We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Identify structural difference(s) between cholesterol and testosterone. OH CH CH . CH CH3 ** HO Cholesterol...
how does the structure on thr bottom left have 2 stereocenters? I
see both Carbons in the CH3 being bonded directly to a H, -CH2 and
another -CH3. i do not see how there are 4 different groups that
each chiral carbon is attached to
os structures are show cand trans molecules srent sequence of groups ul (CH3) group and les initially, a-CH- ction gives, initially, a aded to four different 1,2-Disubstituted Cyclohexanes Now consider 1,2-dimethylcyclohexane. The cis and trans...
HO CH сн. CH2 нс HC CH3 HAC-HC CH CH CH CH d) OH OH 13. The labels have fallen off three bottles. Bottle A contains a gas, bottle B contains a liquid, and bottle C contains a solid. The labels indicate that the compounds have the same number of carbon atoms, one being an alkane, one an alcohol, and the other a carboxylic acid. Suggest the identity of the contents of each bottle, and give reasons for your explanation...
Name: Doom! CH3 Part 2: Isomers - Pairs of compounds. Structural Isomers: 1. Use your model kit and build both of these structure. CH3 CH3-CH2-CH2 CH3-CH-CHE A. B. 1 What is the molecular formula for compound A? What is the molecular formula for compound B? - Without breaking any bonds, is it possible to convert A into B? Would the two compounds have identical properties?! What is the IUPAC name for compound A? What is the IUPAC name for compound...
QUESTION 4 Which of the following is the main structural difference between molecules of fats & oils vs. laboratory margarine. a. Each carbon atom in fats and oils has a total of 3 bonds, whereas each carbon atom in margarine has a total of 4 bonds. b. Each carbon atom in fats and oils has a total of 4 bonds, whereas each carbon atom in margarine has a total of 3 bonds. c. Fats and oils have more carbon-carbon single...
nstitutional Isomer #5 Molecular Formula: CsH200, Calculate Units of Unsaturation Structural Hints for isomer A: 1) 5-membered ring 2) Must have a Weak acid group 3) Only 3 methylene fragments that are connected to one methine fragment in this molecule Structural Hints for isomer B: 1) One Triple bond 2) 3 equivalent methyl groups Draw Isomer A Draw Isomer B Constitutional Isomer Molecular Formula: C8H240, Calculate Units of Unsaturation Structural Hints: 1) Only 4 methyl groups 2) Only 1 methylene...
Question 3 5 pts Identify the class of lipid to which the following molecule belongs. CH2-0-C-(CH)6- (CH2-CH=CH2-CH2) -CH, CH-0-C-(CH2),CH=CH-(CH2)7 – CH3 CH2 –0-C-(CH), –(CH2 -CH=CH), –CH2 –CH; phospholipid fatty acid wax triglyceride Identify the class of lipid to which the following molecule belongs.. CH2 -0-C-(CH2) 16CH; CH-0-C-(CH)-CH=CH(CH2)-CH, O = CH,-o-P-0-(CH)-N(CH) triglyceride fatty acid wax phospholipid We were unable to transcribe this imageQuestion 13 5 pts A saturated fatty acid is a fatty acid chain in which a carbon chain has...
Key for Bonds: - single bond = double bond = triple bond Name the constitutional (structural) isomer for each compound below. Include conformer names where appropriate. 1. (CH3)2CH-CH2-CH2-CH3: 2. CoH12 (ring, most stable conformer): 3. C&H12 (terninal alkene): 4. C+H10 (C-C-C-C dihedral angle=60): 5. H3C-CH3 (H-C-C-H dihedral angle=0);
Select the molecules that contains sphingosine. CH2 CH2 CH2 CH2 CH2 CH2 CH3 HO-CH-CH=CH2 CH2 CH2 CHỊ CH2 CH2 CH2 — OCH CHO CH NH C H 2 CH2 CH2 CH2 CH, CH2 CH, Molecule B Moleculec sphingomyelins phosphatidylcholine Molecule A CH NH C CH CH, CH2 CH2 CH2 CH2 CH2 CH2 CH2 CH CH2-O-P-O-CH2-CH2-NCH CH3 Molecule A CH(CH2)4-C-0-CH CH(CH) --0-CH NH CHE-O-P-O-CH2-HC COO Molecule B O CH2-0-HC CH(CH2)---NH-CH Сн-он CH(CH3)2 -CH=CH Molecule C 0-0-1 0-0-1
HELP
Other Nether What is the TUPAC name of the following compound? -CH3 a) 3-Bromo-2-methylcyclohexene 2-Bromo-1-methylcyclohexene b) 1-Bromo-2-methyl-2-cyclohexene d) 6-Bromo-1-methylcyclohexene 9. Carbon-carbon double bonds do not freely rotate like carbon-carbon single bonds. Why? a) The double bond is much stronger and thus more difficult to rotate b) Overlap of the two 2p orbitals of the pi bond would be lost c) The shorter bond length makes it difficult for the attached groups to rotate past each other. d) Overlap of...
answer the problem show work thanks
CH3 H2O + 1. H-C-CH-CH-CH2 CH3 CH C 2, CHy-CH2-CH-CHOHPCC 25°C 50-55°C + HNO H2SO4 он H2CrO4 CH,CHCH acetone, 35°c Et O 2150113H20 5. CH3(CH2)2MgBr+ CH3(CH2)sC(CH2)sCH3 Nall CH2-CHCH2l H2SO4 140°C 6. CH3CH2CH2OH 7. CHCH CHOH 1) LiAIH(O-t-Bu)3,-78°C 2) H20 8. CH,C-CI HBr 9. CH2 CH-CH-CH2 40°C 10. H3C CIH2 Benzene 100℃ H3C 1. LiAIH/Et2O 11. CH,CH2CH,COH 2. H,0 12. + CH,CH,cCI AIC Benzene, 80°C 13. Br2 heat CH3 AlcI 15. 25°C conc. H2SO4 NaBH4...