convert this formula into Bond-line notation with correct bond angles. (CH3)3CCONH(CH2)2CH(CH2CH3)2

Question

Question

convert this formula into Bond-line notation with correct bond angles.

science chemistry

Answer 1

Answer #1

Bond line notation gr is a shortcut method to represent Organic molecules In this method c atoms are indicated with lines.

Answer 2

Similar Homework Help Questions

Practice: Give IUPAC names for the following compounds. a. (CH3)3CCH2CH(CH2CH3)2 C. CH3(CH2)2CH(CH2CH2CH3)CH(CH3)2

Practice: Give IUPAC names for the following compounds. a. (CH3)3CCH2CH(CH2CH3)2 C. CH3(CH2)2CH(CH2CH2CH3)CH(CH3)2
1. Write the bond-line formulas for the following compounds: a) (CH3)3CCH2CH(OH)CH3 b) CH2=C(CH2CH3)2

1. Write the bond-line formulas for the following compounds: a) (CH3)3CCH2CH(OH)CH3 b) CH2=C(CH2CH3)2
1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH...

1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH For the list above I currently put the following as the IUPAC names. If any are wrong can you please correct them! Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 IUPAC Name: 3,3,4-trimethylhexane IUPAC Name: 3-methyl-4-ol-heptane CH3C(CH3)CH2 IUPAC Name: 2-methylpropene CH2O IUPAC Name: methanal CH3CH(NH2)CH3 IUPAC Name: isopropylamine CH3OCH2CH2CH3 IUPAC Name: methoxyethane (ethyl methyl ether) CH(CH3)2COOH IUPAC Name: 2-methylpropanoic acid

3.13 For each condensed structural formula, write a line- angle formula: CH2CH3 CH3 CH2CH3 (a) CH3CH2CHCHCH,CHCH;...

3.13 For each condensed structural formula, write a line- angle formula: CH2CH3 CH3 CH2CH3 (a) CH3CH2CHCHCH,CHCH; (d) CH3CH,CCH,CH, CH(CH3)2 CH,CH CH; (b) CH3CCH3 (e) (CH3)3CH CH3 (c) (CH3),CHCH(CH3)2 (f) CH3(CH2):CH(CH3)2
4. Convert the following structures to bond-line notation, using wedges and dashes to convey the correct...

4. Convert the following structures to bond-line notation, using wedges and dashes to convey the correct absolute configuration (i.e. R or S). Et OH CH3 OH CH3 Me
IUPAC Nomenclature 4.39 Give the IUPAC name for each compound. h. tyn my 1. -CH(CH2CH3)2 i....

IUPAC Nomenclature 4.39 Give the IUPAC name for each compound. h. tyn my 1. -CH(CH2CH3)2 i. a. CH3CH2CHCH2CHCH2CH2CH3 CH3 CH2CH3 CH2CH3 CH3 b. CH3CH2CCH_CH2CHCHCH2CH2CH3 CH2CH3 CH2CH3 C. CH3CH,CH,C(CH3)2C(CH3)2CH2CH3 d. CH3CH2C(CH2CH3)2CH(CH3)CH(CH2CH2CH3)2 e. (CH3CH2),CCH(CH3)CH2CH2CH3 f. CH3CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)3CH3 g. (CH2CH2CH2)4C more on mo .

Consider each of the compounds. 1) Draw a large, stable line-angle structure with the correct bond...

Consider each of the compounds. 1) Draw a large, stable line-angle structure with the correct bond angles. 2) Draw all appropriate resonance structures and indicate the major contributor. 3) Indicate all lone pair electrons on the atom. 4) Indicate the hybridization under each atom other than H a) CH2=CHCH(.)CH3 b) CH2=CHCH2CH(+)OH c) CH3CO(-)CH2
Consider each of the compounds. 1) Draw a large, stable line-angle structure with the correct bond...

Consider each of the compounds. 1) Draw a large, stable line-angle structure with the correct bond angles. Do not show the hydrogen atoms. 2) Indicate any formal charge on top of the atom. 3) Indicate all lone pair electrons on the atom. 4) Indicate the hybridization under each atom other than H and Na. a) CH2=CHCH(.)CH3 b) CH2=CHCH2CH(+)OH c) CH3CO(-)CH2
N 2. Complete the chart: CONDENSED FORMULA STRUCTURAL FORMULA NAME CH,CH2CHCHCH(CH3)2 CHC(CH2)SCH,CI (CH3)3CCHCH(CH2)2CHCH2

N 2. Complete the chart: CONDENSED FORMULA STRUCTURAL FORMULA NAME CH,CH2CHCHCH(CH3)2 CHC(CH2)SCH,CI (CH3)3CCHCH(CH2)2CHCH2

Bond-line notation is an efficient representation of molecules that is commonly used by chemists. Molecules represented...

Bond-line notation is an efficient representation of molecules that is commonly used by chemists. Molecules represented in bond-line notation are also known as "skeletal structures," "stick figures," or "line-angle" formulas. For the following molecules shown in bond-line notation, draw the appropriate Lewis structure and write out the correct molecular formula for the compound. The first problem is solved for you as an example. Bond-line notation Lewis structure Molecular formula C, H2 1. 2 3