We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
I am having trouble is this correct? CH 3a) Provide the definition for a fatty acid...
How is this molecule classified? НО НО ОН ОН ОН O prostaglandin fatty acid Osphingosine steroid glycerophospholipid The hydrolysis of an unknown lipid produces one glycerol molecule, two stearic acid molecules, choline, and an (unspecified) anion. What kind of lipid was the unknown? O a wax O a triacylglycerol O a glycerophospholipid O a fatty acid O a sphingomyelin What is the correct number for the ketone functional group in this structure? CH, NH, НО CH, | / NH7 Н-...
1. Draw the structure of tripalmitin, the triacylglycerol made from glycerol and palmitic acid. CH2-OH CH-OH CH2-OH palmitic acid glycerol 2. Draw the structure of the product when linolenic acid has been completely halogenated with bromine (Bra). linolenic acid 3. Three fats, labeled X, Y, and Z, were analyzed for double bond content and found to have "iodine numbers" of 78, 147, and 180, respectively. Which of the fats was the most saturated?
What are the products when the following triglyceride undergoes saponification with NaOH? 11.1 CH20-C-(CH)12CH3 CHOC-(CH214CH3 CH20C (CH)CH CH(CH2)-CH 11.2 Write an equation for the full hydrogenation of a triglyceride containing glycerol, oleic acid, linoleic acid, and palmitic acid. How many moles of H2 are required to completely hydrogenate one mole of this triglyceride? 11.3 A drug called RU486 has the following structure: CH3 CH CH3 он CEC-CH3 RU486 a. How is the structure of RU486 similar to that of progesterone?...
7. Draw the structure of a wax formed from a 30-carbon straight chain alcohol and each carboxylic acid a. lauric acid b. myristic acid c. CH(CH3),COOH 8. What hydrolysis products are formed when each wax is treated with aqueous sulfurie acid? a. CH (CH)COO(CH2)2CH. b. CH:(CH2)24COO(CH2CH, c. CH(CH3)COO(CH2).CH; 9. Draw a triacylglycerol that fits each description: a. A triacylglycerol formed from two molecules of lauric acid and one molecule of palmitic acid b. A polyunsaturated triacylglycerol formed from three molecules...
4. Write out the 10 structure for the following polypeptide: он он HyN-CH-C-N-CH-C-N-CH-COO CH2 CH-OH CH C-NH2 CH3 COO 5. Illustrate the possible 2° structure interactions in the following polypeptide: R. 6. Identify the type of 3° structure interaction that will occur between the following pairs of amino acids: a) Aspartic acid and lysine b) Serine and tyrosine c) Leucine and valine d) Cysteine and cysteine 7. Draw out the products of the hydrolysis of the following polypeptide: HsN CH-C-N-C-C-N-C-C-N-CH-C-N-CH-COo...
Atter Complete this reaction of a carboxylic acid with a strong base. reaction: CHCOOH + OH-CH,COO -+H,0 Insert charges where appropriate for this generic carboxylic acid salt. Select Draw Rings Groups More Erase Draw the products of the hydrolysis. Select Draw Rings More 190 O=O Hac CH3 OH-
OH + CH₃ -CH₂-OH c. benzoic acid 9. Draw the line-angle formula for the ester formed in each of the following reactions: 10. Write the IUPAC and common names, if any, of the carboxylic acid and alcohol needed to produce each of the following esters: H-C-0-CH, CH; -CH2-C-0-CH-CH CH 0 CH-CH-CH2-C-0--CH-CH:
just complete 8-10 please
coo CH3 CH2 H CH H H HN-c-c-N-C-C-N-C-C-N-C-Coo H OH OH OH 1. How many amino acid residues are in this structure? 2. How many peptide bonds are in this structure? 3. What is the name of the C terminal residue? 4. What is the one-letter abbreviation of the N-terminal residue? 5. What is the sequence, given in three-letter code, of this peptide? 6. Circle one peptide bond. 7. Circle one alpha-carbon. 8. What is the...
answer1 and 2 please
1) Draw the patty acid 18:14 CH2-O-C-(CH2) 10 CH₃ Slyc a) Sponification of zu the triglyceride shown below produces soap. Complete Rxn hy drawing products. 요 CH₂-O-C-(CH2), CH₃ (CH2) 10 CH3 1 E. + excess Naolt CH-0-€ C ICITU 0) Jungs to Tissues
Question 14 4 pts For the following fatty acid molecules, which of the following is correct? Oleic acid CH-(CH2)-CH=CH(CH2),COOH Lauric acid CHECH COOH Arachidonic acid CH3(CH2).CH=CHCH2CH=CHCH2CH=CHCH2CH=CH(CH3),COOH Stearic acid CH-(CH2)76COOH Linoleic acid CH(CH2).CH=CHCH2CH=CH(CH2),COOH Oleic acid is a polyunsaturated fatty acid and lauric acid is a saturated fatty acid. O Both oleic acid and arachidonic acid are polyunsaturated fatty acids. Lauric acid is a saturated fatty acid and arachidonic acid is a polyunsaturated fatty acid. O Both lauric acid and stearic acid...