1. Which is the most electronegative element in 2-bromoethanol (BrCH2CH2OH)?
2.


1. Which is the most electronegative element in 2-bromoethanol (BrCH2CH2OH)? 2. Identify a carbon that is...
In each of the following groups, which element is the most electronegative? Which is the least electronegative? (Give the element symbol as your answer.) most electronegative least electronegative (a) F, Na, Br (b) Mg, Ca, Rb (c) N, Br, S
Identify the letter of choice that best completes the
statement or answers the question. PLEASE ANSWER ALL! Thank
you!
Part I. Multiple Choice Identify the letter of the choice that best completes the statement or answers the question (2 points each). 1. Which atomic orbitals overlap to form the carbon-carbon o bond and bond of ethylene, HC-CH2? a. o: sp + sp, and sp?+ sp c. 0:sp+ sp, and spi+sp? b. o: sp + sp, and p+p d. o: sp+sp',...
Which of the following compounds is the strongest carbon acid (which has the most acidic H's) ? CH2-C-CH2-NO CH-C-CH,-CH 11. CH2-CH-CH2-N-CH, IV NC-CH CH2-NO CH3 Select one: C. I D. IV
5. According to periodic trends, which element is the most electronegative? A. Ne B. O C. F 6. What is the electron group (EG) and molecular geometry (MG) of an ammonia molecule? A. (EG) tetrahedral and (MG) tetrahedral B. (EG) tetrahedral and (MG) trigonal pyramidal C. (EG) tetrahedral and (MG) bent
for question 19 can you explain why you picked the reagents you
did?
Sterist CH; HC CHH; CCH; - CC CH trans vinylic anion more stable anion able cis vinylic a less stab electron repulsion cis radical anion less stable Hical anion is more stable than the cis radical anion, because the nonbonded electrons are farther apart i The trans vinylic anion is more stable than the cis vinylic anion, because the relatively bulky alkyl group in the trans isomer...
Which species contains a labeled carbon that is sp^2 hybridized?
Please draw lewis structures of each species
3) Which species contains a labelled carbon that is sp2 hybridized? Note that non-bonding electrons have not been drawn in! CH2 (a) 1 only (b) 2 only (c) 3 only (d) Both 1 and 2 (e) Species 1, 2 and 3
1. Which is a true statement about amino acids? a. They are amphiprotic b. The a-carbon has an ester attached c. They are symmetrical d. They are planar e. The α-carbon has a phosphate group attached 2. Which is an incorrect statement regarding the side chains of amino acids? a. Tryptophan, tyrosine, and phenylalanine contain an aromatic group. b. Isoleucine, and leucine are isomers of each other. c. Lysine and methionine contain an amine group. d. Threonine, serine, and tyrosine...
Using the definition of oxidation
states of carbon, which range from –4 to +4, write the number for
the oxidation state of each carbon in the structures below.
(Professor states that oxidation states of carbon is # of
bonds to more electronegative atoms - # of bonds to less
electronegative atoms)
Oxidation state: A =
B =
C =
D = E =
CH2-OH H-C-CI CHCl3 HEC-CH2-BH, A B C D E
please answer all
40. Which is the correct IUPAC name for "isobutyl alcohol?" a) 1-butanol c) 2-butanol b) 2-methyl-1-propanol d)2-methyl-2-propanol e) none of these 41. In a phenol, which group is the substituent on the benzene ring? a) fluoro b) hydroxyl c) sulfhydryl d) carbonyl e ) carboxyl H,C-CH2OH 42. Which is the correct IUPAC name for this compound? HyC-CH-CH2-CH-CH, a) 2-ethyl-4-pentanol c) 4-ethyl-2-pentanol b) 3-methyl-5-hexanol d) 4-methyl-2-hexanol 43. Identify the electron group geometry at each of the carbon atoms...
Question 3 5 pts Identify the class of lipid to which the following molecule belongs. CH2-0-C-(CH)6- (CH2-CH=CH2-CH2) -CH, CH-0-C-(CH2),CH=CH-(CH2)7 – CH3 CH2 –0-C-(CH), –(CH2 -CH=CH), –CH2 –CH; phospholipid fatty acid wax triglyceride Identify the class of lipid to which the following molecule belongs.. CH2 -0-C-(CH2) 16CH; CH-0-C-(CH)-CH=CH(CH2)-CH, O = CH,-o-P-0-(CH)-N(CH) triglyceride fatty acid wax phospholipid We were unable to transcribe this imageQuestion 13 5 pts A saturated fatty acid is a fatty acid chain in which a carbon chain has...