Homework Answers
Add Answer to:
13 (1 Point) Sulphu dioxide gas forms an acidic solution. The equation showing the predominant species...
a Choose the balanced equation for the following half-reaction, which takes place in acidic solution НВFO,(ag)...
a Choose the balanced equation for the following half-reaction, which takes place in acidic solution НВFO,(ag) —> Вr (aq) 4 8e7H (aq) + HBr04 (aq) -> Br (aq) + 4H20(1) 8e H (aq)HBrO4 (aq) -> Br (aq)4H20() Se + 7H* (ag) + HBFO, (ag) — 2Br (аq) + 4H20() Зе + 7H* (ад) + HBFO4(ag) — Br (aq) + 4H20() b Choose the balanced equation for the following half-reaction, which takes place in acidic solution NO3 (ag) > NО2(9) 3e2H...
1. Which of the following compounds in an aqueous solution is a weak acid? A) H2S...
1. Which of the following compounds in an aqueous solution is a weak acid? A) H2S B) HI C) HBr D) H2SO4 E) HCIO 2. Identify the major ionic species present in an aqueous solution of H2SO4. A) S6, 036-(plus H2O as a neutral species) B) H', OH, 56,302- C) 2H, 56, 402- D) H', HS04 E) 24*, SO42- 3. Which of the following represents an acid-base neutralization reaction? A) 2Al(s) + 3H2SO4(aq) → Al2(SO4)3(aq) + 3H2(g) B) SO2(g) +...
5. Which of the following species is amphiprotic in aqueous solution? (a) CH3NH2 c) NH4 (e)...
5. Which of the following species is amphiprotic in aqueous solution? (a) CH3NH2 c) NH4 (e) HSO (d) F (b) Н:0" 6, Use Table 15.2 (page 529) to decide whether the species on the left or those on the right are favored by the reaction. a. NH4 (aq) + H2PO4" (aq) # NH3(aq) + HsPO b. HCN (aq) + HS(aq) CN" (aq) +H2S c. HCO +OH CO2 H2S d. Al(H20)6 3+ +OH = Al(H20) s2+ OH 7. The equilibrium constant...
Classify HF as a strong or weak acid or base in aqueous solution. Weak base O...
Classify HF as a strong or weak acid or base in aqueous solution. Weak base O Weak acid O Strong acid Strong base Which of the following is the correct molecular equation for the following reaction? HC2H302 (aq) Ba(OH)2 (aq) O 2 H (aq) + Ba(ОН)2 (s) +2 H20 ) +2 C2H302 (aq) +2 C2H302 Ba2+ (aq) (aq) Ba2+ (aq) 2 OH O 2 H(aq)+2 C2H302 (aq) Ba2 (aq) +2 C2H3O2 (aq)+ 2 H20 (aq) (1) +Ba(OH)2 (aq) O 2...
In part B of this experiment carbon dioxide gas was bubbled through a lime water (saturated...
In part B of this experiment carbon dioxide gas was bubbled through a lime water (saturated calcium hydroxide) solution for several minutes. At Step 8 the lime water solution was heated on a steam bath for about three minutes and a precipitate was observed to form. From the options below, which give the equation(s) that accurate explain the observed results? Select one: a. CO2(aq) + CO2(g) then CO2(aq) + Ca2+ (aq) + 2H0- (aq) = CaCO3(s) + H20(aq) O b....
1. Which of the followi ch of the following reactions is not readily explained by the...
1. Which of the followi ch of the following reactions is not readily explained by the Arrhenius concept of acids and bases? a. A. HCl(aq) + NaOH(aq) - NaCl(aq) + H20() b. H30(aq) + OH-(aq) + 2H20(1) c. HCI(g) + NH3(g) - NH4Cl(s) d. HC2H302(aq) + H2O(l) H30*(aq) + C2H302-(ag) e. H30 (aq) + OH-(aq) + 2H2O(aq) 2. Classify each of the following species as Brønsted acid or base or both: a) H20, b) OH", c) H30, d) NH3, e)...
1. Which of the followi ch of the following reactions is not readily explained by the Arrhenius concept of acids a...
1. Which of the followi ch of the following reactions is not readily explained by the Arrhenius concept of acids and bases? a. A. HCl(aq) + NaOH(aq) - NaCl(aq) + H20() b. H30(aq) + OH-(aq) + 2H20(1) c. HCI(g) + NH3(g) - NH4Cl(s) d. HC2H302(aq) + H2O(l) H30*(aq) + C2H302-(ag) e. H30 (aq) + OH-(aq) + 2H2O(aq) 2. Classify each of the following species as Brønsted acid or base or both: a) H20, b) OH", c) H30, d) NH3, e)...
Question 1 (1 point) Reaction of chromium metal with phosphoric acid produces chromium(lI) phosphate and hydrogen gas....
Question 1 (1 point) Reaction of chromium metal with phosphoric acid produces chromium(lI) phosphate and hydrogen gas. Select the correct balanced equation O2Cr(s)+2H3PO4laq)-- 2CrPO4(s)+6H(g) O2Cr(s)+2H3PO4laq)--2CrPO4(s)+3H2(g) O3Cr(s)+3H3PO4(aq)--Cr3(PO4]3(s)+3 H2{g) O2Cr(s)+2H3PO3(aq)--2CrPO3(s)+3H2(g) Question 2 (1 point) Methane gas (CH4) reacts with steam (H20 (g)) to produce hydrogen gas and carbon monoxide gas. Select the correct balanced equation. OCHalg) +H20(g) -- 6H(g)+CO(g) O2CH4(8)+H20(g)- 3H2(g)+2CO(g) OCH4(8) +H20(g) - 3H2(g)+CO(g) OCH4(8) +2H208)-- 4H2{g)+CO2{g) Question 3 (1 point) When the following equation is balanced using the smallest possible...
What is acidity and what are the compounds controlling it? Acidity is a measure of the...
What is
acidity and what are the compounds controlling it?
Acidity is a measure of
the concentration of hydrogen ions (H+ or protons) in a solution. We
use pH (potential of H+) as a scale of acidity and this can be
calculated as below:
pH =
-log10[H+] =
log10
(1/[H+])
Q1. Figure 10.3 shows you a range
of pH in some common liquids. Pick 2 liquids (one each from acidic
and basic solutions) and compare the molarity of
[H+] in...
Express your chemical equation: 13.HBr(aq)+Al(OH)3(s)→ 13.1 HI(aq)+CaCO3(s)→ 14. H2SO4(aq)+NaOH(s)→ (neutralization of both acidic protons) 14.1 HBr(aq)+LiOH(s)→...
Express your chemical equation: 13.HBr(aq)+Al(OH)3(s)→ 13.1 HI(aq)+CaCO3(s)→ 14. H2SO4(aq)+NaOH(s)→ (neutralization of both acidic protons) 14.1 HBr(aq)+LiOH(s)→ 18. CO(g)+H2O(g)⇌H2(g)+CO2(g) K=[CO2][H2][CO][H2O] K=[CO][H2O][CO2][H2] K=[CO2][H2][CO][H2O] K=[CO2][H2][CO] 18.1 CH3COOH(aq)+H2O(l)⇌H3O+(aq)+CH3COO−(aq) K=[CH3COOH][CH3COO−][H3O+] K=[CH3COO−][H3O+][CH3COOH] K=[CH3COO−][H3O+][CH3COOH] K=[CH3COO−][H3O+][CH3COOH][H2O] 19. N2(g)+3Br2(g)⇌2NBr3(g) K=[NBr3][N2][Br2] K=[NBr3]2[N2][Br2]3 K=[N2][Br2]3[NBr3]2 K=[NBr3]2[N2][Br2]3 19.1 C(s)+O2(g)⇌CO2(g) K=[O2][CO2] K=[CO2][O2] K=[CO2][O2][C] K=[CO2][O2]
a Choose the balanced equation for the following half-reaction, which takes place in acidic solution НВFO,(ag) —> Вr (aq) 4 8e7H (aq) + HBr04 (aq) -> Br (aq) + 4H20(1) 8e H (aq)HBrO4 (aq) -> Br (aq)4H20() Se + 7H* (ag) + HBFO, (ag) — 2Br (аq) + 4H20() Зе + 7H* (ад) + HBFO4(ag) — Br (aq) + 4H20() b Choose the balanced equation for the following half-reaction, which takes place in acidic solution NO3 (ag) > NО2(9) 3e2H...
1. Which of the following compounds in an aqueous solution is a weak acid? A) H2S B) HI C) HBr D) H2SO4 E) HCIO 2. Identify the major ionic species present in an aqueous solution of H2SO4. A) S6, 036-(plus H2O as a neutral species) B) H', OH, 56,302- C) 2H, 56, 402- D) H', HS04 E) 24*, SO42- 3. Which of the following represents an acid-base neutralization reaction? A) 2Al(s) + 3H2SO4(aq) → Al2(SO4)3(aq) + 3H2(g) B) SO2(g) +...
5. Which of the following species is amphiprotic in aqueous solution? (a) CH3NH2 c) NH4 (e) HSO (d) F (b) Н:0" 6, Use Table 15.2 (page 529) to decide whether the species on the left or those on the right are favored by the reaction. a. NH4 (aq) + H2PO4" (aq) # NH3(aq) + HsPO b. HCN (aq) + HS(aq) CN" (aq) +H2S c. HCO +OH CO2 H2S d. Al(H20)6 3+ +OH = Al(H20) s2+ OH 7. The equilibrium constant...
Classify HF as a strong or weak acid or base in aqueous solution. Weak base O Weak acid O Strong acid Strong base Which of the following is the correct molecular equation for the following reaction? HC2H302 (aq) Ba(OH)2 (aq) O 2 H (aq) + Ba(ОН)2 (s) +2 H20 ) +2 C2H302 (aq) +2 C2H302 Ba2+ (aq) (aq) Ba2+ (aq) 2 OH O 2 H(aq)+2 C2H302 (aq) Ba2 (aq) +2 C2H3O2 (aq)+ 2 H20 (aq) (1) +Ba(OH)2 (aq) O 2...
In part B of this experiment carbon dioxide gas was bubbled through a lime water (saturated calcium hydroxide) solution for several minutes. At Step 8 the lime water solution was heated on a steam bath for about three minutes and a precipitate was observed to form. From the options below, which give the equation(s) that accurate explain the observed results? Select one: a. CO2(aq) + CO2(g) then CO2(aq) + Ca2+ (aq) + 2H0- (aq) = CaCO3(s) + H20(aq) O b....
1. Which of the followi ch of the following reactions is not readily explained by the Arrhenius concept of acids and bases? a. A. HCl(aq) + NaOH(aq) - NaCl(aq) + H20() b. H30(aq) + OH-(aq) + 2H20(1) c. HCI(g) + NH3(g) - NH4Cl(s) d. HC2H302(aq) + H2O(l) H30*(aq) + C2H302-(ag) e. H30 (aq) + OH-(aq) + 2H2O(aq) 2. Classify each of the following species as Brønsted acid or base or both: a) H20, b) OH", c) H30, d) NH3, e)...
1. Which of the followi ch of the following reactions is not readily explained by the Arrhenius concept of acids and bases? a. A. HCl(aq) + NaOH(aq) - NaCl(aq) + H20() b. H30(aq) + OH-(aq) + 2H20(1) c. HCI(g) + NH3(g) - NH4Cl(s) d. HC2H302(aq) + H2O(l) H30*(aq) + C2H302-(ag) e. H30 (aq) + OH-(aq) + 2H2O(aq) 2. Classify each of the following species as Brønsted acid or base or both: a) H20, b) OH", c) H30, d) NH3, e)...
Question 1 (1 point) Reaction of chromium metal with phosphoric acid produces chromium(lI) phosphate and hydrogen gas. Select the correct balanced equation O2Cr(s)+2H3PO4laq)-- 2CrPO4(s)+6H(g) O2Cr(s)+2H3PO4laq)--2CrPO4(s)+3H2(g) O3Cr(s)+3H3PO4(aq)--Cr3(PO4]3(s)+3 H2{g) O2Cr(s)+2H3PO3(aq)--2CrPO3(s)+3H2(g) Question 2 (1 point) Methane gas (CH4) reacts with steam (H20 (g)) to produce hydrogen gas and carbon monoxide gas. Select the correct balanced equation. OCHalg) +H20(g) -- 6H(g)+CO(g) O2CH4(8)+H20(g)- 3H2(g)+2CO(g) OCH4(8) +H20(g) - 3H2(g)+CO(g) OCH4(8) +2H208)-- 4H2{g)+CO2{g) Question 3 (1 point) When the following equation is balanced using the smallest possible...
What is
acidity and what are the compounds controlling it?
Acidity is a measure of
the concentration of hydrogen ions (H+ or protons) in a solution. We
use pH (potential of H+) as a scale of acidity and this can be
calculated as below:
pH =
-log10[H+] =
log10
(1/[H+])
Q1. Figure 10.3 shows you a range
of pH in some common liquids. Pick 2 liquids (one each from acidic
and basic solutions) and compare the molarity of
[H+] in...
Most questions answered within 3 hours.
-
Where is the error in this code sequence?
String s1 = "Hello";
String s2 = "ello";...
asked 10 months ago -
Financial data for Joel de Paris, Inc., for last year
follow:
Joel de Paris, Inc.
Balance...
asked 10 months ago -
Consider this reaction:
Al2(SO4)3 (aq)+ BaCl3
(aq) Al2Cl6 (aq)- +
3BaSO4(s) . What is the...
asked 10 months ago -
Suppose that Savneet is considering increasing her
recent random sample from 20 car rentals to 40...
asked 10 months ago -
Trucks arrive at an unloading terminal at an average rate of 120
per hour.
Trucks arrive...
asked 10 months ago -
Why are methanol and ethanol completely soluble in water while
octanol is not very little soluble....
asked 10 months ago -
A facilities manager at a university reads in a research report
that the mean amount of...
asked 10 months ago -
When the CuSO4 is rehydrated by adding water to the anhydrous
compound, is this an endothermic...
asked 10 months ago -
A ray of sunlight is passing from diamond into crown glass; the
angle of incidence is...
asked 10 months ago -
A block of mass 0.249 kg is placed on top of a light, vertical
spring of...
asked 10 months ago -
how do the kidneys compensate in the presences of acidosis
a) trigger hyperventilate
b) reserve acid...
asked 10 months ago -
Question 501 pts
The rental rate of capital to the firm increases. Which of the
following...
asked 10 months ago