
2. please explain the process of each question
3. please show the oxidation of isobutanol
2. please explain the process of each question 3. please show the oxidation of isobutanol 2....
(1) Show the product of each alcohol oxidation reaction below: OH Croz H30", acetone PCC CH2Cl2 OH Cr₂O, OH H.SO 4, H2O PCC HO CH2Cl2 Nag H2S04, H20 (2) Propose an efficient synthesis for each transformation below mocow OH НО? .name مل.بلو HO / تم.-م" (E) Ph amion e no (F) OMe
Draw a structural formula for the major product of the reaction shown. CH3CH2 S=CHCH2 The CH3CH2 Draw a structural formula for the major product of the reaction shown. CH3 CH3CHCH=CH2 Draw a structural formula for the major product of the reaction shown. Cl2 CH3CH2CH2CH=CH2 - H2O Draw structural formulas for all alkenes that could be used to prepare the alcohol shown below by oxymercuration. H3COH , 1. Hg(OAc)2, H2O 2. NaBH4 Draw the structure of the major organic product of...
Supply products or reagents. If more than
one organic product forms, you must write both products. If stereo-
or regiochemistry is important, you must show that. Incorrect
regio- or stereochemistry will not receive credit. If no reaction
is possible, write N.R.
Please Help with letters E,F,G, and H
Thank you
peroxidesh heat or ho t Jn 9. CH3CH2CH2CH2CHO CrO3» C. w Hoso a. a CECH 3,3-dimethylbut-1-yne cat. HgSO4 H2SO4, H20 cat. Os04 NMO 1.BH3-SMez M 2. H2O2, NaOH (CH3)3 SICI...
Question 47 What is the major organic product of the reaction shown? CH3-(CH3 -COOH + CH3-CH-CH3 - > ??????? OH Question 47 options: OH CH3-(CH2)3-2-0-CH-CH2-CH3 CH3C(CH3)3-CH CH-(CH3)2 CH3-(CH2)2-2-0-C-(CH3)2 CH3-(CH2) 3-2-0-CH-(CH3)2 CH3CH2CH2CH2OCH2OCH(CH3)2
for f - j draw structures pls help with #1 as well
f) 4-methyl-2-pentene 9) trans-8-ethyl-3-undecen h) E-5-bromo-4-chloro-7,7-dimethyl-4-undecene i) Z-1,2-difluoro-cyclohexene i) 4-ethenylcyclohexano Predict the major organic product or products of each of the following reactions. a) (CH3),CHCH-CH: H2SO4 HO b) (CH3),CHCH-CH, 1. Hg(OAc), H20 2. NaBH4 1. BH-THF c) (CH3),CHCH-CH2 2. H,O, NaOH
see Vitc lab 2. The chromium oxidation of compound I below yields a mixture of products (II- V). Identify the order of elution that would occur if you used an alumina stationary phase with diethyl ether to separate the mixture of products (II, III, IV, V) by column chromatography. (Assume there is no starting material in the products.) (a) Write balanced redox reactions for the reaction of K Cr O, with I to give each of the products. Starting material...
Please answer all 3 and explain if you can! Thank you!!
*This one isn't option 2 or 4*
Draw the major organic products of the following reaction. Include lone pairs of electrons and stereochemistry 1.CH,MgBr, Et,o 2. H,O What is the major product in the following series of reactions? 1) 03 then DMS 2) LiAIH4 (excess) then H20 3) NaH (1 equiv.) 4) TsCl (1 equiv.) 5) NaOH (dilute) Products OTS a) b) HO HO OTS он OH c) d)...
3. Complete each of the following reactions. Draw the structure of the organic product or products in the space provided. Show stereochemistry if appropriate. (3 points each) SN2 reaction (a) (CH3)CHCH2Cl + NaCN Sn1 reaction (b) (CH3)CHCH,CI + NaCN (C) M Sn2 reaction ¢l + NaOH - ACH. E1 reaction (d) (CH3)3CCH,OH + HCI major product Ez reaction Cl + NaOH - LCH3 н Ereaction Cl + H20
Insert page Down Backspace End 5. Draw structural formulas for the major organic products of each reaction: H.CO Meso,cl, pyridine OH - PCC SOCI,, pyridine HCI HO+ Pinacol rearr. H2O+ Name THEMU POPQUIZ 7A Chapter 13 CHEM 12A EVC -TULTIPL 1. How m 5. Draw structural formulas for the major organic products of each reaction: V 0 TO 2. Which environme H.CO. MeSo,Cl, pyridine PCC 3. What is ce SOCI. pyridine Whicho HCI HO+ Pinacol rearr. H307 OH HIO,
16A) (2 pts each) Show the expected products. 1) BH, - THE 2) H2O2, NaOH 3) PCC/CH2Cl2 i. 1) NaCN BI C-H 2) H' workup ii. HO/H СН3 CH; iii.