For the following reaction:
NiO2(s) + 4 H+(aq) + 2 Ag(s) → Ni2+(aq) + 2 H2O(l) + 2 Ag+(aq) ℰ° = 2.48 V
Calculate the pH of the solution if ℰ = 2.39 V and
[Ag+] = [Ni2+] = 0.029 M. (See this
table.)

For the following reaction: NiO2(s) + 4 H+(aq) + 2 Ag(s) → Ni2+(aq) + 2 H2O(l)...
For the following reaction: NiO2(s) + 4 H+(aq) + 2 Ag(s) → Ni2+(aq) + 2 H2O(l) + 2 Ag+(aq) ℰ° = 2.48 V Calculate the pH of the solution if ℰ = 2.09 V and [Ag+] = [Ni2+] = 0.045 M. (See this table.)
Consider the following reaction. Mg(s)+2Vo; (aq)+ 4 H* (aq)Mg2+(ag)+ 2 VO2 (aq)+ H2O(l) Ecell 3.37 V. Part A Calculate the AGo for the reaction. Express your answer to three significant figures.
Consider the following reaction. Mg(s)+2Vo; (aq)+ 4 H* (aq)Mg2+(ag)+ 2 VO2 (aq)+ H2O(l) Ecell 3.37 V. Part A Calculate the AGo for the reaction. Express your answer to three significant figures.
Consider a cell based on the following reaction: GeO(s) + H2O(l) + 2 Ag+(aq) → GeO2(s) + 2 H+(aq) + 2 Ag(s) If [Ag+] = 1 M, at 25°C pH = (E - E°)/0.0592 V. pH = 2(E - E°)/0.0592 V. pH = 2(E° - E)/0.0592 V. pH = (E° - E)/0.0592 V.
A voltaic cell is constructed from an Ni2+ (aq) -Ni(s) half-cell and an Ag+ (aq)- Ag(s) half-cell. The initial concentration of Ni2+ (aq) in the Ni2+ - Ni half-cell is [Ni2+1 = 1.80x10-2 M. The initial cell voltage is +1.13 V. Part A By using data in Table 20.1 in the textbook, calculate the standard emf of this voltaic cell. V AEQ ? E V Submit Request Answer Part B. Will the concentration of Ni2+ (aq) increase or decrease as...
Consider the following reaction and its AG at 25.00 °C. Mg(s) + Ni2+ (aq) Mg2+ (aq) + Ni(s) AG = -408.0 kJ/mol Calculate the standard cell potential, Ecell for the reaction. 2.11 V Enter numeric value Calculate the equilibrium constant, K, for the reaction. K= 3.30 x1071 Incorrect
For the cell Ni(s) Ni2+(aq) || Ag+(aq) Ag(s), the standard cell potential is 1.03 V. A cell using these reagents was made, and the observed potential was 0.80 V at 25°C. What is a possible explanation for the observed voltage? The volume of the Agt solution was larger than the volume of the Ni2+ solution. The Agt concentration was larger than the Ni2+ concentration. The Ag electrode was twice as large as the Ni electrode. The Ni2+ concentration was larger...
1) Given the reaction Cd(s)+Ni2+(aq)------>Cd2+(aq)+Ni(s) Calculate the equilibrium constant (K). Ecell of +0.350 V and at 25.0 celsius 2)If 75.0mL of 0.195 M Hbr is combined with 75.0mL of 195M Ca(OH)2 at 25.0 celsius calculate the pH of this solution
Delete water and hydroxide where it is not needed and add in the appropriate coefficients. NiO2(s)+H2O(l)+OH-(aq)+e- ----> Ni(OH)2(s)+H2O(l)+OH-(aq) Express the reduction as a chemical equation including phases and electrons.
A voltaic cell is made from Ni(s), Ni2+(aq), Ag(s) and Ag+
a. Fill in the diagram with the chemicals associated with each
part of the cell.
b. Write a balanced cell reaction
A voltaic cell is made from Ni(s), Niz*(aq), Ag(s) and Ag 7. a. Fill in the diagram with the chemicals associated with each part of the cell. Ni2+ + 2 e-→ Ni(s) Ag+ + e-→ Ag(s) -0.25 0.80
1) Calculate the OH- concentration at equilibrium in the following reaction: NH3 (aq) + H2O (l) -> NH4+ (aq) + OH- (aq) (Kb = 1.8 x10^(-5). (a) 1 x10^(-14) M (b) 2.7 x10^(-3) M (c) 7.2 x10^(-6) M (d) None of the above 2) Which of the following pH values indicates the most basic solution? (a) pH=12 (b) pH=4 (c) pH=8 (d) pH=9 3) Which of the following pH values indicate the most acidic solution? ( (a) pH=11 (b) pH=2...