Delete water and hydroxide where it is not needed and add in the appropriate coefficients. NiO2(s)+H2O(l)+OH-(aq)+e-...
Delete water and hydroxide where it is not needed and add in the appropriate coefficients.
NiO2(s)+H2O(l)+OH-(aq)+e- ----> Ni(OH)2(s)+H2O(l)+OH-(aq)
Express the reduction as a chemical equation including phases and electrons.
Homework Answers
Add Answer to:
Delete water and hydroxide where it is not needed and add in the
appropriate coefficients.
NiO2(s)+H2O(l)+OH-(aq)+e-...
2. Balance the following chemical reaction in basic conditions using the lowest possible whole number coefficients....
2. Balance the following chemical reaction in basic conditions using the lowest possible whole number coefficients. (Enter coefficients for one and zero- blanks will be marked incorrect.) Unbalanced Reaction: ClO4−(aq) + Ni(OH)2(s) → ClO3−(aq) + NiO2(s) Balanced Reaction: ClO4−(aq) + Ni(OH)2(s) + H2O(l) + OH−(aq) + H+(aq) → ClO3−(aq) + NiO2(s) + H2O(l) + OH−(aq) + H+(aq) Incorrect. Tries 1/13 Previous Tries
Balance the following chemical equation? Ca(OH)2(aq)+HNO3(aq)→H2O(l)+Ca(NO3)2(aq) Express your answer as a chemical equation. Identify all of...
Balance the following chemical equation? Ca(OH)2(aq)+HNO3(aq)→H2O(l)+Ca(NO3)2(aq) Express your answer as a chemical equation. Identify all of the phases in your answer?
Consider the following reaction: Ba(OH)2 (aq) + H2SO4 (aq) ⟶ BaSO4 (s) + 2 H2O (l)...
Consider the following reaction: Ba(OH)2 (aq) + H2SO4 (aq) ⟶ BaSO4 (s) + 2 H2O (l) If you add an excess of sulfuric acid to 85.67 g of barium hydroxide, how many grams of water will you expect to produce?
****** Balance all of the following equations******* Part A Na2CO3(aq)+HCl(aq)→NaCl(aq)+H2O(l)+CO2(g)Na2CO3(aq)+HCl(aq)→NaCl(aq)+H2O(l)+CO2(g) Express your answer as a chemical...
****** Balance all of the following equations******* Part A Na2CO3(aq)+HCl(aq)→NaCl(aq)+H2O(l)+CO2(g)Na2CO3(aq)+HCl(aq)→NaCl(aq)+H2O(l)+CO2(g) Express your answer as a chemical equation. Identify all of the phases in your answer. Part B Submit Request Answer HgO(s)→Hg(l)+O2(g)HgO(s)→Hg(l)+O2(g) Express your answer as a chemical equation. Identify all of the phases in your answer. Part C Submit Request Answer Fe(s)+O2(g)→Fe2O3(s)Fe(s)+O2(g)→Fe2O3(s) Express your answer as a chemical equation. Identify all of the phases in your answer. Part D Submit Request Answer Na(s)+Cl2(g)→NaCl(s)Na(s)+Cl2(g)→NaCl(s) Express your answer as a chemical equation....
Part A (acidic) HfO2 (s) → Hf(s) Express your answer as a half-reaction including electrons and phases. AJO O ? Submit...
Part A (acidic) HfO2 (s) → Hf(s) Express your answer as a half-reaction including electrons and phases. AJO O ? Submit Previous Answers Request Answer X Incorrect; Try Again; 2 attempts remaining Part B (basic) Ni(OH)2 (s) → Ni2O3 (s) Express your answer as a half-reaction including electrons and phases. Part C (acidic) NO3 - (aq) + NO2 (g) Express your answer as a half-reaction including electrons and phases. = AED P ? NO2 (aq) + 2H+ (aq) + e...
For the following reaction: NiO2(s) + 4 H+(aq) + 2 Ag(s) → Ni2+(aq) + 2 H2O(l)...
For the following reaction: NiO2(s) + 4 H+(aq) + 2 Ag(s) → Ni2+(aq) + 2 H2O(l) + 2 Ag+(aq) ℰ° = 2.48 V Calculate the pH of the solution if ℰ = 2.39 V and [Ag+] = [Ni2+] = 0.029 M. (See this table.)
For the following reaction: NiO2(s) + 4 H+(aq) + 2 Ag(s) → Ni2+(aq) + 2 H2O(l)...
For the following reaction: NiO2(s) + 4 H+(aq) + 2 Ag(s) → Ni2+(aq) + 2 H2O(l) + 2 Ag+(aq) ℰ° = 2.48 V Calculate the pH of the solution if ℰ = 2.09 V and [Ag+] = [Ni2+] = 0.045 M. (See this table.)
Which of the following chemical reactions represents the ionization of water? 0 H2O(l) H2O+(aq) + e-...
Which of the following chemical reactions represents the ionization of water? 0 H2O(l) H2O+(aq) + e- O H+(aq) + OH-(aq)= H2O(l) O H2O(l)-H2O-(aq) 2H20 2H2(g)+ 02(8) O H2O(l)-H'(aq) + OH-(aq)
Part A Write balanced complete ionic equation for HCl(aq) + LiOH(aq) + H2O(l) + LiCl(aq) Express...
Part A Write balanced complete ionic equation for HCl(aq) + LiOH(aq) + H2O(l) + LiCl(aq) Express your answer as a chemical equation. Identify all of the phases in your answer AEQC ? H* (aq) + CI+ (aq) + Li+ (aq) + OH(aq)--H, O(1) Submit Previous Answers Request Answer * Incorrect; Try Again; 3 attempts remaining Part B Write balanced complete ionic equation for Cas(aq) + CuCl(aq) - Cus(8) + CaCl(aq) Express your answer as a chemical equation. Identify all of...
The following chemical reaction occurs in a basic solution. Mg2+(aq) + MnO2(aq) + OH−(aq) → Mg(s)...
The following chemical reaction occurs in a basic solution. Mg2+(aq) + MnO2(aq) + OH−(aq) → Mg(s) + MnO4−(aq) + H2O(l) How many moles of electrons are transferred when the equation is balancedusing the smallest whole-number coefficients?
Part A (acidic) HfO2 (s) → Hf(s) Express your answer as a half-reaction including electrons and phases. AJO O ? Submit Previous Answers Request Answer X Incorrect; Try Again; 2 attempts remaining Part B (basic) Ni(OH)2 (s) → Ni2O3 (s) Express your answer as a half-reaction including electrons and phases. Part C (acidic) NO3 - (aq) + NO2 (g) Express your answer as a half-reaction including electrons and phases. = AED P ? NO2 (aq) + 2H+ (aq) + e...
Which of the following chemical reactions represents the ionization of water? 0 H2O(l) H2O+(aq) + e- O H+(aq) + OH-(aq)= H2O(l) O H2O(l)-H2O-(aq) 2H20 2H2(g)+ 02(8) O H2O(l)-H'(aq) + OH-(aq)
Part A Write balanced complete ionic equation for HCl(aq) + LiOH(aq) + H2O(l) + LiCl(aq) Express your answer as a chemical equation. Identify all of the phases in your answer AEQC ? H* (aq) + CI+ (aq) + Li+ (aq) + OH(aq)--H, O(1) Submit Previous Answers Request Answer * Incorrect; Try Again; 3 attempts remaining Part B Write balanced complete ionic equation for Cas(aq) + CuCl(aq) - Cus(8) + CaCl(aq) Express your answer as a chemical equation. Identify all of...
Most questions answered within 3 hours.
-
Where is the error in this code sequence?
String s1 = "Hello";
String s2 = "ello";...
asked 10 months ago -
Financial data for Joel de Paris, Inc., for last year
follow:
Joel de Paris, Inc.
Balance...
asked 10 months ago -
Consider this reaction:
Al2(SO4)3 (aq)+ BaCl3
(aq) Al2Cl6 (aq)- +
3BaSO4(s) . What is the...
asked 10 months ago -
Suppose that Savneet is considering increasing her
recent random sample from 20 car rentals to 40...
asked 10 months ago -
Trucks arrive at an unloading terminal at an average rate of 120
per hour.
Trucks arrive...
asked 10 months ago -
Why are methanol and ethanol completely soluble in water while
octanol is not very little soluble....
asked 10 months ago -
A facilities manager at a university reads in a research report
that the mean amount of...
asked 10 months ago -
When the CuSO4 is rehydrated by adding water to the anhydrous
compound, is this an endothermic...
asked 10 months ago -
A ray of sunlight is passing from diamond into crown glass; the
angle of incidence is...
asked 10 months ago -
A block of mass 0.249 kg is placed on top of a light, vertical
spring of...
asked 10 months ago -
how do the kidneys compensate in the presences of acidosis
a) trigger hyperventilate
b) reserve acid...
asked 10 months ago -
Question 501 pts
The rental rate of capital to the firm increases. Which of the
following...
asked 10 months ago