-CC-H +1-CH=CH-(CH2)4-CH3